SUBROUTINE slRFRO ( ZOBS, HM, TDK, PMB, RH, WL, PHI, TLR, : EPS, REF ) *+ * - - - - - - * R F R O * - - - - - - * * Atmospheric refraction for radio and optical/IR wavelengths. * * Given: * ZOBS d observed zenith distance of the source (radian) * HM d height of the observer above sea level (metre) * TDK d ambient temperature at the observer (K) * PMB d pressure at the observer (millibar) * RH d relative humidity at the observer (range 0-1) * WL d effective wavelength of the source (micrometre) * PHI d latitude of the observer (radian, astronomical) * TLR d temperature lapse rate in the troposphere (K/metre) * EPS d precision required to terminate iteration (radian) * * Returned: * REF d refraction: in vacuo ZD minus observed ZD (radian) * * Notes: * * 1 A suggested value for the TLR argument is 0.0065D0. The * refraction is significantly affected by TLR, and if studies * of the local atmosphere have been carried out a better TLR * value may be available. The sign of the supplied TLR value * is ignored. * * 2 A suggested value for the EPS argument is 1D-8. The result is * usually at least two orders of magnitude more computationally * precise than the supplied EPS value. * * 3 The routine computes the refraction for zenith distances up * to and a little beyond 90 deg using the method of Hohenkerk * and Sinclair (NAO Technical Notes 59 and 63, subsequently adopted * in the Explanatory Supplement, 1992 edition - see section 3.281). * * 4 The code is a development of the optical/IR refraction subroutine * AREF of C.Hohenkerk (HMNAO, September 1984), with extensions to * support the radio case. Apart from merely cosmetic changes, the * following modifications to the original HMNAO optical/IR refraction * code have been made: * * . The angle arguments have been changed to radians. * * . Any value of ZOBS is allowed (see note 6, below). * * . Other argument values have been limited to safe values. * * . Murray's values for the gas constants have been used * (Vectorial Astrometry, Adam Hilger, 1983). * * . The numerical integration phase has been rearranged for * extra clarity. * * . A better model for Ps(T) has been adopted (taken from * Gill, Atmosphere-Ocean Dynamics, Academic Press, 1982). * * . More accurate expressions for Pwo have been adopted * (again from Gill 1982). * * . The formula for the water vapour pressure, given the * saturation pressure and the relative humidity, is from * Crane (1976), expression 2.5.5. * * . Provision for radio wavelengths has been added using * expressions devised by A.T.Sinclair, RGO (private * communication 1989). The refractivity model currently * used is from J.M.Rueger, "Refractive Index Formulae for * Electronic Distance Measurement with Radio and Millimetre * Waves", in Unisurv Report S-68 (2002), School of Surveying * and Spatial Information Systems, University of New South * Wales, Sydney, Australia. * * . The optical refractivity for dry air is from Resolution 3 of * the International Association of Geodesy adopted at the XXIIth * General Assembly in Birmingham, UK, 1999. * * . Various small changes have been made to gain speed. * * 5 The radio refraction is chosen by specifying WL > 100 micrometres. * Because the algorithm takes no account of the ionosphere, the * accuracy deteriorates at low frequencies, below about 30 MHz. * * 6 Before use, the value of ZOBS is expressed in the range +/- pi. * If this ranged ZOBS is -ve, the result REF is computed from its * absolute value before being made -ve to match. In addition, if * it has an absolute value greater than 93 deg, a fixed REF value * equal to the result for ZOBS = 93 deg is returned, appropriately * signed. * * 7 As in the original Hohenkerk and Sinclair algorithm, fixed values * of the water vapour polytrope exponent, the height of the * tropopause, and the height at which refraction is negligible are * used. * * 8 The radio refraction has been tested against work done by * Iain Coulson, JACH, (private communication 1995) for the * James Clerk Maxwell Telescope, Mauna Kea. For typical conditions, * agreement at the 0.1 arcsec level is achieved for moderate ZD, * worsening to perhaps 0.5-1.0 arcsec at ZD 80 deg. At hot and * humid sea-level sites the accuracy will not be as good. * * 9 It should be noted that the relative humidity RH is formally * defined in terms of "mixing ratio" rather than pressures or * densities as is often stated. It is the mass of water per unit * mass of dry air divided by that for saturated air at the same * temperature and pressure (see Gill 1982). * * 10 The algorithm is designed for observers in the troposphere. The * supplied temperature, pressure and lapse rate are assumed to be * for a point in the troposphere and are used to define a model * atmosphere with the tropopause at 11km altitude and a constant * temperature above that. However, in practice, the refraction * values returned for stratospheric observers, at altitudes up to * 25km, are quite usable. * * Called: slDA1P, slATMT, slATMS * * Last revision: 5 December 2005 * * Copyright P.T.Wallace. All rights reserved. * * License: * This program is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by * the Free Software Foundation; either version 2 of the License, or * (at your option) any later version. * * This program is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * GNU General Public License for more details. * * You should have received a copy of the GNU General Public License * along with this program (see SLA_CONDITIONS); if not, write to the * Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, * Boston, MA 02110-1301 USA * * Copyright (C) 1995 Association of Universities for Research in Astronomy Inc. *- IMPLICIT NONE DOUBLE PRECISION ZOBS,HM,TDK,PMB,RH,WL,PHI,TLR,EPS,REF * * Fixed parameters * DOUBLE PRECISION D93,GCR,DMD,DMW,S,DELTA,HT,HS INTEGER ISMAX * 93 degrees in radians PARAMETER (D93=1.623156204D0) * Universal gas constant PARAMETER (GCR=8314.32D0) * Molecular weight of dry air PARAMETER (DMD=28.9644D0) * Molecular weight of water vapour PARAMETER (DMW=18.0152D0) * Mean Earth radius (metre) PARAMETER (S=6378120D0) * Exponent of temperature dependence of water vapour pressure PARAMETER (DELTA=18.36D0) * Height of tropopause (metre) PARAMETER (HT=11000D0) * Upper limit for refractive effects (metre) PARAMETER (HS=80000D0) * Numerical integration: maximum number of strips. PARAMETER (ISMAX=16384) INTEGER IS,K,N,I,J LOGICAL OPTIC,LOOP DOUBLE PRECISION ZOBS1,ZOBS2,HMOK,TDKOK,PMBOK,RHOK,WLOK,ALPHA, : TOL,WLSQ,GB,A,GAMAL,GAMMA,GAMM2,DELM2, : TDC,PSAT,PWO,W, : C1,C2,C3,C4,C5,C6,R0,TEMPO,DN0,RDNDR0,SK0,F0, : RT,TT,DNT,RDNDRT,SINE,ZT,FT,DNTS,RDNDRP,ZTS,FTS, : RS,DNS,RDNDRS,ZS,FS,REFOLD,Z0,ZRANGE,FB,FF,FO,FE, : H,R,SZ,RG,DR,TG,DN,RDNDR,T,F,REFP,REFT DOUBLE PRECISION slDA1P * The refraction integrand DOUBLE PRECISION REFI REFI(DN,RDNDR) = RDNDR/(DN+RDNDR) * Transform ZOBS into the normal range. ZOBS1 = slDA1P(ZOBS) ZOBS2 = MIN(ABS(ZOBS1),D93) * Keep other arguments within safe bounds. HMOK = MIN(MAX(HM,-1D3),HS) TDKOK = MIN(MAX(TDK,100D0),500D0) PMBOK = MIN(MAX(PMB,0D0),10000D0) RHOK = MIN(MAX(RH,0D0),1D0) WLOK = MAX(WL,0.1D0) ALPHA = MIN(MAX(ABS(TLR),0.001D0),0.01D0) * Tolerance for iteration. TOL = MIN(MAX(ABS(EPS),1D-12),0.1D0)/2D0 * Decide whether optical/IR or radio case - switch at 100 microns. OPTIC = WLOK.LE.100D0 * Set up model atmosphere parameters defined at the observer. WLSQ = WLOK*WLOK GB = 9.784D0*(1D0-0.0026D0*COS(PHI+PHI)-0.00000028D0*HMOK) IF (OPTIC) THEN A = (287.6155D0+(1.62887D0+0.01360D0/WLSQ)/WLSQ) : *273.15D-6/1013.25D0 ELSE A = 77.6890D-6 END IF GAMAL = (GB*DMD)/GCR GAMMA = GAMAL/ALPHA GAMM2 = GAMMA-2D0 DELM2 = DELTA-2D0 TDC = TDKOK-273.15D0 PSAT = 10D0**((0.7859D0+0.03477D0*TDC)/(1D0+0.00412D0*TDC))* : (1D0+PMBOK*(4.5D-6+6D-10*TDC*TDC)) IF (PMBOK.GT.0D0) THEN PWO = RHOK*PSAT/(1D0-(1D0-RHOK)*PSAT/PMBOK) ELSE PWO = 0D0 END IF W = PWO*(1D0-DMW/DMD)*GAMMA/(DELTA-GAMMA) C1 = A*(PMBOK+W)/TDKOK IF (OPTIC) THEN C2 = (A*W+11.2684D-6*PWO)/TDKOK ELSE C2 = (A*W+6.3938D-6*PWO)/TDKOK END IF C3 = (GAMMA-1D0)*ALPHA*C1/TDKOK C4 = (DELTA-1D0)*ALPHA*C2/TDKOK IF (OPTIC) THEN C5 = 0D0 C6 = 0D0 ELSE C5 = 375463D-6*PWO/TDKOK C6 = C5*DELM2*ALPHA/(TDKOK*TDKOK) END IF * Conditions at the observer. R0 = S+HMOK CALL slATMT(R0,TDKOK,ALPHA,GAMM2,DELM2,C1,C2,C3,C4,C5,C6, : R0,TEMPO,DN0,RDNDR0) SK0 = DN0*R0*SIN(ZOBS2) F0 = REFI(DN0,RDNDR0) * Conditions in the troposphere at the tropopause. RT = S+MAX(HT,HMOK) CALL slATMT(R0,TDKOK,ALPHA,GAMM2,DELM2,C1,C2,C3,C4,C5,C6, : RT,TT,DNT,RDNDRT) SINE = SK0/(RT*DNT) ZT = ATAN2(SINE,SQRT(MAX(1D0-SINE*SINE,0D0))) FT = REFI(DNT,RDNDRT) * Conditions in the stratosphere at the tropopause. CALL slATMS(RT,TT,DNT,GAMAL,RT,DNTS,RDNDRP) SINE = SK0/(RT*DNTS) ZTS = ATAN2(SINE,SQRT(MAX(1D0-SINE*SINE,0D0))) FTS = REFI(DNTS,RDNDRP) * Conditions at the stratosphere limit. RS = S+HS CALL slATMS(RT,TT,DNT,GAMAL,RS,DNS,RDNDRS) SINE = SK0/(RS*DNS) ZS = ATAN2(SINE,SQRT(MAX(1D0-SINE*SINE,0D0))) FS = REFI(DNS,RDNDRS) * Variable initialization to avoid compiler warning. REFT = 0D0 * Integrate the refraction integral in two parts; first in the * troposphere (K=1), then in the stratosphere (K=2). DO K = 1,2 * Initialize previous refraction to ensure at least two iterations. REFOLD = 1D0 * Start off with 8 strips. IS = 8 * Start Z, Z range, and start and end values. IF (K.EQ.1) THEN Z0 = ZOBS2 ZRANGE = ZT-Z0 FB = F0 FF = FT ELSE Z0 = ZTS ZRANGE = ZS-Z0 FB = FTS FF = FS END IF * Sums of odd and even values. FO = 0D0 FE = 0D0 * First time through the loop we have to do every point. N = 1 * Start of iteration loop (terminates at specified precision). LOOP = .TRUE. DO WHILE (LOOP) * Strip width. H = ZRANGE/DBLE(IS) * Initialize distance from Earth centre for quadrature pass. IF (K.EQ.1) THEN R = R0 ELSE R = RT END IF * One pass (no need to compute evens after first time). DO I=1,IS-1,N * Sine of observed zenith distance. SZ = SIN(Z0+H*DBLE(I)) * Find R (to the nearest metre, maximum four iterations). IF (SZ.GT.1D-20) THEN W = SK0/SZ RG = R DR = 1D6 J = 0 DO WHILE (ABS(DR).GT.1D0.AND.J.LT.4) J=J+1 IF (K.EQ.1) THEN CALL slATMT(R0,TDKOK,ALPHA,GAMM2,DELM2, : C1,C2,C3,C4,C5,C6,RG,TG,DN,RDNDR) ELSE CALL slATMS(RT,TT,DNT,GAMAL,RG,DN,RDNDR) END IF DR = (RG*DN-W)/(DN+RDNDR) RG = RG-DR END DO R = RG END IF * Find the refractive index and integrand at R. IF (K.EQ.1) THEN CALL slATMT(R0,TDKOK,ALPHA,GAMM2,DELM2, : C1,C2,C3,C4,C5,C6,R,T,DN,RDNDR) ELSE CALL slATMS(RT,TT,DNT,GAMAL,R,DN,RDNDR) END IF F = REFI(DN,RDNDR) * Accumulate odd and (first time only) even values. IF (N.EQ.1.AND.MOD(I,2).EQ.0) THEN FE = FE+F ELSE FO = FO+F END IF END DO * Evaluate the integrand using Simpson's Rule. REFP = H*(FB+4D0*FO+2D0*FE+FF)/3D0 * Has the required precision been achieved (or can't be)? IF (ABS(REFP-REFOLD).GT.TOL.AND.IS.LT.ISMAX) THEN * No: prepare for next iteration. * Save current value for convergence test. REFOLD = REFP * Double the number of strips. IS = IS+IS * Sum of all current values = sum of next pass's even values. FE = FE+FO * Prepare for new odd values. FO = 0D0 * Skip even values next time. N = 2 ELSE * Yes: save troposphere component and terminate the loop. IF (K.EQ.1) REFT = REFP LOOP = .FALSE. END IF END DO END DO * Result. REF = REFT+REFP IF (ZOBS1.LT.0D0) REF = -REF END