aboutsummaryrefslogtreecommitdiff
path: root/math/ieee
diff options
context:
space:
mode:
authorJoseph Hunkeler <jhunkeler@gmail.com>2015-07-08 20:46:52 -0400
committerJoseph Hunkeler <jhunkeler@gmail.com>2015-07-08 20:46:52 -0400
commitfa080de7afc95aa1c19a6e6fc0e0708ced2eadc4 (patch)
treebdda434976bc09c864f2e4fa6f16ba1952b1e555 /math/ieee
downloadiraf-linux-fa080de7afc95aa1c19a6e6fc0e0708ced2eadc4.tar.gz
Initial commit
Diffstat (limited to 'math/ieee')
-rw-r--r--math/ieee/README8
-rw-r--r--math/ieee/chap1/README14
-rw-r--r--math/ieee/chap1/const.f114
-rw-r--r--math/ieee/chap1/fast.f73
-rw-r--r--math/ieee/chap1/ffa.f84
-rw-r--r--math/ieee/chap1/ffs.f80
-rw-r--r--math/ieee/chap1/fft842.f116
-rw-r--r--math/ieee/chap1/fftaoh.f82
-rw-r--r--math/ieee/chap1/fftasm.f67
-rw-r--r--math/ieee/chap1/fftohm.f101
-rw-r--r--math/ieee/chap1/fftsoh.f81
-rw-r--r--math/ieee/chap1/fftsym.f84
-rw-r--r--math/ieee/chap1/ford1.f24
-rw-r--r--math/ieee/chap1/ford2.f46
-rw-r--r--math/ieee/chap1/fourea.f98
-rw-r--r--math/ieee/chap1/fr2tr.f15
-rw-r--r--math/ieee/chap1/fr4syn.f109
-rw-r--r--math/ieee/chap1/fr4tr.f118
-rw-r--r--math/ieee/chap1/fsst.f71
-rw-r--r--math/ieee/chap1/iftaoh.f87
-rw-r--r--math/ieee/chap1/iftasm.f77
-rw-r--r--math/ieee/chap1/iftohm.f83
-rw-r--r--math/ieee/chap1/iftsoh.f94
-rw-r--r--math/ieee/chap1/iftsym.f90
-rw-r--r--math/ieee/chap1/inishl.f179
-rw-r--r--math/ieee/chap1/ord1.f24
-rw-r--r--math/ieee/chap1/ord2.f46
-rw-r--r--math/ieee/chap1/r2tr.f16
-rw-r--r--math/ieee/chap1/r2tx.f18
-rw-r--r--math/ieee/chap1/r4syn.f20
-rw-r--r--math/ieee/chap1/r4tr.f18
-rw-r--r--math/ieee/chap1/r4tx.f29
-rw-r--r--math/ieee/chap1/r8syn.f186
-rw-r--r--math/ieee/chap1/r8tr.f201
-rw-r--r--math/ieee/chap1/r8tx.f107
-rw-r--r--math/ieee/chap1/rad4sb.f38
-rw-r--r--math/ieee/chap1/radix4.f488
-rw-r--r--math/ieee/chap1/test/test12.f90
-rw-r--r--math/ieee/chap1/test/test13.f260
-rw-r--r--math/ieee/chap1/test/test17.f147
-rw-r--r--math/ieee/chap1/test/test18.f71
-rw-r--r--math/ieee/chap1/time/time12.f53
-rw-r--r--math/ieee/chap1/time/time17.f53
-rw-r--r--math/ieee/chap1/time/time18.f48
-rw-r--r--math/ieee/chap1/weave1.f371
-rw-r--r--math/ieee/chap1/weave2.f412
-rw-r--r--math/ieee/chap1/wfta.f150
-rw-r--r--math/ieee/d1mach.f256
-rw-r--r--math/ieee/i1mach.f382
-rw-r--r--math/ieee/r1mach.f177
-rw-r--r--math/ieee/uni.c8
51 files changed, 5664 insertions, 0 deletions
diff --git a/math/ieee/README b/math/ieee/README
new file mode 100644
index 00000000..80b30bfd
--- /dev/null
+++ b/math/ieee/README
@@ -0,0 +1,8 @@
+ This directory contians programs and subroutines from the
+text "Programs for Digital Signal Processing" by the IEEE Press.
+Directories of the name "chap*" correspond to each chapter of
+the text.
+ The files "*mach*" are the machine dependent routines which
+should be edited for the hardware which you are going to run the
+routines on. The file "uni.c" is a uniform random number generator,
+not the one from the text, but one which uses the UNIX generator.
diff --git a/math/ieee/chap1/README b/math/ieee/chap1/README
new file mode 100644
index 00000000..bf86b45f
--- /dev/null
+++ b/math/ieee/chap1/README
@@ -0,0 +1,14 @@
+ This directory contains the IEEE routines from Chapter 1 -
+Discrete Fourier Transform Programs. Some of the routines are
+provided here as separete files (fourea.f, wfta.f, ...) but are
+purposely not put into the library, as these routines are not for
+general use (fourea.f is an inefficient, demonstration version;
+wfta.f is the Winograd DFT which is slower than the regular DFT
+and uses far too much memory ona 16-bit machine to be of
+practical use; ...).
+ The directory "test" contains the test routines from the chapter.
+The directory "time" contains some routines to time various of the
+routines.
+ The file "compall" compiles the appropiate routines and then
+"mklib" will make the library, which one will probably want to
+move to "/usr/lib/libieee.a".
diff --git a/math/ieee/chap1/const.f b/math/ieee/chap1/const.f
new file mode 100644
index 00000000..54eb4e41
--- /dev/null
+++ b/math/ieee/chap1/const.f
@@ -0,0 +1,114 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: const
+c computes the multipliers for the various modules
+c-----------------------------------------------------------------------
+c
+ subroutine const(co3,co8,co16,co9,cdc,cdd)
+ double precision dtheta,dtwopi,dsq32,dsq2
+ double precision dcos1,dcos2,dcos3,dcos4
+ double precision dsin1,dsin2,dsin3,dsin4
+ dimension co3(3),co8(8),co16(18),co9(11),cdc(9),cdd(6)
+ dtwopi=8.0d0*datan(1.0d0)
+ dsq32=dsqrt(0.75d0)
+ dsq2=dsqrt(0.5d0)
+c
+c multipliers for the three point module
+c
+ co3(1)=1.0
+ co3(2)=-1.5
+ co3(3)=-dsq32
+c
+c multipliers for the five point module
+c
+ dtheta=dtwopi/5.0d0
+ dcos1=dcos(dtheta)
+ dcos2=dcos(2.0d0*dtheta)
+ dsin1=dsin(dtheta)
+ dsin2=dsin(2.0d0*dtheta)
+ cdd(1)=1.0
+ cdd(2)=-1.25
+ cdd(3)=-dsin1-dsin2
+ cdd(4)=0.5*(dcos1-dcos2)
+ cdd(5)=dsin1-dsin2
+ cdd(6)=dsin2
+c
+c
+c multipliers for the seven point module
+c
+ dtheta=dtwopi/7.0d0
+ dcos1=dcos(dtheta)
+ dcos2=dcos(2.0d0*dtheta)
+ dcos3=dcos(3.0d0*dtheta)
+ dsin1=dsin(dtheta)
+ dsin2=dsin(2.0d0*dtheta)
+ dsin3=dsin(3.0d0*dtheta)
+ cdc(1)=1.0
+ cdc(2)=-7.0d0/6.0d0
+ cdc(3)=-(dsin1+dsin2-dsin3)/3.0d0
+ cdc(4)=(dcos1+dcos2-2.0d0*dcos3)/3.0d0
+ cdc(5)=(2.0d0*dcos1-dcos2-dcos3)/3.0d0
+ cdc(6)=-(2.0d0*dsin1-dsin2+dsin3)/3.0d0
+ cdc(7)=-(dsin1+dsin2+2.0d0*dsin3)/3.0d0
+ cdc(8)=(dcos1-2.0d0*dcos2+dcos3)/3.0d0
+ cdc(9)=-(dsin1-2.0d0*dsin2-dsin3)/3.0d0
+c
+c multipliers for the eight point module
+c
+ co8(1)=1.0
+ co8(2)=1.0
+ co8(3)=1.0
+ co8(4)=-1.0
+ co8(5)=1.0
+ co8(6)=-dsq2
+ co8(7)=-1.0
+ co8(8)=dsq2
+c
+c multipliers for the nine point module
+c
+ dtheta=dtwopi/9.0d0
+ dcos1=dcos(dtheta)
+ dcos2=dcos(2.0d0*dtheta)
+ dcos4=dcos(4.0d0*dtheta)
+ dsin1=dsin(dtheta)
+ dsin2=dsin(2.0d0*dtheta)
+ dsin4=dsin(4.0d0*dtheta)
+ co9(1)=1.0
+ co9(2)=-1.5
+ co9(3)=-dsq32
+ co9(4)=0.5
+ co9(5)=(2.0d0*dcos1-dcos2-dcos4)/3.0d0
+ co9(6)=(dcos1-2.0d0*dcos2+dcos4)/3.0d0
+ co9(7)=(dcos1+dcos2-2.0d0*dcos4)/3.0d0
+ co9(8)=-(2.0d0*dsin1+dsin2-dsin4)/3.0d0
+ co9(9)=-(dsin1+2.0d0*dsin2+dsin4)/3.0d0
+ co9(10)=-(dsin1-dsin2-2.0d0*dsin4)/3.0d0
+ co9(11)=-dsq32
+c
+c multipliers for the sixteen point module
+c
+ dtheta=dtwopi/16.0d0
+ dcos1=dcos(dtheta)
+ dcos3=dcos(3.0d0*dtheta)
+ dsin1=dsin(dtheta)
+ dsin3=dsin(3.0d0*dtheta)
+ co16(1)=1.0
+ co16(2)=1.0
+ co16(3)=1.0
+ co16(4)=-1.0
+ co16(5)=1.0
+ co16(6)=-dsq2
+ co16(7)=-1.0
+ co16(8)=dsq2
+ co16(9)=1.0
+ co16(10)=-(dsin1-dsin3)
+ co16(11)=-dsq2
+ co16(12)=-co16(10)
+ co16(13)=-1.0
+ co16(14)=-(dsin1+dsin3)
+ co16(15)=dsq2
+ co16(16)=-co16(14)
+ co16(17)=-dsin3
+ co16(18)=dcos3
+ return
+ end
diff --git a/math/ieee/chap1/fast.f b/math/ieee/chap1/fast.f
new file mode 100644
index 00000000..9a0ad713
--- /dev/null
+++ b/math/ieee/chap1/fast.f
@@ -0,0 +1,73 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fast
+c replaces the real vector b(k), for k=1,2,...,n,
+c with its finite discrete fourier transform
+c-----------------------------------------------------------------------
+c
+ subroutine fast(b, n)
+c
+c the dc term is returned in location b(1) with b(2) set to 0.
+c thereafter the jth harmonic is returned as a complex
+c number stored as b(2*j+1) + i b(2*j+2).
+c the n/2 harmonic is returned in b(n+1) with b(n+2) set to 0.
+c hence, b must be dimensioned to size n+2.
+c the subroutine is called as fast(b,n) where n=2**m and
+c b is the real array described above.
+c
+ dimension b(2)
+ common /cons/ pii, p7, p7two, c22, s22, pi2
+c
+c iw is a machine dependent write device number
+c
+ iw = i1mach(2)
+c
+ pii = 4.*atan(1.)
+ pi8 = pii/8.
+ p7 = 1./sqrt(2.)
+ p7two = 2.*p7
+ c22 = cos(pi8)
+ s22 = sin(pi8)
+ pi2 = 2.*pii
+ do 10 i=1,15
+ m = i
+ nt = 2**i
+ if (n.eq.nt) go to 20
+ 10 continue
+ write (iw,9999)
+9999 format (33h n is not a power of two for fast)
+ stop
+ 20 n4pow = m/2
+c
+c do a radix 2 iteration first if one is required.
+c
+ if (m-n4pow*2) 40, 40, 30
+ 30 nn = 2
+ int = n/nn
+ call fr2tr(int, b(1), b(int+1))
+ go to 50
+ 40 nn = 1
+c
+c perform radix 4 iterations.
+c
+ 50 if (n4pow.eq.0) go to 70
+ do 60 it=1,n4pow
+ nn = nn*4
+ int = n/nn
+ call fr4tr(int, nn, b(1), b(int+1), b(2*int+1), b(3*int+1),
+ * b(1), b(int+1), b(2*int+1), b(3*int+1))
+ 60 continue
+c
+c perform in-place reordering.
+c
+ 70 call ford1(m, b)
+ call ford2(m, b)
+ t = b(2)
+ b(2) = 0.
+ b(n+1) = t
+ b(n+2) = 0.
+ do 80 it=4,n,2
+ b(it) = -b(it)
+ 80 continue
+ return
+ end
diff --git a/math/ieee/chap1/ffa.f b/math/ieee/chap1/ffa.f
new file mode 100644
index 00000000..dd62ea01
--- /dev/null
+++ b/math/ieee/chap1/ffa.f
@@ -0,0 +1,84 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: ffa
+c fast fourier analysis subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine ffa(b, nfft)
+c
+c this subroutine replaces the real vector b(k), (k=1,2,...,n),
+c with its finite discrete fourier transform. the dc term is
+c returned in location b(1) with b(2) set to 0. thereafter, the
+c jth harmonic is returned as a complex number stored as
+c b(2*j+1) + i b(2*j+2). note that the n/2 harmonic is returned
+c in b(n+1) with b(n+2) set to 0. hence, b must be dimensioned
+c to size n+2.
+c subroutine is called as ffa (b,n) where n=2**m and b is an
+c n term real array. a real-valued, radix 8 algorithm is used
+c with in-place reordering and the trig functions are computed as
+c needed.
+c
+ dimension b(2)
+ common /con/ pii, p7, p7two, c22, s22, pi2
+c
+c iw is a machine dependent write device number
+c
+ iw = i1mach(2)
+c
+ pii = 4.*atan(1.)
+ pi8 = pii/8.
+ p7 = 1./sqrt(2.)
+ p7two = 2.*p7
+ c22 = cos(pi8)
+ s22 = sin(pi8)
+ pi2 = 2.*pii
+ n = 1
+ do 10 i=1,15
+ m = i
+ n = n*2
+ if (n.eq.nfft) go to 20
+ 10 continue
+ write (iw,9999)
+9999 format (30h nfft not a power of 2 for ffa)
+ stop
+ 20 continue
+ n8pow = m/3
+c
+c do a radix 2 or radix 4 iteration first if one is required
+c
+ if (m-n8pow*3-1) 50, 40, 30
+ 30 nn = 4
+ int = n/nn
+ call r4tr(int, b(1), b(int+1), b(2*int+1), b(3*int+1))
+ go to 60
+ 40 nn = 2
+ int = n/nn
+ call r2tr(int, b(1), b(int+1))
+ go to 60
+ 50 nn = 1
+c
+c perform radix 8 iterations
+c
+ 60 if (n8pow) 90, 90, 70
+ 70 do 80 it=1,n8pow
+ nn = nn*8
+ int = n/nn
+ call r8tr(int, nn, b(1), b(int+1), b(2*int+1), b(3*int+1),
+ * b(4*int+1), b(5*int+1), b(6*int+1), b(7*int+1), b(1),
+ * b(int+1), b(2*int+1), b(3*int+1), b(4*int+1), b(5*int+1),
+ * b(6*int+1), b(7*int+1))
+ 80 continue
+c
+c perform in-place reordering
+c
+ 90 call ord1(m, b)
+ call ord2(m, b)
+ t = b(2)
+ b(2) = 0.
+ b(nfft+1) = t
+ b(nfft+2) = 0.
+ do 100 i=4,nfft,2
+ b(i) = -b(i)
+ 100 continue
+ return
+ end
diff --git a/math/ieee/chap1/ffs.f b/math/ieee/chap1/ffs.f
new file mode 100644
index 00000000..2858fdb0
--- /dev/null
+++ b/math/ieee/chap1/ffs.f
@@ -0,0 +1,80 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: ffs
+c fast fourier synthesis subroutine
+c radix 8-4-2
+c-----------------------------------------------------------------------
+c
+ subroutine ffs(b, nfft)
+c
+c this subroutine synthesizes the real vector b(k), where
+c k=1,2,...,n. the initial fourier coefficients are placed in
+c the b array of size n+2. the dc term is in b(1) with
+c b(2) equal to 0.
+c the jth harmonic is stored as b(2*j+1) + i b(2*j+2).
+c the n/2 harmonic is in b(n+1) with b(n+2) equal to 0.
+c the subroutine is called as ffs(b,n) where n=2**m and
+c b is the n term real array discussed above.
+c
+ dimension b(2)
+ common /con1/ pii, p7, p7two, c22, s22, pi2
+c
+c iw is a machine dependent write device number
+c
+ iw = i1mach(2)
+c
+ pii = 4.*atan(1.)
+ pi8 = pii/8.
+ p7 = 1./sqrt(2.)
+ p7two = 2.*p7
+ c22 = cos(pi8)
+ s22 = sin(pi8)
+ pi2 = 2.*pii
+ n = 1
+ do 10 i=1,15
+ m = i
+ n = n*2
+ if (n.eq.nfft) go to 20
+ 10 continue
+ write (iw,9999)
+9999 format (30h nfft not a power of 2 for ffs)
+ stop
+ 20 continue
+ b(2) = b(nfft+1)
+ do 30 i=1,nfft
+ b(i) = b(i)/float(nfft)
+ 30 continue
+ do 40 i=4,nfft,2
+ b(i) = -b(i)
+ 40 continue
+ n8pow = m/3
+c
+c reorder the input fourier coefficients
+c
+ call ord2(m, b)
+ call ord1(m, b)
+c
+ if (n8pow.eq.0) go to 60
+c
+c perform the radix 8 iterations
+c
+ nn = n
+ do 50 it=1,n8pow
+ int = n/nn
+ call r8syn(int, nn, b, b(int+1), b(2*int+1), b(3*int+1),
+ * b(4*int+1), b(5*int+1), b(6*int+1), b(7*int+1), b(1),
+ * b(int+1), b(2*int+1), b(3*int+1), b(4*int+1), b(5*int+1),
+ * b(6*int+1), b(7*int+1))
+ nn = nn/8
+ 50 continue
+c
+c do a radix 2 or radix 4 iteration if one is required
+c
+ 60 if (m-n8pow*3-1) 90, 80, 70
+ 70 int = n/4
+ call r4syn(int, b(1), b(int+1), b(2*int+1), b(3*int+1))
+ go to 90
+ 80 int = n/2
+ call r2tr(int, b(1), b(int+1))
+ 90 return
+ end
diff --git a/math/ieee/chap1/fft842.f b/math/ieee/chap1/fft842.f
new file mode 100644
index 00000000..37a3a651
--- /dev/null
+++ b/math/ieee/chap1/fft842.f
@@ -0,0 +1,116 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fft842
+c fast fourier transform for n=2**m
+c complex input
+c-----------------------------------------------------------------------
+c
+ subroutine fft842(in, n, x, y)
+c
+c this program replaces the vector z=x+iy by its finite
+c discrete, complex fourier transform if in=0. the inverse transform
+c is calculated for in=1. it performs as many base
+c 8 iterations as possible and then finishes with a base 4 iteration
+c or a base 2 iteration if needed.
+c
+c the subroutine is called as subroutine fft842 (in,n,x,y).
+c the integer n (a power of 2), the n real location array x, and
+c the n real location array y must be supplied to the subroutine.
+c
+ dimension x(2), y(2), l(15)
+ common /con2/ pi2, p7
+ equivalence (l15,l(1)), (l14,l(2)), (l13,l(3)), (l12,l(4)),
+ * (l11,l(5)), (l10,l(6)), (l9,l(7)), (l8,l(8)), (l7,l(9)),
+ * (l6,l(10)), (l5,l(11)), (l4,l(12)), (l3,l(13)), (l2,l(14)),
+ * (l1,l(15))
+c
+c
+c iw is a machine dependent write device number
+c
+ iw = i1mach(2)
+c
+ pi2 = 8.*atan(1.)
+ p7 = 1./sqrt(2.)
+ do 10 i=1,15
+ m = i
+ nt = 2**i
+ if (n.eq.nt) go to 20
+ 10 continue
+ write (iw,9999)
+9999 format (35h n is not a power of two for fft842)
+ stop
+ 20 n2pow = m
+ nthpo = n
+ fn = nthpo
+ if (in.eq.1) go to 40
+ do 30 i=1,nthpo
+ y(i) = -y(i)
+ 30 continue
+ 40 n8pow = n2pow/3
+ if (n8pow.eq.0) go to 60
+c
+c radix 8 passes,if any.
+c
+ do 50 ipass=1,n8pow
+ nxtlt = 2**(n2pow-3*ipass)
+ lengt = 8*nxtlt
+ call r8tx(nxtlt, nthpo, lengt, x(1), x(nxtlt+1), x(2*nxtlt+1),
+ * x(3*nxtlt+1), x(4*nxtlt+1), x(5*nxtlt+1), x(6*nxtlt+1),
+ * x(7*nxtlt+1), y(1), y(nxtlt+1), y(2*nxtlt+1), y(3*nxtlt+1),
+ * y(4*nxtlt+1), y(5*nxtlt+1), y(6*nxtlt+1), y(7*nxtlt+1))
+ 50 continue
+c
+c is there a four factor left
+c
+ 60 if (n2pow-3*n8pow-1) 90, 70, 80
+c
+c go through the base 2 iteration
+c
+c
+ 70 call r2tx(nthpo, x(1), x(2), y(1), y(2))
+ go to 90
+c
+c go through the base 4 iteration
+c
+ 80 call r4tx(nthpo, x(1), x(2), x(3), x(4), y(1), y(2), y(3), y(4))
+c
+ 90 do 110 j=1,15
+ l(j) = 1
+ if (j-n2pow) 100, 100, 110
+ 100 l(j) = 2**(n2pow+1-j)
+ 110 continue
+ ij = 1
+ do 130 j1=1,l1
+ do 130 j2=j1,l2,l1
+ do 130 j3=j2,l3,l2
+ do 130 j4=j3,l4,l3
+ do 130 j5=j4,l5,l4
+ do 130 j6=j5,l6,l5
+ do 130 j7=j6,l7,l6
+ do 130 j8=j7,l8,l7
+ do 130 j9=j8,l9,l8
+ do 130 j10=j9,l10,l9
+ do 130 j11=j10,l11,l10
+ do 130 j12=j11,l12,l11
+ do 130 j13=j12,l13,l12
+ do 130 j14=j13,l14,l13
+ do 130 ji=j14,l15,l14
+ if (ij-ji) 120, 130, 130
+ 120 r = x(ij)
+ x(ij) = x(ji)
+ x(ji) = r
+ fi = y(ij)
+ y(ij) = y(ji)
+ y(ji) = fi
+ 130 ij = ij + 1
+ if (in.eq.1) go to 150
+ do 140 i=1,nthpo
+ y(i) = -y(i)
+ 140 continue
+ go to 170
+ 150 do 160 i=1,nthpo
+ x(i) = x(i)/fn
+ y(i) = y(i)/fn
+ 160 continue
+ 170 return
+ end
diff --git a/math/ieee/chap1/fftaoh.f b/math/ieee/chap1/fftaoh.f
new file mode 100644
index 00000000..f703c98b
--- /dev/null
+++ b/math/ieee/chap1/fftaoh.f
@@ -0,0 +1,82 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fftaoh
+c compute dft for real, antisymmetric, odd harmonic, n-point sequence
+c using n/4-point fft
+c antisymmetric sequence means x(m)=-x(n-m), m=1,...,n/2-1
+c odd harmonic means x(2*k)=0, all k, where x(k) is the dft of x(m)
+c x(m) has the property x(m)=x(n/2-m), m=0,1,...,n/4-1, x(0)=0
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine fftaoh(x, n, y)
+ dimension x(1), y(1)
+c
+c x = real array which on input contains the (n/4+1) points of the
+c input sequence (antisymmetrical)
+c on output x contains the n/4 imaginary points of the odd
+c harmonics of the transform of the input--i.e. the zero
+c valued real parts are not given nor are the zero-valued
+c even harmonics
+c n = true size of input
+c y = scratch array of size n/4+2
+c
+c
+c handle n = 2 and n = 4 cases separately
+c
+ if (n.gt.4) go to 20
+ if (n.eq.4) go to 10
+c
+c for n=2, assume x(1)=0, x(2)=0, compute dft directly
+c
+ x(1) = 0.
+ return
+c
+c n = 4 case, assume x(1)=x(3)=0, x(2)=-x(4)=x0, compute dft directly
+c
+ 10 x(1) = -2.*x(2)
+ return
+ 20 twopi = 8.*atan(1.0)
+c
+c form new sequence, y(m)=x(2*m)+(x(2*m+1)-x(2*m-1))
+c
+ no2 = n/2
+ no4 = n/4
+ no8 = n/8
+ if (no8.eq.1) go to 40
+ do 30 i=2,no8
+ ind = 2*i
+ t1 = x(ind) - x(ind-2)
+ y(i) = x(ind-1) + t1
+ ind1 = n/4 + 2 - i
+ y(ind1) = x(ind-1) - t1
+ 30 continue
+ 40 y(1) = 2.*x(2)
+ y(no8+1) = x(no4+1)
+c
+c the sequence y (n/4 points) has only odd harmonics
+c call subroutine fftohm to exploit odd harmonics
+c
+ call fftohm(y, no2)
+c
+c form original dft from complex odd harmonics of y(k)
+c by unscrambling y(k)
+c
+ tpn = twopi/float(n)
+ cosi = 2.*cos(tpn)
+ sini = 2.*sin(tpn)
+ cosd = cos(tpn*2.)
+ sind = sin(tpn*2.)
+ do 50 i=1,no8
+ ind = 2*i
+ bk = y(ind-1)/sini
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ ak = y(ind)
+ x(i) = ak - bk
+ ind1 = n/4 + 1 - i
+ x(ind1) = -ak - bk
+ 50 continue
+ return
+ end
diff --git a/math/ieee/chap1/fftasm.f b/math/ieee/chap1/fftasm.f
new file mode 100644
index 00000000..30c84b79
--- /dev/null
+++ b/math/ieee/chap1/fftasm.f
@@ -0,0 +1,67 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fftasm
+c compute dft for real, antisymmetric, n-point sequence x(m) using
+c n/2-point fft
+c antisymmetric sequence means x(m)=-x(n-m), m=1,...,n/2-1
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine fftasm(x, n, y)
+ dimension x(1), y(1)
+c
+c x = real array which on input contains the n/2 points of the
+c input sequence (asymmetrical)
+c on output x contains the n/2+1 imaginary points of the transform
+c of the input--i.e. the zero valued real parts are not returned
+c n = true size of input
+c y = scratch array of size n/2+2
+c
+c
+c for n = 2, assume x(1)=0, x(2)=0, compute dft directly
+c
+ if (n.eq.2) go to 30
+ twopi = 8.*atan(1.0)
+c
+c form new sequence, y(m)=x(2*m)+(x(2*m+1)-x(2*m-1))
+c
+ no2 = n/2
+ no4 = n/4
+ do 10 i=2,no4
+ ind = 2*i
+ t1 = x(ind) - x(ind-2)
+ y(i) = x(ind-1) + t1
+ ind1 = no2 + 2 - i
+ y(ind1) = -x(ind-1) + t1
+ 10 continue
+ y(1) = 2.*x(2)
+ y(no4+1) = -2.*x(no2)
+c
+c take n/2 point (real) fft of y
+c
+ call fast(y, no2)
+c
+c form original dft by unscrambling y(k)
+c use recursion relation to generate sin(tpn*i) multiplier
+c
+ tpn = twopi/float(n)
+ cosi = 2.*cos(tpn)
+ sini = 2.*sin(tpn)
+ cosd = cosi/2.
+ sind = sini/2.
+ nind = no4 + 1
+ do 20 i=2,nind
+ ind = 2*i
+ bk = y(ind-1)/sini
+ ak = y(ind)
+ x(i) = ak - bk
+ ind1 = no2 + 2 - i
+ x(ind1) = -ak - bk
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ 20 continue
+ 30 x(1) = 0.
+ x(no2+1) = 0.
+ return
+ end
diff --git a/math/ieee/chap1/fftohm.f b/math/ieee/chap1/fftohm.f
new file mode 100644
index 00000000..6e3ecc9d
--- /dev/null
+++ b/math/ieee/chap1/fftohm.f
@@ -0,0 +1,101 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fftohm
+c compute dft for real, n-point, odd harmonic sequences using an
+c n/2 point fft
+c odd harmonic means x(2*k)=0, all k where x(k) is the dft of x(m)
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine fftohm(x, n)
+ dimension x(1)
+c
+c x = real array which on input contains the first n/2 points of the
+c input
+c on output x contains the n/4 complex values of the odd
+c harmonics of the input--stored in the sequence re(x(1)),im(x(1)),
+c re(x(2)),im(x(2)),...
+c ****note: x must be dimensioned to size n/2+2 for fft routine
+c n = true size of x sequence
+c
+c first compute real(x(1)) and real(x(n/2-1)) separately
+c also simultaneously multiply original sequence by sin(twopi*(m-1)/n)
+c sin and cos are computed recursively
+c
+c
+c for n = 2, assume x(1)=x0, x(2)=-x0, compute dft directly
+c
+ if (n.gt.2) go to 10
+ x(1) = 2.*x(1)
+ x(2) = 0.
+ return
+ 10 twopi = 8.*atan(1.0)
+ tpn = twopi/float(n)
+c
+c compute x1=real(x(1)) and x2=imaginary(x(n/2-1))
+c x(n) = x(n)*4.*sin(twopi*(i-1)/n)
+c
+ t1 = 0.
+c
+c cosd and sind are multipliers for recursion for sin and cos
+c cosi and sini are initial conditions for recursion for sin and cos
+c
+ cosd = cos(tpn*2.)
+ sind = sin(tpn*2.)
+ cosi = 1.
+ sini = 0.
+ no2 = n/2
+ do 20 i=1,no2,2
+ t = x(i)*cosi
+ x(i) = x(i)*4.*sini
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ t1 = t1 + t
+ 20 continue
+c
+c reset initial conditions (cosi,sini) for new recursion
+c
+ cosi = cos(tpn)
+ sini = sin(tpn)
+ t2 = 0.
+ do 30 i=2,no2,2
+ t = x(i)*cosi
+ x(i) = x(i)*4.*sini
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ t2 = t2 + t
+ 30 continue
+ x1 = 2.*(t1+t2)
+ x2 = 2.*(t1-t2)
+c
+c take n/2 point (real) fft of preprocessed sequence x
+c
+ call fast(x, no2)
+c
+c for n = 4--skip recursion and initial conditions
+c
+ if (n.eq.4) go to 50
+c
+c initial conditions for recursion
+c
+ x(2) = -x(1)/2.
+ x(1) = x1
+c
+c for n = 8, skip recursion
+c
+ if (n.eq.8) go to 50
+c
+c unscramble y(k) using recursion formula
+c
+ nind = no2 - 2
+ do 40 i=3,nind,2
+ t = x(i)
+ x(i) = x(i-2) + x(i+1)
+ x(i+1) = x(i-1) - t
+ 40 continue
+ 50 x(no2) = x(no2+1)/2.
+ x(no2-1) = x2
+ return
+ end
diff --git a/math/ieee/chap1/fftsoh.f b/math/ieee/chap1/fftsoh.f
new file mode 100644
index 00000000..afc18c17
--- /dev/null
+++ b/math/ieee/chap1/fftsoh.f
@@ -0,0 +1,81 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fftsoh
+c compute dft for real, symmetric, odd harmonic, n-point sequence
+c using n/4-point fft
+c symmetric sequence means x(m)=x(n-m), m=1,...,n/2-1
+c odd harmonic means x(2*k)=0, all k, where x(k) is the dft of x(m)
+c x(m) has the property x(m)=-x(n/2-m), m=0,1,...,n/4-1, x(n/4)=0
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine fftsoh(x, n, y)
+ dimension x(1), y(1)
+c
+c x = real array which on input contains the n/4 points of the
+c input sequence (symmetrical)
+c on output x contains the n/4 real points of the odd harmonics
+c of the transform of the input--i.e. the zero valued imaginary
+c parts are not given nor are the zero-valued even harmonics
+c n = true size of input
+c y = scratch array of size n/4+2
+c
+c
+c handle n = 2 and n = 4 cases separately
+c
+ if (n.gt.4) go to 20
+ if (n.eq.4) go to 10
+c
+c for n=2, assume x(1)=x0, x(2)=-x0, compute dft directly
+c
+ x(1) = 2.*x(1)
+ return
+c
+c n = 4 case, compute dft directly
+c
+ 10 x(1) = 2.*x(1)
+ return
+ 20 twopi = 8.*atan(1.0)
+c
+c form new sequence, y(m)=x(2*m)+(x(2*m+1)-x(2*m-1))
+c
+ no2 = n/2
+ no4 = n/4
+ no8 = n/8
+ if (no8.eq.1) go to 40
+ do 30 i=2,no8
+ ind = 2*i
+ t1 = x(ind) - x(ind-2)
+ y(i) = x(ind-1) + t1
+ ind1 = n/4 + 2 - i
+ y(ind1) = -x(ind-1) + t1
+ 30 continue
+ 40 y(1) = x(1)
+ y(no8+1) = -2.*x(no4)
+c
+c the sequence y (n/4 points) has only odd harmonics
+c call subroutine fftohm to exploit odd harmonics
+c
+ call fftohm(y, no2)
+c
+c form original dft from complex odd harmonics of y(k)
+c by unscrambling y(k)
+c
+ tpn = twopi/float(n)
+ cosi = 2.*cos(tpn)
+ sini = 2.*sin(tpn)
+ cosd = cos(tpn*2.)
+ sind = sin(tpn*2.)
+ do 50 i=1,no8
+ ind = 2*i
+ bk = y(ind)/sini
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ ak = y(ind-1)
+ x(i) = ak + bk
+ ind1 = n/4 + 1 - i
+ x(ind1) = ak - bk
+ 50 continue
+ return
+ end
diff --git a/math/ieee/chap1/fftsym.f b/math/ieee/chap1/fftsym.f
new file mode 100644
index 00000000..b1e795bb
--- /dev/null
+++ b/math/ieee/chap1/fftsym.f
@@ -0,0 +1,84 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fftsym
+c compute dft for real, symmetric, n-point sequence x(m) using
+c n/2-point fft
+c symmetric sequence means x(m)=x(n-m), m=1,...,n/2-1
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine fftsym(x, n, y)
+ dimension x(1), y(1)
+c
+c x = real array which on input contains the n/2+1 points of the
+c input sequence (symmetrical)
+c on output x contains the n/2+1 real points of the transform of
+c the input--i.e. the zero valued imaginary parts are not returned
+c n = true size of input
+c y = scratch array of size n/2+2
+c
+c
+c for n = 2, compute dft directly
+c
+ if (n.gt.2) go to 10
+ t = x(1) + x(2)
+ x(2) = x(1) - x(2)
+ x(1) = t
+ return
+ 10 twopi = 8.*atan(1.0)
+c
+c first compute b0 term, where b0=sum of odd values of x(m)
+c
+ no2 = n/2
+ no4 = n/4
+ nind = no2 + 1
+ b0 = 0.
+ do 20 i=2,nind,2
+ b0 = b0 + x(i)
+ 20 continue
+ b0 = b0*2.
+c
+c for n = 4 skip recursion loop
+c
+ if (n.eq.4) go to 40
+c
+c form new sequence, y(m)=x(2*m)+(x(2*m+1)-x(2*m-1))
+c
+ do 30 i=2,no4
+ ind = 2*i
+ t1 = x(ind) - x(ind-2)
+ y(i) = x(ind-1) + t1
+ ind1 = no2 + 2 - i
+ y(ind1) = x(ind-1) - t1
+ 30 continue
+ 40 y(1) = x(1)
+ y(no4+1) = x(no2+1)
+c
+c take n/2 point (real) fft of y
+c
+ call fast(y, no2)
+c
+c form original dft by unscrambling y(k)
+c use recursion to give sin(tpn*i) multiplier
+c
+ tpn = twopi/float(n)
+ cosi = 2.*cos(tpn)
+ sini = 2.*sin(tpn)
+ cosd = cosi/2.
+ sind = sini/2.
+ nind = no4 + 1
+ do 50 i=2,nind
+ ind = 2*i
+ bk = y(ind)/sini
+ ak = y(ind-1)
+ x(i) = ak + bk
+ nind1 = n/2 + 2 - i
+ x(nind1) = ak - bk
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ 50 continue
+ x(1) = b0 + y(1)
+ x(no2+1) = y(1) - b0
+ return
+ end
diff --git a/math/ieee/chap1/ford1.f b/math/ieee/chap1/ford1.f
new file mode 100644
index 00000000..4982246f
--- /dev/null
+++ b/math/ieee/chap1/ford1.f
@@ -0,0 +1,24 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: ford1
+c in-place reordering subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine ford1(m, b)
+ dimension b(2)
+c
+ k = 4
+ kl = 2
+ n = 2**m
+ do 40 j=4,n,2
+ if (k-j) 20, 20, 10
+ 10 t = b(j)
+ b(j) = b(k)
+ b(k) = t
+ 20 k = k - 2
+ if (k-kl) 30, 30, 40
+ 30 k = 2*j
+ kl = j
+ 40 continue
+ return
+ end
diff --git a/math/ieee/chap1/ford2.f b/math/ieee/chap1/ford2.f
new file mode 100644
index 00000000..8ee26d69
--- /dev/null
+++ b/math/ieee/chap1/ford2.f
@@ -0,0 +1,46 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: ford2
+c in-place reordering subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine ford2(m, b)
+ dimension l(15), b(2)
+ equivalence (l15,l(1)), (l14,l(2)), (l13,l(3)), (l12,l(4)),
+ * (l11,l(5)), (l10,l(6)), (l9,l(7)), (l8,l(8)), (l7,l(9)),
+ * (l6,l(10)), (l5,l(11)), (l4,l(12)), (l3,l(13)), (l2,l(14)),
+ * (l1,l(15))
+ n = 2**m
+ l(1) = n
+ do 10 k=2,m
+ l(k) = l(k-1)/2
+ 10 continue
+ do 20 k=m,14
+ l(k+1) = 2
+ 20 continue
+ ij = 2
+ do 40 j1=2,l1,2
+ do 40 j2=j1,l2,l1
+ do 40 j3=j2,l3,l2
+ do 40 j4=j3,l4,l3
+ do 40 j5=j4,l5,l4
+ do 40 j6=j5,l6,l5
+ do 40 j7=j6,l7,l6
+ do 40 j8=j7,l8,l7
+ do 40 j9=j8,l9,l8
+ do 40 j10=j9,l10,l9
+ do 40 j11=j10,l11,l10
+ do 40 j12=j11,l12,l11
+ do 40 j13=j12,l13,l12
+ do 40 j14=j13,l14,l13
+ do 40 ji=j14,l15,l14
+ if (ij-ji) 30, 40, 40
+ 30 t = b(ij-1)
+ b(ij-1) = b(ji-1)
+ b(ji-1) = t
+ t = b(ij)
+ b(ij) = b(ji)
+ b(ji) = t
+ 40 ij = ij + 2
+ return
+ end
diff --git a/math/ieee/chap1/fourea.f b/math/ieee/chap1/fourea.f
new file mode 100644
index 00000000..d412c0e2
--- /dev/null
+++ b/math/ieee/chap1/fourea.f
@@ -0,0 +1,98 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fourea
+c performs cooley-tukey fast fourier transform
+c-----------------------------------------------------------------------
+c
+ subroutine fourea(data, n, isi)
+c
+c the cooley-tukey fast fourier transform in ansi fortran
+c
+c data is a one-dimensional complex array whose length, n, is a
+c power of two. isi is +1 for an inverse transform and -1 for a
+c forward transform. transform values are returned in the input
+c array, replacing the input.
+c transform(j)=sum(data(i)*w**((i-1)*(j-1))), where i and j run
+c from 1 to n and w = exp (isi*2*pi*sqrt(-1)/n). program also
+c computes inverse transform, for which the defining expression
+c is invtr(j)=(1/n)*sum(data(i)*w**((i-1)*(j-1))).
+c running time is proportional to n*log2(n), rather than to the
+c classical n**2.
+c after program by brenner, june 1967. this is a very short version
+c of the fft and is intended mainly for demonstration. programs
+c are available in this collection which run faster and are not
+c restricted to powers of 2 or to one-dimensional arrays.
+c see -- ieee trans audio (june 1967), special issue on fft.
+c
+ complex data(1)
+ complex temp, w
+ ioutd = i1mach(2)
+c
+c check for power of two up to 15
+c
+ nn = 1
+ do 10 i=1,15
+ m = i
+ nn = nn*2
+ if (nn.eq.n) go to 20
+ 10 continue
+ write (ioutd,9999)
+9999 format (30h n not a power of 2 for fourea)
+ stop
+ 20 continue
+c
+ pi = 4.*atan(1.)
+ fn = n
+c
+c this section puts data in bit-reversed order
+c
+ j = 1
+ do 80 i=1,n
+c
+c at this point, i and j are a bit reversed pair (except for the
+c displacement of +1)
+c
+ if (i-j) 30, 40, 40
+c
+c exchange data(i) with data(j) if i.lt.j.
+c
+ 30 temp = data(j)
+ data(j) = data(i)
+ data(i) = temp
+c
+c implement j=j+1, bit-reversed counter
+c
+ 40 m = n/2
+ 50 if (j-m) 70, 70, 60
+ 60 j = j - m
+ m = (m+1)/2
+ go to 50
+ 70 j = j + m
+ 80 continue
+c
+c now compute the butterflies
+c
+ mmax = 1
+ 90 if (mmax-n) 100, 130, 130
+ 100 istep = 2*mmax
+ do 120 m=1,mmax
+ theta = pi*float(isi*(m-1))/float(mmax)
+ w = cmplx(cos(theta),sin(theta))
+ do 110 i=m,n,istep
+ j = i + mmax
+ temp = w*data(j)
+ data(j) = data(i) - temp
+ data(i) = data(i) + temp
+ 110 continue
+ 120 continue
+ mmax = istep
+ go to 90
+ 130 if (isi) 160, 140, 140
+c
+c for inv trans -- isi=1 -- multiply output by 1/n
+c
+ 140 do 150 i=1,n
+ data(i) = data(i)/fn
+ 150 continue
+ 160 return
+ end
diff --git a/math/ieee/chap1/fr2tr.f b/math/ieee/chap1/fr2tr.f
new file mode 100644
index 00000000..24a103ff
--- /dev/null
+++ b/math/ieee/chap1/fr2tr.f
@@ -0,0 +1,15 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fr2tr
+c radix 2 iteration subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine fr2tr(int, b0, b1)
+ dimension b0(2), b1(2)
+ do 10 k=1,int
+ t = b0(k) + b1(k)
+ b1(k) = b0(k) - b1(k)
+ b0(k) = t
+ 10 continue
+ return
+ end
diff --git a/math/ieee/chap1/fr4syn.f b/math/ieee/chap1/fr4syn.f
new file mode 100644
index 00000000..5ce978f0
--- /dev/null
+++ b/math/ieee/chap1/fr4syn.f
@@ -0,0 +1,109 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fr4syn
+c radix 4 synthesis
+c-----------------------------------------------------------------------
+c
+c
+ subroutine fr4syn(int, nn, b0, b1, b2, b3, b4, b5, b6, b7)
+ dimension l(15), b0(2), b1(2), b2(2), b3(2), b4(2), b5(2), b6(2),
+ * b7(2)
+ common /const/ pii, p7, p7two, c22, s22, pi2
+ equivalence (l15,l(1)), (l14,l(2)), (l13,l(3)), (l12,l(4)),
+ * (l11,l(5)), (l10,l(6)), (l9,l(7)), (l8,l(8)), (l7,l(9)),
+ * (l6,l(10)), (l5,l(11)), (l4,l(12)), (l3,l(13)), (l2,l(14)),
+ * (l1,l(15))
+c
+ l(1) = nn/4
+ do 40 k=2,15
+ if (l(k-1)-2) 10, 20, 30
+ 10 l(k-1) = 2
+ 20 l(k) = 2
+ go to 40
+ 30 l(k) = l(k-1)/2
+ 40 continue
+c
+ piovn = pii/float(nn)
+ ji = 3
+ jl = 2
+ jr = 2
+c
+ do 120 j1=2,l1,2
+ do 120 j2=j1,l2,l1
+ do 120 j3=j2,l3,l2
+ do 120 j4=j3,l4,l3
+ do 120 j5=j4,l5,l4
+ do 120 j6=j5,l6,l5
+ do 120 j7=j6,l7,l6
+ do 120 j8=j7,l8,l7
+ do 120 j9=j8,l9,l8
+ do 120 j10=j9,l10,l9
+ do 120 j11=j10,l11,l10
+ do 120 j12=j11,l12,l11
+ do 120 j13=j12,l13,l12
+ do 120 j14=j13,l14,l13
+ do 120 jthet=j14,l15,l14
+ th2 = jthet - 2
+ if (th2) 50, 50, 90
+ 50 do 60 k=1,int
+ t0 = b0(k) + b1(k)
+ t1 = b0(k) - b1(k)
+ t2 = b2(k)*2.0
+ t3 = b3(k)*2.0
+ b0(k) = t0 + t2
+ b2(k) = t0 - t2
+ b1(k) = t1 + t3
+ b3(k) = t1 - t3
+ 60 continue
+c
+ if (nn-4) 120, 120, 70
+ 70 k0 = int*4 + 1
+ kl = k0 + int - 1
+ do 80 k=k0,kl
+ t2 = b0(k) - b2(k)
+ t3 = b1(k) + b3(k)
+ b0(k) = (b0(k)+b2(k))*2.0
+ b2(k) = (b3(k)-b1(k))*2.0
+ b1(k) = (t2+t3)*p7two
+ b3(k) = (t3-t2)*p7two
+ 80 continue
+ go to 120
+ 90 arg = th2*piovn
+ c1 = cos(arg)
+ s1 = -sin(arg)
+ c2 = c1**2 - s1**2
+ s2 = c1*s1 + c1*s1
+ c3 = c1*c2 - s1*s2
+ s3 = c2*s1 + s2*c1
+c
+ int4 = int*4
+ j0 = jr*int4 + 1
+ k0 = ji*int4 + 1
+ jlast = j0 + int - 1
+ do 100 j=j0,jlast
+ k = k0 + j - j0
+ t0 = b0(j) + b6(k)
+ t1 = b7(k) - b1(j)
+ t2 = b0(j) - b6(k)
+ t3 = b7(k) + b1(j)
+ t4 = b2(j) + b4(k)
+ t5 = b5(k) - b3(j)
+ t6 = b5(k) + b3(j)
+ t7 = b4(k) - b2(j)
+ b0(j) = t0 + t4
+ b4(k) = t1 + t5
+ b1(j) = (t2+t6)*c1 - (t3+t7)*s1
+ b5(k) = (t2+t6)*s1 + (t3+t7)*c1
+ b2(j) = (t0-t4)*c2 - (t1-t5)*s2
+ b6(k) = (t0-t4)*s2 + (t1-t5)*c2
+ b3(j) = (t2-t6)*c3 - (t3-t7)*s3
+ b7(k) = (t2-t6)*s3 + (t3-t7)*c3
+ 100 continue
+ jr = jr + 2
+ ji = ji - 2
+ if (ji-jl) 110, 110, 120
+ 110 ji = 2*jr - 1
+ jl = jr
+ 120 continue
+ return
+ end
diff --git a/math/ieee/chap1/fr4tr.f b/math/ieee/chap1/fr4tr.f
new file mode 100644
index 00000000..16ba3fe6
--- /dev/null
+++ b/math/ieee/chap1/fr4tr.f
@@ -0,0 +1,118 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fr4tr
+c radix 4 iteration subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine fr4tr(int, nn, b0, b1, b2, b3, b4, b5, b6, b7)
+ dimension l(15), b0(2), b1(2), b2(2), b3(2), b4(2), b5(2), b6(2),
+ * b7(2)
+ common /cons/ pii, p7, p7two, c22, s22, pi2
+ equivalence (l15,l(1)), (l14,l(2)), (l13,l(3)), (l12,l(4)),
+ * (l11,l(5)), (l10,l(6)), (l9,l(7)), (l8,l(8)), (l7,l(9)),
+ * (l6,l(10)), (l5,l(11)), (l4,l(12)), (l3,l(13)), (l2,l(14)),
+ * (l1,l(15))
+c
+c jthet is a reversed binary counter, jr steps two at a time to
+c locate the real parts of intermediate results, and ji locates
+c the imaginary part corresponding to jr.
+c
+ l(1) = nn/4
+ do 40 k=2,15
+ if (l(k-1)-2) 10, 20, 30
+ 10 l(k-1) = 2
+ 20 l(k) = 2
+ go to 40
+ 30 l(k) = l(k-1)/2
+ 40 continue
+c
+ piovn = pii/float(nn)
+ ji = 3
+ jl = 2
+ jr = 2
+c
+ do 120 j1=2,l1,2
+ do 120 j2=j1,l2,l1
+ do 120 j3=j2,l3,l2
+ do 120 j4=j3,l4,l3
+ do 120 j5=j4,l5,l4
+ do 120 j6=j5,l6,l5
+ do 120 j7=j6,l7,l6
+ do 120 j8=j7,l8,l7
+ do 120 j9=j8,l9,l8
+ do 120 j10=j9,l10,l9
+ do 120 j11=j10,l11,l10
+ do 120 j12=j11,l12,l11
+ do 120 j13=j12,l13,l12
+ do 120 j14=j13,l14,l13
+ do 120 jthet=j14,l15,l14
+ th2 = jthet - 2
+ if (th2) 50, 50, 90
+ 50 do 60 k=1,int
+ t0 = b0(k) + b2(k)
+ t1 = b1(k) + b3(k)
+ b2(k) = b0(k) - b2(k)
+ b3(k) = b1(k) - b3(k)
+ b0(k) = t0 + t1
+ b1(k) = t0 - t1
+ 60 continue
+c
+ if (nn-4) 120, 120, 70
+ 70 k0 = int*4 + 1
+ kl = k0 + int - 1
+ do 80 k=k0,kl
+ pr = p7*(b1(k)-b3(k))
+ pi = p7*(b1(k)+b3(k))
+ b3(k) = b2(k) + pi
+ b1(k) = pi - b2(k)
+ b2(k) = b0(k) - pr
+ b0(k) = b0(k) + pr
+ 80 continue
+ go to 120
+c
+ 90 arg = th2*piovn
+ c1 = cos(arg)
+ s1 = sin(arg)
+ c2 = c1**2 - s1**2
+ s2 = c1*s1 + c1*s1
+ c3 = c1*c2 - s1*s2
+ s3 = c2*s1 + s2*c1
+c
+ int4 = int*4
+ j0 = jr*int4 + 1
+ k0 = ji*int4 + 1
+ jlast = j0 + int - 1
+ do 100 j=j0,jlast
+ k = k0 + j - j0
+ r1 = b1(j)*c1 - b5(k)*s1
+ r5 = b1(j)*s1 + b5(k)*c1
+ t2 = b2(j)*c2 - b6(k)*s2
+ t6 = b2(j)*s2 + b6(k)*c2
+ t3 = b3(j)*c3 - b7(k)*s3
+ t7 = b3(j)*s3 + b7(k)*c3
+ t0 = b0(j) + t2
+ t4 = b4(k) + t6
+ t2 = b0(j) - t2
+ t6 = b4(k) - t6
+ t1 = r1 + t3
+ t5 = r5 + t7
+ t3 = r1 - t3
+ t7 = r5 - t7
+ b0(j) = t0 + t1
+ b7(k) = t4 + t5
+ b6(k) = t0 - t1
+ b1(j) = t5 - t4
+ b2(j) = t2 - t7
+ b5(k) = t6 + t3
+ b4(k) = t2 + t7
+ b3(j) = t3 - t6
+ 100 continue
+c
+ jr = jr + 2
+ ji = ji - 2
+ if (ji-jl) 110, 110, 120
+ 110 ji = 2*jr - 1
+ jl = jr
+ 120 continue
+ return
+ end
diff --git a/math/ieee/chap1/fsst.f b/math/ieee/chap1/fsst.f
new file mode 100644
index 00000000..75ce56cb
--- /dev/null
+++ b/math/ieee/chap1/fsst.f
@@ -0,0 +1,71 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: fsst
+c fourier synthesis subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine fsst(b, n)
+c
+c this subroutine synthesizes the real vector b(k), for
+c k=1,2,...,n, from the fourier coefficients stored in the
+c b array of size n+2. the dc term is in b(1) with b(2) equal
+c to 0. the jth harmonic is stored as b(2*j+1) + i b(2*j+2).
+c the n/2 harmonic is in b(n+1) with b(n+2) equal to 0.
+c the subroutine is called as fsst(b,n) where n=2**m and
+c b is the real array discussed above.
+c
+ dimension b(2)
+ common /const/ pii, p7, p7two, c22, s22, pi2
+c
+c iw is a machine dependent write device number
+c
+ iw = i1mach(2)
+c
+ pii = 4.*atan(1.)
+ pi8 = pii/8.
+ p7 = 1./sqrt(2.)
+ p7two = 2.*p7
+ c22 = cos(pi8)
+ s22 = sin(pi8)
+ pi2 = 2.*pii
+ do 10 i=1,15
+ m = i
+ nt = 2**i
+ if (n.eq.nt) go to 20
+ 10 continue
+ write (iw,9999)
+9999 format (33h n is not a power of two for fsst)
+ stop
+ 20 b(2) = b(n+1)
+ do 30 i=4,n,2
+ b(i) = -b(i)
+ 30 continue
+c
+c scale the input by n
+c
+ do 40 i=1,n
+ b(i) = b(i)/float(n)
+ 40 continue
+ n4pow = m/2
+c
+c scramble the inputs
+c
+ call ford2(m, b)
+ call ford1(m, b)
+c
+ if (n4pow.eq.0) go to 60
+ nn = 4*n
+ do 50 it=1,n4pow
+ nn = nn/4
+ int = n/nn
+ call fr4syn(int, nn, b(1), b(int+1), b(2*int+1), b(3*int+1),
+ * b(1), b(int+1), b(2*int+1), b(3*int+1))
+ 50 continue
+c
+c do a radix 2 iteration if one is required
+c
+ 60 if (m-n4pow*2) 80, 80, 70
+ 70 int = n/2
+ call fr2tr(int, b(1), b(int+1))
+ 80 return
+ end
diff --git a/math/ieee/chap1/iftaoh.f b/math/ieee/chap1/iftaoh.f
new file mode 100644
index 00000000..8cb0a908
--- /dev/null
+++ b/math/ieee/chap1/iftaoh.f
@@ -0,0 +1,87 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: iftaoh
+c compute idft for real, antisymmetric, odd harmonic, n-point sequence
+c using n/4-point fft
+c antisymmetric sequence means x(m)=-x(n-m), m=1,...,n/2-1
+c odd harmonic means x(2*k)=0, all k, where x(k) is the dft of x(m)
+c x(m)has the property x(m)=x(n/2-m), m=0,1,...,n/4-1, x(0)=0
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine iftaoh(x, n, y)
+ dimension x(1), y(1)
+c
+c x = real array which on input contains the n/4 imaginary points
+c of the odd harmonics of the transform of the original time
+c sequence--i.e. the zero valued real parts are not input nor
+c are the zero-valued even harmonics
+c on output x contains the first (n/4+1) points of the original
+c time sequence (antisymmetrical)
+c n = true size of input
+c y = scratch array of size n/4+2
+c
+c
+c handle n = 2 and n = 4 cases separately
+c
+ if (n.gt.4) go to 20
+ if (n.eq.4) go to 10
+c
+c for n=2 assume x(1)=0, x(2)=0, compute idft directly
+c
+ x(1) = 0.
+ return
+c
+c for n=4, assume x(1)=x(3)=0, x(2)=-x(4)=x0, compute idft directly
+c
+ 10 x(2) = -x(1)/2.
+ x(1) = 0.
+ return
+c
+c code for values of n which are multiples of 8
+c
+ 20 twopi = 8.*atan(1.0)
+ no2 = n/2
+ no4 = n/4
+ no8 = n/8
+ tpn = twopi/float(n)
+c
+c scramble original dft (x(k)) to give y(k)
+c use recursion to give sin multipliers
+c
+ cosi = cos(tpn)
+ sini = sin(tpn)
+ cosd = cos(tpn*2.)
+ sind = sin(tpn*2.)
+ do 30 i=1,no8
+ ind = 2*i
+ ind1 = no4 + 1 - i
+ ak = (x(i)-x(ind1))/2.
+ bk = -(x(i)+x(ind1))
+ y(ind) = ak
+ y(ind-1) = bk*sini
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ 30 continue
+c
+c the sequence y(k) is an odd harmonic sequence
+c use subroutine iftohm to give y(m)
+c
+ call iftohm(y, no2)
+c
+c form x sequence from y sequence
+c
+ x(2) = y(1)/2.
+ x(1) = 0.
+ if (n.eq.8) return
+ do 40 i=2,no8
+ ind = 2*i
+ ind1 = no4 + 2 - i
+ x(ind-1) = (y(i)+y(ind1))/2.
+ t1 = (y(i)-y(ind1))/2.
+ x(ind) = t1 + x(ind-2)
+ 40 continue
+ x(no4+1) = y(no8+1)
+ return
+ end
diff --git a/math/ieee/chap1/iftasm.f b/math/ieee/chap1/iftasm.f
new file mode 100644
index 00000000..6ec12c7d
--- /dev/null
+++ b/math/ieee/chap1/iftasm.f
@@ -0,0 +1,77 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: iftasm
+c compute idft for real, antisymmetric, n-point sequence x(m) using
+c n/2-point fft
+c antisymmetric sequence means x(m)=-x(n-m), m=1,...,n/2-1
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine iftasm(x, n, y)
+ dimension x(1), y(1)
+c
+c x = imaginary array which on input contains the n/2+1 real points of
+c the transform of the input--i.e. the zero valued real parts
+c are not given as input
+c on output x contains the n/2 points of the time sequence
+c (antisymmetrical)
+c n = true size of input
+c y = scratch array of size n/2+2
+c
+c
+c for n = 2, assume x(1)=0, x(2)=0
+c
+ if (n.gt.2) go to 10
+ x(1) = 0
+ x(2) = 0
+ return
+ 10 twopi = 8.*atan(1.0)
+c
+c first compute x1=x(1) term directly
+c use recursion on the sine cosine terms
+c
+ no2 = n/2
+ no4 = n/4
+ tpn = twopi/float(n)
+c
+c scramble original dft (x(k)) to give y(k)
+c use recursion relation to give sin(tpn*i) multiplier
+c
+ cosi = cos(tpn)
+ sini = sin(tpn)
+ cosd = cosi
+ sind = sini
+ nind = no4 + 1
+ do 20 i=2,nind
+ ind = 2*i
+ ind1 = no2 + 2 - i
+ ak = (x(i)-x(ind1))/2.
+ bk = -(x(i)+x(ind1))
+ y(ind) = ak
+ y(ind-1) = bk*sini
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ 20 continue
+ y(1) = 0.
+ y(2) = 0.
+c
+c take n/2 point idft of y
+c
+ call fsst(y, no2)
+c
+c form x sequence from y sequence
+c
+ x(2) = y(1)/2.
+ x(1) = 0.
+ if (n.eq.4) go to 40
+ do 30 i=2,no4
+ ind = 2*i
+ ind1 = no2 + 2 - i
+ x(ind-1) = (y(i)-y(ind1))/2.
+ t1 = (y(i)+y(ind1))/2.
+ x(ind) = t1 + x(ind-2)
+ 30 continue
+ 40 x(no2) = -y(no4+1)/2.
+ return
+ end
diff --git a/math/ieee/chap1/iftohm.f b/math/ieee/chap1/iftohm.f
new file mode 100644
index 00000000..df084e87
--- /dev/null
+++ b/math/ieee/chap1/iftohm.f
@@ -0,0 +1,83 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: iftohm
+c compute idft for real, n-point, odd harmonic sequences using an
+c n/2 point fft
+c odd harmonic means x(2*k)=0, all k where x(k) is the dft of x(m)
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine iftohm(x, n)
+ dimension x(1)
+c
+c x = real array which on input contains the n/4 complex values of the
+c odd harmonics of the input--stored in the sequence re(x(1)),
+c im(x(1)),re(x(2)),im(x(2)),...
+c on output x contains the first n/2 points of the input
+c ****note: x must be dimensioned to size n/2+2 for fft routine
+c n = true size of x sequence
+c
+c first compute real(x(1)) and real(x(n/2-1)) separately
+c also simultaneously multiply original sequence by sin(twopi*(m-1)/n)
+c sin and cos are computed recursively
+c
+c
+c for n = 2, assume x(1)=x0, x(2)=-x0, compute idft directly
+c
+ if (n.gt.2) go to 10
+ x(1) = 0.5*x(1)
+ x(2) = -x(1)
+ return
+ 10 twopi = 8.*atan(1.0)
+ tpn = twopi/float(n)
+ no2 = n/2
+ no4 = n/4
+ nind = no2
+c
+c solve for x(0)=x0 directly
+c
+ x0 = 0.
+ do 20 i=1,no2,2
+ x0 = x0 + 2.*x(i)
+ 20 continue
+ x0 = x0/float(n)
+c
+c form y(k)=j*(x(2k+1)-x(2k-1))
+c overwrite x array with y sequence
+c
+ xpr = x(1)
+ xpi = x(2)
+ x(1) = -2.*x(2)
+ x(2) = 0.
+ if (no4.eq.1) go to 40
+ do 30 i=3,nind,2
+ ti = x(i) - xpr
+ tr = -x(i+1) + xpi
+ xpr = x(i)
+ xpi = x(i+1)
+ x(i) = tr
+ x(i+1) = ti
+ 30 continue
+ 40 x(no2+1) = 2.*xpi
+ x(no2+2) = 0.
+c
+c take n/2 point (real) ifft of preprocessed sequence x
+c
+ call fsst(x, no2)
+c
+c solve for x(m) by dividing by 4*sin(twopi*m/n) for m=1,2,...,n/2-1
+c for m=0 substitute precomputed value x0
+c
+ cosi = 4.
+ sini = 0.
+ cosd = cos(tpn)
+ sind = sin(tpn)
+ do 50 i=2,no2
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ x(i) = x(i)/sini
+ 50 continue
+ x(1) = x0
+ return
+ end
diff --git a/math/ieee/chap1/iftsoh.f b/math/ieee/chap1/iftsoh.f
new file mode 100644
index 00000000..6098e6e4
--- /dev/null
+++ b/math/ieee/chap1/iftsoh.f
@@ -0,0 +1,94 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: iftsoh
+c compute idft for real, symmetric, odd harmonic, n-point sequence
+c using n/4-point fft
+c symmetric sequence means x(m)=x(n-m), m=1,...,n/2-1
+c odd harmonic means x(2*k)=0, all k, where x(k) is the dft of x(m)
+c x(m) has the property x(m)=-x(n/2-m), m=0,1,...,n/4-1, x(n/4)=0
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine iftsoh(x, n, y)
+ dimension x(1), y(1)
+c
+c x = real array which on input contains the n/4 real points of
+c the odd harmonics of the transform of the original time sequence
+c i.e. the zero valued imaginary parts are not given nor are the
+c zero valued even harmonics
+c on output x contains the first n/4 points of the original input
+c sequence (symmetrical)
+c n = true size of input
+c y = scratch array of size n/4+2
+c
+c
+c handle n = 2 and n = 4 cases separately
+c
+ if (n.gt.4) go to 10
+c
+c for n=2, 4 assume x(1)=x0, x(2)=-x0, compute idft directly
+c
+ x(1) = x(1)/2.
+ return
+c
+c code for values of n which are multiples of 8
+c
+ 10 twopi = 8.*atan(1.0)
+ no2 = n/2
+ no4 = n/4
+ no8 = n/8
+ tpn = twopi/float(n)
+c
+c first compute x1=x(1) term directly
+c use recursion on the sine cosine terms
+c
+ cosd = cos(tpn*2.)
+ sind = sin(tpn*2.)
+ cosi = 2.*cos(tpn)
+ sini = 2.*sin(tpn)
+ x1 = 0.
+ do 20 i=1,no4
+ x1 = x1 + x(i)*cosi
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ 20 continue
+ x1 = x1/float(n)
+c
+c scramble original dft (x(k)) to give y(k)
+c use recursion relation to give sin multipliers
+c
+ cosi = cos(tpn)
+ sini = sin(tpn)
+ do 30 i=1,no8
+ ind = 2*i
+ ind1 = no4 + 1 - i
+ ak = (x(i)+x(ind1))/2.
+ bk = (x(i)-x(ind1))
+ y(ind-1) = ak
+ y(ind) = bk*sini
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ 30 continue
+c
+c the sequence y(k) is the odd harmonics dft output
+c use subroutine iftohm to obtain y(m), the inverse transform
+c
+ call iftohm(y, no2)
+c
+c form x(m) sequence from y(m) sequence
+c use x1 initial condition on the recursion
+c
+ x(1) = y(1)
+ x(2) = x1
+ if (no8.eq.1) return
+ do 40 i=2,no8
+ ind = 2*i
+ ind1 = no4 + 2 - i
+ t1 = (y(i)+y(ind1))/2.
+ x(ind-1) = (y(i)-y(ind1))/2.
+ x(ind) = t1 + x(ind-2)
+ 40 continue
+ return
+ end
diff --git a/math/ieee/chap1/iftsym.f b/math/ieee/chap1/iftsym.f
new file mode 100644
index 00000000..e45c9a37
--- /dev/null
+++ b/math/ieee/chap1/iftsym.f
@@ -0,0 +1,90 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: iftsym
+c compute idft for real, symmetric, n-point sequence x(m) using
+c n/2-point fft
+c symmetric sequence means x(m)=x(n-m), m=1,...,n/2-1
+c note: index m is sequence index--not fortran index
+c-----------------------------------------------------------------------
+c
+ subroutine iftsym(x, n, y)
+ dimension x(1), y(1)
+c
+c x = real array which on input contains the n/2+1 real points of the
+c transform of the input--i.e. the zero valued imaginary parts
+c are not given as input
+c on output x contains the n/2+1 points of the time sequence
+c (symmetrical)
+c n = true size of input
+c y = scratch array of size n/2+2
+c
+c
+c for n = 2, compute idft directly
+c
+ if (n.gt.2) go to 10
+ t = (x(1)+x(2))/2.
+ x(2) = (x(1)-x(2))/2.
+ x(1) = t
+ return
+ 10 twopi = 8.*atan(1.0)
+c
+c first compute x1=x(1) term directly
+c use recursion on the sine cosine terms
+c
+ no2 = n/2
+ no4 = n/4
+ tpn = twopi/float(n)
+ cosd = cos(tpn)
+ sind = sin(tpn)
+ cosi = 2.
+ sini = 0.
+ x1 = x(1) - x(no2+1)
+ do 20 i=2,no2
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ x1 = x1 + x(i)*cosi
+ 20 continue
+ x1 = x1/float(n)
+c
+c scramble original dft (x(k)) to give y(k)
+c use recursion relation to generate sin(tpn*i) multiplier
+c
+ cosi = cos(tpn)
+ sini = sin(tpn)
+ cosd = cosi
+ sind = sini
+ y(1) = (x(1)+x(no2+1))/2.
+ y(2) = 0.
+ nind = no4 + 1
+ do 30 i=2,nind
+ ind = 2*i
+ nind1 = no2 + 2 - i
+ ak = (x(i)+x(nind1))/2.
+ bk = (x(i)-x(nind1))
+ y(ind-1) = ak
+ y(ind) = bk*sini
+ temp = cosi*cosd - sini*sind
+ sini = cosi*sind + sini*cosd
+ cosi = temp
+ 30 continue
+c
+c take n/2 point idft of y
+c
+ call fsst(y, no2)
+c
+c form x sequence from y sequence
+c
+ x(1) = y(1)
+ x(2) = x1
+ if (n.eq.4) go to 50
+ do 40 i=2,no4
+ ind = 2*i
+ ind1 = no2 + 2 - i
+ x(ind-1) = (y(i)+y(ind1))/2.
+ t1 = (y(i)-y(ind1))/2.
+ x(ind) = t1 + x(ind-2)
+ 40 continue
+ 50 x(no2+1) = y(no4+1)
+ return
+ end
diff --git a/math/ieee/chap1/inishl.f b/math/ieee/chap1/inishl.f
new file mode 100644
index 00000000..925cd657
--- /dev/null
+++ b/math/ieee/chap1/inishl.f
@@ -0,0 +1,179 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: inishl
+c this subroutine initializes the wfta routine for a given
+c value of the transform length n. the factors of n are
+c determined, the multiplication coefficients are calculated
+c and stored in the array coef(.), the input and output
+c permutation vectors are computed and stored in the arrays
+c indx1(.) and indx2(.)
+c
+c-----------------------------------------------------------------------
+c
+ subroutine inishl(n,coef,xr,xi,indx1,indx2,ierr)
+ dimension coef(1),xr(1),xi(1)
+ integer s1,s2,s3,s4,indx1(1),indx2(1),p1
+ dimension co3(3),co4(4),co8(8),co9(11),co16(18),cda(18),cdb(11),
+ 1cdc(9),cdd(6)
+ common na,nb,nc,nd,nd1,nd2,nd3,nd4
+c
+c data statements assign short dft coefficients.
+c
+ data co4(1),co4(2),co4(3),co4(4)/4*1.0/
+c
+ data cda(1),cda(2),cda(3),cda(4),cda(5),cda(6),cda(7),
+ 1 cda(8),cda(9),cda(10),cda(11),cda(12),cda(13),cda(14),
+ 2 cda(15),cda(16),cda(17),cda(18)/18*1.0/
+c
+ data cdb(1),cdb(2),cdb(3),cdb(4),cdb(5),cdb(6),cdb(7),cdb(8),
+ 1 cdb(9),cdb(10),cdb(11)/11*1.0/
+c
+ data ionce/1/
+c
+c get multiplier constants
+c
+ if(ionce.ne.1) go to 20
+ call const(co3,co8,co16,co9,cdc,cdd)
+20 ionce=-1
+c
+c following segment determines factors of n and chooses
+c the appropriate short dft coefficients.
+c
+ iout=i1mach(2)
+ ierr=0
+ nd1=1
+ na=1
+ nb=1
+ nd2=1
+ nc=1
+ nd3=1
+ nd=1
+ nd4=1
+ if(n.le.0 .or. n.gt.5040) go to 190
+ if(16*(n/16).eq.n) go to 30
+ if(8*(n/8).eq.n) go to 40
+ if(4*(n/4).eq.n) go to 50
+ if(2*(n/2).ne.n) go to 70
+ nd1=2
+ na=2
+ cda(2)=1.0
+ go to 70
+30 nd1=18
+ na=16
+ do 31 j=1,18
+31 cda(j)=co16(j)
+ go to 70
+40 nd1=8
+ na=8
+ do 41 j=1,8
+41 cda(j)=co8(j)
+ go to 70
+50 nd1=4
+ na=4
+ do 51 j=1,4
+51 cda(j)=co4(j)
+70 if(3*(n/3).ne.n) go to 120
+ if(9*(n/9).eq.n) go to 100
+ nd2=3
+ nb=3
+ do 71 j=1,3
+71 cdb(j)=co3(j)
+ go to 120
+100 nd2=11
+ nb=9
+ do 110 j=1,11
+110 cdb(j)=co9(j)
+120 if(7*(n/7).ne.n) go to 160
+ nd3=9
+ nc=7
+160 if(5*(n/5).ne.n) go to 190
+ nd4=6
+ nd=5
+190 m=na*nb*nc*nd
+ if(m.eq.n) go to 250
+ write(iout,210)
+210 format(21h this n does not work)
+ ierr=-1
+ return
+c
+c next segment generates the dft coefficients by
+c multiplying together the short dft coefficients
+c
+250 j=1
+ do 300 n4=1,nd4
+ do 300 n3=1,nd3
+ do 300 n2=1,nd2
+ do 300 n1=1,nd1
+ coef(j)=cda(n1)*cdb(n2)*cdc(n3)*cdd(n4)
+ j=j+1
+300 continue
+c
+c following segment forms the input indexing vector
+c
+ j=1
+ nu=nb*nc*nd
+ nv=na*nc*nd
+ nw=na*nb*nd
+ ny=na*nb*nc
+ k=1
+ do 440 n4=1,nd
+ do 430 n3=1,nc
+ do 420 n2=1,nb
+ do 410 n1=1,na
+405 if(k.le.n) go to 408
+ k=k-n
+ go to 405
+408 indx1(j)=k
+ j=j+1
+410 k=k+nu
+420 k=k+nv
+430 k=k+nw
+440 k=k+ny
+c
+c following segment forms the output indexing vector
+c
+ m=1
+ s1=0
+ s2=0
+ s3=0
+ s4=0
+ if(na.eq.1) go to 530
+520 p1=m*nu-1
+ if((p1/na)*na.eq.p1) go to 510
+ m=m+1
+ go to 520
+510 s1=p1+1
+530 if(nb.eq.1) go to 540
+ m=1
+550 p1=m*nv-1
+ if((p1/nb)*nb.eq.p1) go to 560
+ m=m+1
+ go to 550
+560 s2=p1+1
+540 if(nc.eq.1) go to 630
+ m=1
+620 p1=m*nw-1
+ if((p1/nc)*nc.eq.p1) go to 610
+ m=m+1
+ go to 620
+610 s3=p1+1
+630 if(nd.eq.1) go to 660
+ m=1
+640 p1=m*ny-1
+ if((p1/nd)*nd.eq.p1) go to 650
+ m=m+1
+ go to 640
+650 s4=p1+1
+660 j=1
+ do 810 n4=1,nd
+ do 810 n3=1,nc
+ do 810 n2=1,nb
+ do 810 n1=1,na
+ indx2(j)=s1*(n1-1)+s2*(n2-1)+s3*(n3-1)+s4*(n4-1)+1
+900 if(indx2(j).le.n) go to 910
+ indx2(j)=indx2(j)-n
+ go to 900
+910 j=j+1
+810 continue
+ return
+ end
diff --git a/math/ieee/chap1/ord1.f b/math/ieee/chap1/ord1.f
new file mode 100644
index 00000000..21e4494e
--- /dev/null
+++ b/math/ieee/chap1/ord1.f
@@ -0,0 +1,24 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: ord1
+c in-place reordering subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine ord1(m, b)
+ dimension b(2)
+c
+ k = 4
+ kl = 2
+ n = 2**m
+ do 40 j=4,n,2
+ if (k-j) 20, 20, 10
+ 10 t = b(j)
+ b(j) = b(k)
+ b(k) = t
+ 20 k = k - 2
+ if (k-kl) 30, 30, 40
+ 30 k = 2*j
+ kl = j
+ 40 continue
+ return
+ end
diff --git a/math/ieee/chap1/ord2.f b/math/ieee/chap1/ord2.f
new file mode 100644
index 00000000..10f03ec7
--- /dev/null
+++ b/math/ieee/chap1/ord2.f
@@ -0,0 +1,46 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: ord2
+c in-place reordering subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine ord2(m, b)
+ dimension l(15), b(2)
+ equivalence (l15,l(1)), (l14,l(2)), (l13,l(3)), (l12,l(4)),
+ * (l11,l(5)), (l10,l(6)), (l9,l(7)), (l8,l(8)), (l7,l(9)),
+ * (l6,l(10)), (l5,l(11)), (l4,l(12)), (l3,l(13)), (l2,l(14)),
+ * (l1,l(15))
+ n = 2**m
+ l(1) = n
+ do 10 k=2,m
+ l(k) = l(k-1)/2
+ 10 continue
+ do 20 k=m,14
+ l(k+1) = 2
+ 20 continue
+ ij = 2
+ do 40 j1=2,l1,2
+ do 40 j2=j1,l2,l1
+ do 40 j3=j2,l3,l2
+ do 40 j4=j3,l4,l3
+ do 40 j5=j4,l5,l4
+ do 40 j6=j5,l6,l5
+ do 40 j7=j6,l7,l6
+ do 40 j8=j7,l8,l7
+ do 40 j9=j8,l9,l8
+ do 40 j10=j9,l10,l9
+ do 40 j11=j10,l11,l10
+ do 40 j12=j11,l12,l11
+ do 40 j13=j12,l13,l12
+ do 40 j14=j13,l14,l13
+ do 40 ji=j14,l15,l14
+ if (ij-ji) 30, 40, 40
+ 30 t = b(ij-1)
+ b(ij-1) = b(ji-1)
+ b(ji-1) = t
+ t = b(ij)
+ b(ij) = b(ji)
+ b(ji) = t
+ 40 ij = ij + 2
+ return
+ end
diff --git a/math/ieee/chap1/r2tr.f b/math/ieee/chap1/r2tr.f
new file mode 100644
index 00000000..510763fe
--- /dev/null
+++ b/math/ieee/chap1/r2tr.f
@@ -0,0 +1,16 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: r2tr
+c radix 2 iteration subroutine
+c-----------------------------------------------------------------------
+c
+c
+ subroutine r2tr(int, b0, b1)
+ dimension b0(2), b1(2)
+ do 10 k=1,int
+ t = b0(k) + b1(k)
+ b1(k) = b0(k) - b1(k)
+ b0(k) = t
+ 10 continue
+ return
+ end
diff --git a/math/ieee/chap1/r2tx.f b/math/ieee/chap1/r2tx.f
new file mode 100644
index 00000000..425c10f8
--- /dev/null
+++ b/math/ieee/chap1/r2tx.f
@@ -0,0 +1,18 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: r2tx
+c radix 2 iteration subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine r2tx(nthpo, cr0, cr1, ci0, ci1)
+ dimension cr0(2), cr1(2), ci0(2), ci1(2)
+ do 10 k=1,nthpo,2
+ r1 = cr0(k) + cr1(k)
+ cr1(k) = cr0(k) - cr1(k)
+ cr0(k) = r1
+ fi1 = ci0(k) + ci1(k)
+ ci1(k) = ci0(k) - ci1(k)
+ ci0(k) = fi1
+ 10 continue
+ return
+ end
diff --git a/math/ieee/chap1/r4syn.f b/math/ieee/chap1/r4syn.f
new file mode 100644
index 00000000..77c97bba
--- /dev/null
+++ b/math/ieee/chap1/r4syn.f
@@ -0,0 +1,20 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: r4syn
+c radix 4 synthesis
+c-----------------------------------------------------------------------
+c
+ subroutine r4syn(int, b0, b1, b2, b3)
+ dimension b0(2), b1(2), b2(2), b3(2)
+ do 10 k=1,int
+ t0 = b0(k) + b1(k)
+ t1 = b0(k) - b1(k)
+ t2 = b2(k) + b2(k)
+ t3 = b3(k) + b3(k)
+ b0(k) = t0 + t2
+ b2(k) = t0 - t2
+ b1(k) = t1 + t3
+ b3(k) = t1 - t3
+ 10 continue
+ return
+ end
diff --git a/math/ieee/chap1/r4tr.f b/math/ieee/chap1/r4tr.f
new file mode 100644
index 00000000..5fc46eab
--- /dev/null
+++ b/math/ieee/chap1/r4tr.f
@@ -0,0 +1,18 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: r4tr
+c radix 4 iteration subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine r4tr(int, b0, b1, b2, b3)
+ dimension b0(2), b1(2), b2(2), b3(2)
+ do 10 k=1,int
+ r0 = b0(k) + b2(k)
+ r1 = b1(k) + b3(k)
+ b2(k) = b0(k) - b2(k)
+ b3(k) = b1(k) - b3(k)
+ b0(k) = r0 + r1
+ b1(k) = r0 - r1
+ 10 continue
+ return
+ end
diff --git a/math/ieee/chap1/r4tx.f b/math/ieee/chap1/r4tx.f
new file mode 100644
index 00000000..4e5649e8
--- /dev/null
+++ b/math/ieee/chap1/r4tx.f
@@ -0,0 +1,29 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: r4tx
+c radix 4 iteration subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine r4tx(nthpo, cr0, cr1, cr2, cr3, ci0, ci1, ci2, ci3)
+ dimension cr0(2), cr1(2), cr2(2), cr3(2), ci0(2), ci1(2), ci2(2),
+ * ci3(2)
+ do 10 k=1,nthpo,4
+ r1 = cr0(k) + cr2(k)
+ r2 = cr0(k) - cr2(k)
+ r3 = cr1(k) + cr3(k)
+ r4 = cr1(k) - cr3(k)
+ fi1 = ci0(k) + ci2(k)
+ fi2 = ci0(k) - ci2(k)
+ fi3 = ci1(k) + ci3(k)
+ fi4 = ci1(k) - ci3(k)
+ cr0(k) = r1 + r3
+ ci0(k) = fi1 + fi3
+ cr1(k) = r1 - r3
+ ci1(k) = fi1 - fi3
+ cr2(k) = r2 - fi4
+ ci2(k) = fi2 + r4
+ cr3(k) = r2 + fi4
+ ci3(k) = fi2 - r4
+ 10 continue
+ return
+ end
diff --git a/math/ieee/chap1/r8syn.f b/math/ieee/chap1/r8syn.f
new file mode 100644
index 00000000..054413d7
--- /dev/null
+++ b/math/ieee/chap1/r8syn.f
@@ -0,0 +1,186 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: r8syn
+c radix 8 synthesis subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine r8syn(int, nn, br0, br1, br2, br3, br4, br5, br6, br7,
+ * bi0, bi1, bi2, bi3, bi4, bi5, bi6, bi7)
+ dimension l(15), br0(2), br1(2), br2(2), br3(2), br4(2), br5(2),
+ * br6(2), br7(2), bi0(2), bi1(2), bi2(2), bi3(2), bi4(2),
+ * bi5(2), bi6(2), bi7(2)
+ common /con1/ pii, p7, p7two, c22, s22, pi2
+ equivalence (l15,l(1)), (l14,l(2)), (l13,l(3)), (l12,l(4)),
+ * (l11,l(5)), (l10,l(6)), (l9,l(7)), (l8,l(8)), (l7,l(9)),
+ * (l6,l(10)), (l5,l(11)), (l4,l(12)), (l3,l(13)), (l2,l(14)),
+ * (l1,l(15))
+ l(1) = nn/8
+ do 40 k=2,15
+ if (l(k-1)-2) 10, 20, 30
+ 10 l(k-1) = 2
+ 20 l(k) = 2
+ go to 40
+ 30 l(k) = l(k-1)/2
+ 40 continue
+ piovn = pii/float(nn)
+ ji = 3
+ jl = 2
+ jr = 2
+c
+ do 120 j1=2,l1,2
+ do 120 j2=j1,l2,l1
+ do 120 j3=j2,l3,l2
+ do 120 j4=j3,l4,l3
+ do 120 j5=j4,l5,l4
+ do 120 j6=j5,l6,l5
+ do 120 j7=j6,l7,l6
+ do 120 j8=j7,l8,l7
+ do 120 j9=j8,l9,l8
+ do 120 j10=j9,l10,l9
+ do 120 j11=j10,l11,l10
+ do 120 j12=j11,l12,l11
+ do 120 j13=j12,l13,l12
+ do 120 j14=j13,l14,l13
+ do 120 jthet=j14,l15,l14
+ th2 = jthet - 2
+ if (th2) 50, 50, 90
+ 50 do 60 k=1,int
+ t0 = br0(k) + br1(k)
+ t1 = br0(k) - br1(k)
+ t2 = br2(k) + br2(k)
+ t3 = br3(k) + br3(k)
+ t4 = br4(k) + br6(k)
+ t6 = br7(k) - br5(k)
+ t5 = br4(k) - br6(k)
+ t7 = br7(k) + br5(k)
+ pr = p7*(t7+t5)
+ pi = p7*(t7-t5)
+ tt0 = t0 + t2
+ tt1 = t1 + t3
+ t2 = t0 - t2
+ t3 = t1 - t3
+ t4 = t4 + t4
+ t5 = pr + pr
+ t6 = t6 + t6
+ t7 = pi + pi
+ br0(k) = tt0 + t4
+ br1(k) = tt1 + t5
+ br2(k) = t2 + t6
+ br3(k) = t3 + t7
+ br4(k) = tt0 - t4
+ br5(k) = tt1 - t5
+ br6(k) = t2 - t6
+ br7(k) = t3 - t7
+ 60 continue
+ if (nn-8) 120, 120, 70
+ 70 k0 = int*8 + 1
+ kl = k0 + int - 1
+ do 80 k=k0,kl
+ t1 = bi0(k) + bi6(k)
+ t2 = bi7(k) - bi1(k)
+ t3 = bi0(k) - bi6(k)
+ t4 = bi7(k) + bi1(k)
+ pr = t3*c22 + t4*s22
+ pi = t4*c22 - t3*s22
+ t5 = bi2(k) + bi4(k)
+ t6 = bi5(k) - bi3(k)
+ t7 = bi2(k) - bi4(k)
+ t8 = bi5(k) + bi3(k)
+ rr = t8*c22 - t7*s22
+ ri = -t8*s22 - t7*c22
+ bi0(k) = (t1+t5) + (t1+t5)
+ bi4(k) = (t2+t6) + (t2+t6)
+ bi1(k) = (pr+rr) + (pr+rr)
+ bi5(k) = (pi+ri) + (pi+ri)
+ t5 = t1 - t5
+ t6 = t2 - t6
+ bi2(k) = p7two*(t6+t5)
+ bi6(k) = p7two*(t6-t5)
+ rr = pr - rr
+ ri = pi - ri
+ bi3(k) = p7two*(ri+rr)
+ bi7(k) = p7two*(ri-rr)
+ 80 continue
+ go to 120
+ 90 arg = th2*piovn
+ c1 = cos(arg)
+ s1 = -sin(arg)
+ c2 = c1**2 - s1**2
+ s2 = c1*s1 + c1*s1
+ c3 = c1*c2 - s1*s2
+ s3 = c2*s1 + s2*c1
+ c4 = c2**2 - s2**2
+ s4 = c2*s2 + c2*s2
+ c5 = c2*c3 - s2*s3
+ s5 = c3*s2 + s3*c2
+ c6 = c3**2 - s3**2
+ s6 = c3*s3 + c3*s3
+ c7 = c3*c4 - s3*s4
+ s7 = c4*s3 + s4*c3
+ int8 = int*8
+ j0 = jr*int8 + 1
+ k0 = ji*int8 + 1
+ jlast = j0 + int - 1
+ do 100 j=j0,jlast
+ k = k0 + j - j0
+ tr0 = br0(j) + bi6(k)
+ ti0 = bi7(k) - br1(j)
+ tr1 = br0(j) - bi6(k)
+ ti1 = bi7(k) + br1(j)
+ tr2 = br2(j) + bi4(k)
+ ti2 = bi5(k) - br3(j)
+ tr3 = bi5(k) + br3(j)
+ ti3 = bi4(k) - br2(j)
+ tr4 = br4(j) + bi2(k)
+ ti4 = bi3(k) - br5(j)
+ t0 = br4(j) - bi2(k)
+ t1 = bi3(k) + br5(j)
+ tr5 = p7*(t0+t1)
+ ti5 = p7*(t1-t0)
+ tr6 = br6(j) + bi0(k)
+ ti6 = bi1(k) - br7(j)
+ t0 = br6(j) - bi0(k)
+ t1 = bi1(k) + br7(j)
+ tr7 = -p7*(t0-t1)
+ ti7 = -p7*(t1+t0)
+ t0 = tr0 + tr2
+ t1 = ti0 + ti2
+ t2 = tr1 + tr3
+ t3 = ti1 + ti3
+ tr2 = tr0 - tr2
+ ti2 = ti0 - ti2
+ tr3 = tr1 - tr3
+ ti3 = ti1 - ti3
+ t4 = tr4 + tr6
+ t5 = ti4 + ti6
+ t6 = tr5 + tr7
+ t7 = ti5 + ti7
+ ttr6 = ti4 - ti6
+ ti6 = tr6 - tr4
+ ttr7 = ti5 - ti7
+ ti7 = tr7 - tr5
+ br0(j) = t0 + t4
+ bi0(k) = t1 + t5
+ br1(j) = c1*(t2+t6) - s1*(t3+t7)
+ bi1(k) = c1*(t3+t7) + s1*(t2+t6)
+ br2(j) = c2*(tr2+ttr6) - s2*(ti2+ti6)
+ bi2(k) = c2*(ti2+ti6) + s2*(tr2+ttr6)
+ br3(j) = c3*(tr3+ttr7) - s3*(ti3+ti7)
+ bi3(k) = c3*(ti3+ti7) + s3*(tr3+ttr7)
+ br4(j) = c4*(t0-t4) - s4*(t1-t5)
+ bi4(k) = c4*(t1-t5) + s4*(t0-t4)
+ br5(j) = c5*(t2-t6) - s5*(t3-t7)
+ bi5(k) = c5*(t3-t7) + s5*(t2-t6)
+ br6(j) = c6*(tr2-ttr6) - s6*(ti2-ti6)
+ bi6(k) = c6*(ti2-ti6) + s6*(tr2-ttr6)
+ br7(j) = c7*(tr3-ttr7) - s7*(ti3-ti7)
+ bi7(k) = c7*(ti3-ti7) + s7*(tr3-ttr7)
+ 100 continue
+ jr = jr + 2
+ ji = ji - 2
+ if (ji-jl) 110, 110, 120
+ 110 ji = 2*jr - 1
+ jl = jr
+ 120 continue
+ return
+ end
diff --git a/math/ieee/chap1/r8tr.f b/math/ieee/chap1/r8tr.f
new file mode 100644
index 00000000..d49ef58c
--- /dev/null
+++ b/math/ieee/chap1/r8tr.f
@@ -0,0 +1,201 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: r8tr
+c radix 8 iteration subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine r8tr(int, nn, br0, br1, br2, br3, br4, br5, br6, br7,
+ * bi0, bi1, bi2, bi3, bi4, bi5, bi6, bi7)
+ dimension l(15), br0(2), br1(2), br2(2), br3(2), br4(2), br5(2),
+ * br6(2), br7(2), bi0(2), bi1(2), bi2(2), bi3(2), bi4(2),
+ * bi5(2), bi6(2), bi7(2)
+ common /con/ pii, p7, p7two, c22, s22, pi2
+ equivalence (l15,l(1)), (l14,l(2)), (l13,l(3)), (l12,l(4)),
+ * (l11,l(5)), (l10,l(6)), (l9,l(7)), (l8,l(8)), (l7,l(9)),
+ * (l6,l(10)), (l5,l(11)), (l4,l(12)), (l3,l(13)), (l2,l(14)),
+ * (l1,l(15))
+c
+c set up counters such that jthet steps through the arguments
+c of w, jr steps through starting locations for the real part of the
+c intermediate results and ji steps through starting locations
+c of the imaginary part of the intermediate results.
+c
+ l(1) = nn/8
+ do 40 k=2,15
+ if (l(k-1)-2) 10, 20, 30
+ 10 l(k-1) = 2
+ 20 l(k) = 2
+ go to 40
+ 30 l(k) = l(k-1)/2
+ 40 continue
+ piovn = pii/float(nn)
+ ji = 3
+ jl = 2
+ jr = 2
+ do 120 j1=2,l1,2
+ do 120 j2=j1,l2,l1
+ do 120 j3=j2,l3,l2
+ do 120 j4=j3,l4,l3
+ do 120 j5=j4,l5,l4
+ do 120 j6=j5,l6,l5
+ do 120 j7=j6,l7,l6
+ do 120 j8=j7,l8,l7
+ do 120 j9=j8,l9,l8
+ do 120 j10=j9,l10,l9
+ do 120 j11=j10,l11,l10
+ do 120 j12=j11,l12,l11
+ do 120 j13=j12,l13,l12
+ do 120 j14=j13,l14,l13
+ do 120 jthet=j14,l15,l14
+ th2 = jthet - 2
+ if (th2) 50, 50, 90
+ 50 do 60 k=1,int
+ t0 = br0(k) + br4(k)
+ t1 = br1(k) + br5(k)
+ t2 = br2(k) + br6(k)
+ t3 = br3(k) + br7(k)
+ t4 = br0(k) - br4(k)
+ t5 = br1(k) - br5(k)
+ t6 = br2(k) - br6(k)
+ t7 = br3(k) - br7(k)
+ br2(k) = t0 - t2
+ br3(k) = t1 - t3
+ t0 = t0 + t2
+ t1 = t1 + t3
+ br0(k) = t0 + t1
+ br1(k) = t0 - t1
+ pr = p7*(t5-t7)
+ pi = p7*(t5+t7)
+ br4(k) = t4 + pr
+ br7(k) = t6 + pi
+ br6(k) = t4 - pr
+ br5(k) = pi - t6
+ 60 continue
+ if (nn-8) 120, 120, 70
+ 70 k0 = int*8 + 1
+ kl = k0 + int - 1
+ do 80 k=k0,kl
+ pr = p7*(bi2(k)-bi6(k))
+ pi = p7*(bi2(k)+bi6(k))
+ tr0 = bi0(k) + pr
+ ti0 = bi4(k) + pi
+ tr2 = bi0(k) - pr
+ ti2 = bi4(k) - pi
+ pr = p7*(bi3(k)-bi7(k))
+ pi = p7*(bi3(k)+bi7(k))
+ tr1 = bi1(k) + pr
+ ti1 = bi5(k) + pi
+ tr3 = bi1(k) - pr
+ ti3 = bi5(k) - pi
+ pr = tr1*c22 - ti1*s22
+ pi = ti1*c22 + tr1*s22
+ bi0(k) = tr0 + pr
+ bi6(k) = tr0 - pr
+ bi7(k) = ti0 + pi
+ bi1(k) = pi - ti0
+ pr = -tr3*s22 - ti3*c22
+ pi = tr3*c22 - ti3*s22
+ bi2(k) = tr2 + pr
+ bi4(k) = tr2 - pr
+ bi5(k) = ti2 + pi
+ bi3(k) = pi - ti2
+ 80 continue
+ go to 120
+ 90 arg = th2*piovn
+ c1 = cos(arg)
+ s1 = sin(arg)
+ c2 = c1**2 - s1**2
+ s2 = c1*s1 + c1*s1
+ c3 = c1*c2 - s1*s2
+ s3 = c2*s1 + s2*c1
+ c4 = c2**2 - s2**2
+ s4 = c2*s2 + c2*s2
+ c5 = c2*c3 - s2*s3
+ s5 = c3*s2 + s3*c2
+ c6 = c3**2 - s3**2
+ s6 = c3*s3 + c3*s3
+ c7 = c3*c4 - s3*s4
+ s7 = c4*s3 + s4*c3
+ int8 = int*8
+ j0 = jr*int8 + 1
+ k0 = ji*int8 + 1
+ jlast = j0 + int - 1
+ do 100 j=j0,jlast
+ k = k0 + j - j0
+ tr1 = br1(j)*c1 - bi1(k)*s1
+ ti1 = br1(j)*s1 + bi1(k)*c1
+ tr2 = br2(j)*c2 - bi2(k)*s2
+ ti2 = br2(j)*s2 + bi2(k)*c2
+ tr3 = br3(j)*c3 - bi3(k)*s3
+ ti3 = br3(j)*s3 + bi3(k)*c3
+ tr4 = br4(j)*c4 - bi4(k)*s4
+ ti4 = br4(j)*s4 + bi4(k)*c4
+ tr5 = br5(j)*c5 - bi5(k)*s5
+ ti5 = br5(j)*s5 + bi5(k)*c5
+ tr6 = br6(j)*c6 - bi6(k)*s6
+ ti6 = br6(j)*s6 + bi6(k)*c6
+ tr7 = br7(j)*c7 - bi7(k)*s7
+ ti7 = br7(j)*s7 + bi7(k)*c7
+c
+ t0 = br0(j) + tr4
+ t1 = bi0(k) + ti4
+ tr4 = br0(j) - tr4
+ ti4 = bi0(k) - ti4
+ t2 = tr1 + tr5
+ t3 = ti1 + ti5
+ tr5 = tr1 - tr5
+ ti5 = ti1 - ti5
+ t4 = tr2 + tr6
+ t5 = ti2 + ti6
+ tr6 = tr2 - tr6
+ ti6 = ti2 - ti6
+ t6 = tr3 + tr7
+ t7 = ti3 + ti7
+ tr7 = tr3 - tr7
+ ti7 = ti3 - ti7
+c
+ tr0 = t0 + t4
+ ti0 = t1 + t5
+ tr2 = t0 - t4
+ ti2 = t1 - t5
+ tr1 = t2 + t6
+ ti1 = t3 + t7
+ tr3 = t2 - t6
+ ti3 = t3 - t7
+ t0 = tr4 - ti6
+ t1 = ti4 + tr6
+ t4 = tr4 + ti6
+ t5 = ti4 - tr6
+ t2 = tr5 - ti7
+ t3 = ti5 + tr7
+ t6 = tr5 + ti7
+ t7 = ti5 - tr7
+ br0(j) = tr0 + tr1
+ bi7(k) = ti0 + ti1
+ bi6(k) = tr0 - tr1
+ br1(j) = ti1 - ti0
+ br2(j) = tr2 - ti3
+ bi5(k) = ti2 + tr3
+ bi4(k) = tr2 + ti3
+ br3(j) = tr3 - ti2
+ pr = p7*(t2-t3)
+ pi = p7*(t2+t3)
+ br4(j) = t0 + pr
+ bi3(k) = t1 + pi
+ bi2(k) = t0 - pr
+ br5(j) = pi - t1
+ pr = -p7*(t6+t7)
+ pi = p7*(t6-t7)
+ br6(j) = t4 + pr
+ bi1(k) = t5 + pi
+ bi0(k) = t4 - pr
+ br7(j) = pi - t5
+ 100 continue
+ jr = jr + 2
+ ji = ji - 2
+ if (ji-jl) 110, 110, 120
+ 110 ji = 2*jr - 1
+ jl = jr
+ 120 continue
+ return
+ end
diff --git a/math/ieee/chap1/r8tx.f b/math/ieee/chap1/r8tx.f
new file mode 100644
index 00000000..9cc4f591
--- /dev/null
+++ b/math/ieee/chap1/r8tx.f
@@ -0,0 +1,107 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: r8tx
+c radix 8 iteration subroutine
+c-----------------------------------------------------------------------
+c
+ subroutine r8tx(nxtlt, nthpo, lengt, cr0, cr1, cr2, cr3, cr4,
+ * cr5, cr6, cr7, ci0, ci1, ci2, ci3, ci4, ci5, ci6, ci7)
+ dimension cr0(2), cr1(2), cr2(2), cr3(2), cr4(2), cr5(2), cr6(2),
+ * cr7(2), ci1(2), ci2(2), ci3(2), ci4(2), ci5(2), ci6(2),
+ * ci7(2), ci0(2)
+ common /con2/ pi2, p7
+c
+ scale = pi2/float(lengt)
+ do 30 j=1,nxtlt
+ arg = float(j-1)*scale
+ c1 = cos(arg)
+ s1 = sin(arg)
+ c2 = c1**2 - s1**2
+ s2 = c1*s1 + c1*s1
+ c3 = c1*c2 - s1*s2
+ s3 = c2*s1 + s2*c1
+ c4 = c2**2 - s2**2
+ s4 = c2*s2 + c2*s2
+ c5 = c2*c3 - s2*s3
+ s5 = c3*s2 + s3*c2
+ c6 = c3**2 - s3**2
+ s6 = c3*s3 + c3*s3
+ c7 = c3*c4 - s3*s4
+ s7 = c4*s3 + s4*c3
+ do 20 k=j,nthpo,lengt
+ ar0 = cr0(k) + cr4(k)
+ ar1 = cr1(k) + cr5(k)
+ ar2 = cr2(k) + cr6(k)
+ ar3 = cr3(k) + cr7(k)
+ ar4 = cr0(k) - cr4(k)
+ ar5 = cr1(k) - cr5(k)
+ ar6 = cr2(k) - cr6(k)
+ ar7 = cr3(k) - cr7(k)
+ ai0 = ci0(k) + ci4(k)
+ ai1 = ci1(k) + ci5(k)
+ ai2 = ci2(k) + ci6(k)
+ ai3 = ci3(k) + ci7(k)
+ ai4 = ci0(k) - ci4(k)
+ ai5 = ci1(k) - ci5(k)
+ ai6 = ci2(k) - ci6(k)
+ ai7 = ci3(k) - ci7(k)
+ br0 = ar0 + ar2
+ br1 = ar1 + ar3
+ br2 = ar0 - ar2
+ br3 = ar1 - ar3
+ br4 = ar4 - ai6
+ br5 = ar5 - ai7
+ br6 = ar4 + ai6
+ br7 = ar5 + ai7
+ bi0 = ai0 + ai2
+ bi1 = ai1 + ai3
+ bi2 = ai0 - ai2
+ bi3 = ai1 - ai3
+ bi4 = ai4 + ar6
+ bi5 = ai5 + ar7
+ bi6 = ai4 - ar6
+ bi7 = ai5 - ar7
+ cr0(k) = br0 + br1
+ ci0(k) = bi0 + bi1
+ if (j.le.1) go to 10
+ cr1(k) = c4*(br0-br1) - s4*(bi0-bi1)
+ ci1(k) = c4*(bi0-bi1) + s4*(br0-br1)
+ cr2(k) = c2*(br2-bi3) - s2*(bi2+br3)
+ ci2(k) = c2*(bi2+br3) + s2*(br2-bi3)
+ cr3(k) = c6*(br2+bi3) - s6*(bi2-br3)
+ ci3(k) = c6*(bi2-br3) + s6*(br2+bi3)
+ tr = p7*(br5-bi5)
+ ti = p7*(br5+bi5)
+ cr4(k) = c1*(br4+tr) - s1*(bi4+ti)
+ ci4(k) = c1*(bi4+ti) + s1*(br4+tr)
+ cr5(k) = c5*(br4-tr) - s5*(bi4-ti)
+ ci5(k) = c5*(bi4-ti) + s5*(br4-tr)
+ tr = -p7*(br7+bi7)
+ ti = p7*(br7-bi7)
+ cr6(k) = c3*(br6+tr) - s3*(bi6+ti)
+ ci6(k) = c3*(bi6+ti) + s3*(br6+tr)
+ cr7(k) = c7*(br6-tr) - s7*(bi6-ti)
+ ci7(k) = c7*(bi6-ti) + s7*(br6-tr)
+ go to 20
+ 10 cr1(k) = br0 - br1
+ ci1(k) = bi0 - bi1
+ cr2(k) = br2 - bi3
+ ci2(k) = bi2 + br3
+ cr3(k) = br2 + bi3
+ ci3(k) = bi2 - br3
+ tr = p7*(br5-bi5)
+ ti = p7*(br5+bi5)
+ cr4(k) = br4 + tr
+ ci4(k) = bi4 + ti
+ cr5(k) = br4 - tr
+ ci5(k) = bi4 - ti
+ tr = -p7*(br7+bi7)
+ ti = p7*(br7-bi7)
+ cr6(k) = br6 + tr
+ ci6(k) = bi6 + ti
+ cr7(k) = br6 - tr
+ ci7(k) = bi6 - ti
+ 20 continue
+ 30 continue
+ return
+ end
diff --git a/math/ieee/chap1/rad4sb.f b/math/ieee/chap1/rad4sb.f
new file mode 100644
index 00000000..dfebf0cc
--- /dev/null
+++ b/math/ieee/chap1/rad4sb.f
@@ -0,0 +1,38 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: rad4sb
+c used by subroutine radix4. never directly accessed by user.
+c-----------------------------------------------------------------------
+c
+ subroutine rad4sb(ntype)
+c
+c input: ntype = type of butterfly invoked
+c output: parameters used by subroutine radix4
+c
+ dimension ix(2996)
+ common /xx/ix
+ common ntypl,kkp,index,ixc
+ if(ntype.eq.ntypl) go to 7
+ ix(ixc)=0
+ ix(ixc+1)=ntype
+ ixc=ixc+2
+ if(ntype.ne.4) go to 4
+ indexp=(index-1)*9
+ ix(ixc)=kkp+1
+ ix(ixc+1)=indexp+1
+ ixc=ixc+2
+ go to 6
+4 ix(ixc)=kkp+1
+ ixc=ixc+1
+6 ntypl=ntype
+ return
+7 if(ntype.ne.4) go to 8
+ indexp=(index-1)*9
+ ix(ixc)=kkp+1
+ ix(ixc+1)=indexp+1
+ ixc=ixc+2
+ return
+8 ix(ixc)=kkp+1
+ ixc=ixc+1
+ return
+ end
diff --git a/math/ieee/chap1/radix4.f b/math/ieee/chap1/radix4.f
new file mode 100644
index 00000000..cd703305
--- /dev/null
+++ b/math/ieee/chap1/radix4.f
@@ -0,0 +1,488 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: radix4
+c computes forward or inverse complex dft via radix-4 fft.
+c uses autogen technique to yield time efficient program.
+c-----------------------------------------------------------------------
+c
+ subroutine radix4(mm,iflag,jflag)
+c
+c input:
+c mm = power of 4 (i.e., n = 4**mm complex point transform)
+c (mm.ge.2 and mm.le.5)
+c
+c iflag = 1 on first pass for given n
+c = 0 on subsequent passes for given n
+c
+c jflag = -1 for forward transform
+c = +1 for inverse transform
+c
+c input/output:
+c a = array of dimensions 2*n with real and imaginary parts
+c of dft input/output in odd, even array components.
+c
+c for optimal time efficiency, common is used to pass arrays.
+c this means that dimensions of arrays a, ix, and t can be
+c modified to reflect maximum value of n = 4**mm to be used. note
+c that array "ix" is also dimensioned in subroutine "rad4sb".
+c
+c i.e., a( ) ix( ) t( )
+c
+c m =2 32 38 27
+c m<=3 128 144 135
+c m<=4 512 658 567
+c m<=5 2048 2996 2295
+c
+ dimension a(2048),ix(2996),t(2295)
+ dimension nfac(11),np(209)
+ common ntypl,kkp,index,ixc
+ common /aa/a
+ common /xx/ix
+c
+c check for mm<2 or mm>5
+c
+ if(mm.lt.2.or.mm.gt.5)stop
+c
+c initialize on first pass """"""""""""""""""""""""""""""""""""""""
+c
+ if(iflag.eq.1) go to 9999
+c
+c fast fourier transform start ####################################
+c
+8885 kspan=2*4**mm
+ if(jflag.eq.1) go to 8887
+c
+c conjugate data for forward transform
+c
+ do 8886 j=2,n2,2
+8886 a(j)=-a(j)
+ go to 8889
+c
+c multiply data by n**(-1) if inverse transform
+c
+8887 do 8888 j=1,n2,2
+ a(j)=a(j)*xp
+8888 a(j+1)=a(j+1)*xp
+8889 i=3
+ it=ix(i-1)
+ go to (1,2,3,4,5,6,7,8),it
+c***********************************************************************
+c
+c 8 multiply butterfly
+c
+1 kk=ix(i)
+c
+11 k1=kk+kspan
+ k2=k1+kspan
+ k3=k2+kspan
+c
+ akp=a(kk)+a(k2)
+ akm=a(kk)-a(k2)
+ ajp=a(k1)+a(k3)
+ ajm=a(k1)-a(k3)
+ a(kk)=akp+ajp
+c
+ bkp=a(kk+1)+a(k2+1)
+ bkm=a(kk+1)-a(k2+1)
+ bjp=a(k1+1)+a(k3+1)
+ bjm=a(k1+1)-a(k3+1)
+ a(kk+1)=bkp+bjp
+c
+ bjp=bkp-bjp
+c
+ a(k2+1)=(akp+bjp-ajp)*c707
+ a(k2)=a(k2+1)+bjp*cm141
+c
+ bkp=bkm+ajm
+ akp=akm-bjm
+c
+ ac0=(akp+bkp)*c924
+ a(k1+1)=ac0+akp*cm541
+ a(k1) =ac0+bkp*cm131
+c
+ bkm=bkm-ajm
+ akm=akm+bjm
+c
+ ac0=(akm+bkm)*c383
+ a(k3+1)=ac0+akm*c541
+ a(k3) =ac0+bkm*cm131
+c
+ i=i+1
+ kk=ix(i)
+ if (kk) 111,111,11
+111 i=i+2
+ it=ix(i-1)
+ go to (1,2,3,4,5,6,7,8), it
+c***********************************************************************
+c
+c 4 multiply butterfly
+c
+2 kk=ix(i)
+c
+22 k1=kk+kspan
+ k2=k1+kspan
+ k3=k2+kspan
+c
+ akp=a(kk)+a(k2)
+ akm=a(kk)-a(k2)
+ ajp=a(k1)+a(k3)
+ ajm=a(k1)-a(k3)
+ a(kk)=akp+ajp
+c
+ bkp=a(kk+1)+a(k2+1)
+ bkm=a(kk+1)-a(k2+1)
+ bjp=a(k1+1)+a(k3+1)
+ bjm=a(k1+1)-a(k3+1)
+ a(kk+1)=bkp+bjp
+ a(k2)=-bkp+bjp
+ a(k2+1)=akp-ajp
+c
+ bkp=bkm+ajm
+c
+ a(k1+1)=(bkp+akm-bjm)*c707
+ a(k1)=a(k1+1)+bkp*cm141
+c
+ akm=akm+bjm
+c
+ a(k3+1)=(akm+ajm-bkm)*c707
+ a(k3)=a(k3+1)+akm*cm141
+c
+ i=i+1
+ kk=ix(i)
+ if (kk) 222,222,22
+222 i=i+2
+ it=ix(i-1)
+ go to (1,2,3,4,5,6,7,8), it
+c***********************************************************************
+c
+c 8 multiply butterfly
+c
+3 kk=ix(i)
+c
+33 k1=kk+kspan
+ k2=k1+kspan
+ k3=k2+kspan
+c
+ akp=a(kk)+a(k2)
+ akm=a(kk)-a(k2)
+ ajp=a(k1)+a(k3)
+ ajm=a(k1)-a(k3)
+ a(kk)=akp+ajp
+c
+ bkp=a(kk+1)+a(k2+1)
+ bkm=a(kk+1)-a(k2+1)
+ bjp=a(k1+1)+a(k3+1)
+ bjm=a(k1+1)-a(k3+1)
+ a(kk+1)=bkp+bjp
+c
+ ajp=akp-ajp
+c
+ a(k2+1)=(ajp+bjp-bkp)*c707
+ a(k2)=a(k2+1)+ajp*cm141
+c
+ bkp=bkm+ajm
+ akp=akm-bjm
+c
+ ac0=(akp+bkp)*c383
+ a(k1+1)=ac0+akp*c541
+ a(k1) =ac0+bkp*cm131
+c
+ bkm=bkm-ajm
+ akm=akm+bjm
+c
+ ac0=(akm+bkm)*cm924
+ a(k3+1)=ac0+akm*c541
+ a(k3) =ac0+bkm*c131
+c
+ i=i+1
+ kk=ix(i)
+ if (kk) 333,333,33
+333 i=i+2
+ it=ix(i-1)
+ go to (1,2,3,4,5,6,7,8), it
+c***********************************************************************
+c
+c general 9 multiply butterfly
+c
+4 kk=ix(i)
+c
+44 k1=kk+kspan
+ k2=k1+kspan
+ k3=k2+kspan
+c
+ akp=a(kk)+a(k2)
+ akm=a(kk)-a(k2)
+ ajp=a(k1)+a(k3)
+ ajm=a(k1)-a(k3)
+ a(kk)=akp+ajp
+c
+ bkp=a(kk+1)+a(k2+1)
+ bkm=a(kk+1)-a(k2+1)
+ bjp=a(k1+1)+a(k3+1)
+ bjm=a(k1+1)-a(k3+1)
+ a(kk+1)=bkp+bjp
+c
+ ajp=akp-ajp
+ bjp=bkp-bjp
+c
+ j=ix(i+1)
+c
+ ac0=(ajp+bjp)*t(j+8)
+ a(k2+1)=ac0+ajp*t(j+6)
+ a(k2) =ac0+bjp*t(j+7)
+c
+ bkp=bkm+ajm
+ akp=akm-bjm
+c
+ ac0=(akp+bkp)*t(j+5)
+ a(k1+1)=ac0+akp*t(j+3)
+ a(k1) =ac0+bkp*t(j+4)
+c
+ bkm=bkm-ajm
+ akm=akm+bjm
+c
+ ac0=(akm+bkm)*t(j+2)
+ a(k3+1)=ac0+akm*t(j)
+ a(k3) =ac0+bkm*t(j+1)
+c
+ i=i+2
+ kk=ix(i)
+ if (kk) 444,444,44
+444 i=i+2
+ it=ix(i-1)
+ go to (1,2,3,4,5,6,7,8), it
+c***********************************************************************
+c
+c 0 multiply butterfly
+c
+5 kk=ix(i)
+c
+55 k1=kk+kspan
+ k2=k1+kspan
+ k3=k2+kspan
+c
+ akp=a(kk)+a(k2)
+ akm=a(kk)-a(k2)
+ ajp=a(k1)+a(k3)
+ ajm=a(k1)-a(k3)
+ a(kk)=akp+ajp
+ a(k2)=akp-ajp
+c
+ bkp=a(kk+1)+a(k2+1)
+ bkm=a(kk+1)-a(k2+1)
+ bjp=a(k1+1)+a(k3+1)
+ bjm=a(k1+1)-a(k3+1)
+ a(kk+1)=bkp+bjp
+ a(k2+1)=bkp-bjp
+c
+ a(k3+1)=bkm-ajm
+ a(k1+1)=bkm+ajm
+ a(k3)=akm+bjm
+ a(k1)=akm-bjm
+c
+ i=i+1
+ kk=ix(i)
+ if (kk) 555,555,55
+555 i=i+2
+ it=ix(i-1)
+ go to (1,2,3,4,5,6,7,8), it
+c***********************************************************************
+c
+c offset reduced
+c
+6 kspan=kspan/4
+ i=i+2
+ it=ix(i-1)
+ go to (1,2,3,4,5,6,7,8), it
+c***********************************************************************
+c
+c bit reversal (shuffling)
+c
+7 ip1=ix(i)
+77 ip2=ix(i+1)
+ t1=a(ip2)
+ a(ip2)=a(ip1)
+ a(ip1)=t1
+ t1=a(ip2+1)
+ a(ip2+1)=a(ip1+1)
+ a(ip1+1)=t1
+ i=i+2
+ ip1=ix(i)
+ if (ip1) 777,777,77
+777 i=i+2
+ it=ix(i-1)
+ go to (1,2,3,4,5,6,7,8), it
+c***********************************************************************
+8 if(jflag.eq.1) go to 888
+c
+c conjugate output if forward transform
+c
+ do 88 j=2,n2,2
+88 a(j)=-a(j)
+888 return
+c
+c fast fourier transform ends #####################################
+c
+c initialization phase starts. done only once
+c
+9999 ixc=1
+ n=4**mm
+ xp=n
+ xp=1./xp
+ ntot=n
+ n2=n*2
+ nspan=n
+ n1test=n/16
+ n2test=n/8
+ n3test=(3*n)/16
+ nspan4=nspan/4
+ ibase=0
+ isn=1
+ inc=isn
+ rad=8.0*atan(1.0)
+ pi=4.*atan(1.0)
+ c707=sin(pi/4.)
+ cm141=-2.*c707
+ c383=sin(pi/8.)
+ c924=cos(pi/8.)
+ cm924=-c924
+ c541=c924-c383
+ cm541=-c541
+ c131=c924+c383
+ cm131=-c131
+10 nt=inc*ntot
+ ks=inc*nspan
+ kspan=ks
+ jc=ks/n
+ radf=rad*float(jc)*.5
+ i=0
+c
+c determine the factors of n
+c all factors must be 4 for this version
+c
+ m=0
+ k=n
+15 m=m+1
+ nfac(m)=4
+ k=k/4
+20 if(k-(k/4)*4.eq.0) go to 15
+ kt=1
+ if(n.ge.256) kt=2
+ kspan0=kspan
+ ntypl=0
+c
+100 ndelta=kspan0/kspan
+ index=0
+ sd=radf/float(kspan)
+ cd=2.0*sin(sd)**2
+ sd=sin(sd+sd)
+ kk=1
+ i=i+1
+c
+c transform for a factor of 4
+c
+ kspan=kspan/4
+ ix(ixc)=0
+ ix(ixc+1)=6
+ ixc=ixc+2
+c
+410 c1=1.0
+ s1=0.0
+420 k1=kk+kspan
+ k2=k1+kspan
+ k3=k2+kspan
+ if(s1.eq.0.0) go to 460
+430 if(kspan.ne.nspan4) go to 431
+ t(ibase+5)=-(s1+c1)
+ t(ibase+6)=c1
+ t(ibase+4)=s1-c1
+ t(ibase+8)=-(s2+c2)
+ t(ibase+9)=c2
+ t(ibase+7)=s2-c2
+ t(ibase+2)=-(s3+c3)
+ t(ibase+3)=c3
+ t(ibase+1)=s3-c3
+ ibase=ibase+9
+c
+431 kkp=(kk-1)*2
+ if(index.ne.n1test) go to 150
+ call rad4sb(1)
+ go to 5035
+150 if(index.ne.n2test) go to 160
+ call rad4sb(2)
+ go to 5035
+160 if(index.ne.n3test) go to 170
+ call rad4sb(3)
+ go to 5035
+170 call rad4sb(4)
+5035 kk=k3+kspan
+ if(kk.le.nt) go to 420
+440 index=index+ndelta
+ c2=c1-(cd*c1+sd*s1)
+ s1=(sd*c1-cd*s1)+s1
+ c1=c2
+ c2=c1*c1-s1*s1
+ s2=c1*s1+c1*s1
+ c3=c2*c1-s2*s1
+ s3=c2*s1+s2*c1
+ kk=kk-nt+jc
+ if(kk.le.kspan) go to 420
+ kk=kk-kspan+inc
+ if(kk.le.jc) go to 410
+ if(kspan.eq.jc) go to 800
+ go to 100
+460 kkp=(kk-1)*2
+ call rad4sb(5)
+5050 kk=k3+kspan
+ if(kk.le.nt) go to 420
+ go to 440
+c
+800 ix(ixc)=0
+ ix(ixc+1)=7
+ ixc=ixc+2
+c
+c compute parameters to permute the results to normal order
+c done in two steps
+c permutation for square factors of n
+c
+ np(1)=ks
+ k=kt+kt+1
+ if(m.lt.k) k=k-1
+ j=1
+ np(k+1)=jc
+810 np(j+1)=np(j)/nfac(j)
+ np(k)=np(k+1)*nfac(j)
+ j=j+1
+ k=k-1
+ if(j.lt.k) go to 810
+ k3=np(k+1)
+ kspan=np(2)
+ kk=jc+1
+ k2=kspan+1
+ j=1
+c
+c permutation for single variate transform
+c
+820 kkp=(kk-1)*2
+ k2p=(k2-1)*2
+ ix(ixc)=kkp+1
+ ix(ixc+1)=k2p+1
+ ixc=ixc+2
+ kk=kk+inc
+ k2=kspan+k2
+ if(k2.lt.ks) go to 820
+830 k2=k2-np(j)
+ j=j+1
+ k2=np(j+1)+k2
+ if(k2.gt.np(j)) go to 830
+ j=1
+840 if(kk.lt.k2) go to 820
+ kk=kk+inc
+ k2=kspan+k2
+ if(k2.lt.ks) go to 840
+ if(kk.lt.ks) go to 830
+ jc=k3
+ ix(ixc)=0
+ ix(ixc+1)=8
+ go to 8885
+ end
diff --git a/math/ieee/chap1/test/test12.f b/math/ieee/chap1/test/test12.f
new file mode 100644
index 00000000..a830ab2c
--- /dev/null
+++ b/math/ieee/chap1/test/test12.f
@@ -0,0 +1,90 @@
+c
+c-----------------------------------------------------------------------
+c main program: fastmain - fast fourier transforms
+c authors: g. d. bergland and m. t. dolan
+c bell laboratories, murray hill, new jersey 07974
+c
+c input: the program calls on a random number
+c generator for input and checks dft and
+c idft with a 32-point sequence
+c-----------------------------------------------------------------------
+c
+ dimension x(32), y(32), b(34)
+c
+c generate random numbers and store array in b so
+c the same sequence can be used in all tests.
+c note that b is dimensioned to size n+2.
+c
+c iw is a machine dependent write device number
+c
+ iw = i1mach(2)
+c
+ do 10 i=1,32
+ x(i) = uni(0)
+ b(i) = x(i)
+ 10 continue
+ m = 5
+ n = 2**m
+ np1 = n + 1
+ np2 = n + 2
+ knt = 1
+c
+c test fast-fsst then ffa-ffs
+c
+ write (iw,9999)
+ 20 write (iw,9998) (b(i),i=1,n)
+ if (knt.eq.1) call fast(b, n)
+ if (knt.eq.2) call ffa(b, n)
+ write (iw,9997) (b(i),i=1,np1,2)
+ write (iw,9996) (b(i),i=2,np2,2)
+ if (knt.eq.1) call fsst(b, n)
+ if (knt.eq.2) call ffs(b, n)
+ write (iw,9995) (b(i),i=1,n)
+ knt = knt + 1
+ if (knt.eq.3) go to 40
+c
+ write (iw,9994)
+ do 30 i=1,n
+ b(i) = x(i)
+ 30 continue
+ go to 20
+c
+c test fft842 with real input then complex
+c
+ 40 write (iw,9993)
+ do 50 i=1,n
+ b(i) = x(i)
+ y(i) = 0.
+ 50 continue
+ 60 write (iw,9992) (b(i),i=1,n)
+ write (iw,9991) (y(i),i=1,n)
+ call fft842(0, n, b, y)
+ write (iw,9997) (b(i),i=1,n)
+ write (iw,9996) (y(i),i=1,n)
+ call fft842(1, n, b, y)
+ write (iw,9990) (b(i),i=1,n)
+ write (iw,9989) (y(i),i=1,n)
+ knt = knt + 1
+ if (knt.eq.5) go to 80
+c
+ write (iw,9988)
+ do 70 i=1,n
+ b(i) = x(i)
+ y(i) = uni(0)
+ 70 continue
+ go to 60
+c
+9999 format (19h1test fast and fsst)
+9998 format (20h0real input sequence/(4e17.8))
+9997 format (29h0real components of transform/(4e17.8))
+9996 format (29h0imag components of transform/(4e17.8))
+9995 format (23h0real inverse transform/(4e17.8))
+9994 format (17h1test ffa and ffs)
+9993 format (37h1test fft842 with real input sequence/(4e17.8))
+9992 format (34h0real components of input sequence/(4e17.8))
+9991 format (34h0imag components of input sequence/(4e17.8))
+9990 format (37h0real components of inverse transform/(4e17.8))
+9989 format (37h0imag components of inverse transform/(4e17.8))
+9988 format (40h1test fft842 with complex input sequence)
+ 80 stop
+ end
diff --git a/math/ieee/chap1/test/test13.f b/math/ieee/chap1/test/test13.f
new file mode 100644
index 00000000..d7157069
--- /dev/null
+++ b/math/ieee/chap1/test/test13.f
@@ -0,0 +1,260 @@
+c
+c-----------------------------------------------------------------------
+c main program: test program for fft subroutines
+c author: l r rabiner
+c bell laboratories, murray hill, new jersey, 07974
+c input: randomly chosen sequences to test fft subroutines
+c for sequences with special properties
+c n is the fft length (n must be a power of 2)
+c 2<= n <= 4096
+c-----------------------------------------------------------------------
+c
+ dimension x(4098), y(4098)
+c
+c define i/0 device codes
+c input: input to this program is user-interactive
+c that is - a question is written on the user
+c terminal (iout1) ad the user types in the answer.
+c
+c output: all output is written on the standard
+c output unit (iout2).
+c
+ ind = i1mach(1)
+ iout1 = i1mach(4)
+ iout2 = i1mach(2)
+c
+c read in analysis size for fft
+c
+ 10 write (iout1,9999)
+9999 format (30h fft size(2.le.n.le.4096)(i4)=)
+ read (ind,9998) n
+9998 format (i4)
+ if (n.eq.0) stop
+ do 20 i=1,12
+ itest = 2**i
+ if (n.eq.itest) go to 30
+ 20 continue
+ write (iout1,9997)
+9997 format (45h n is not a power of 2 in the range 2 to 4096)
+ go to 10
+ 30 write (iout2,9996) n
+9996 format (11h testing n=, i5, 17h random sequences)
+ write (iout2,9992)
+ np2 = n + 2
+ no2 = n/2
+ no2p1 = no2 + 1
+ no4 = n/4
+ no4p1 = no4 + 1
+c
+c create symmetrical sequence of size n
+c
+ do 40 i=2,no2
+ x(i) = uni(0) - 0.5
+ ind1 = np2 - i
+ x(ind1) = x(i)
+ 40 continue
+ x(1) = uni(0) - 0.5
+ x(no2p1) = uni(0) - 0.5
+ do 50 i=1,no2p1
+ y(i) = x(i)
+ 50 continue
+ write (iout2,9995)
+9995 format (28h original symmetric sequence)
+ write (iout2,9993) (x(i),i=1,n)
+ write (iout2,9992)
+c
+c compute true fft of n point sequence
+c
+ call fast(x, n)
+ write (iout2,9994) n
+9994 format (1h , i4, 32h point fft of symmetric sequence)
+ write (iout2,9993) (x(i),i=1,np2)
+9993 format (1h , 5e13.5)
+ write (iout2,9992)
+9992 format (1h /1h )
+c
+c use subroutine fftsym to obtain dft from no2 point fft
+c
+ do 60 i=1,no2p1
+ x(i) = y(i)
+ 60 continue
+ call fftsym(x, n, y)
+ write (iout2,9991)
+9991 format (17h output of fftsym)
+ write (iout2,9993) (x(i),i=1,no2p1)
+ write (iout2,9992)
+c
+c use subroutine iftsym to obtain original sequence from no2 point dft
+c
+ call iftsym(x, n, y)
+ write (iout2,9990)
+9990 format (17h output of iftsym)
+ write (iout2,9993) (x(i),i=1,no2p1)
+ write (iout2,9992)
+c
+c create antisymmetric n point sequence
+c
+ do 70 i=2,no2
+ x(i) = uni(0) - 0.5
+ ind1 = np2 - i
+ x(ind1) = -x(i)
+ 70 continue
+ x(1) = 0.
+ x(no2p1) = 0.
+ do 80 i=1,no2p1
+ y(i) = x(i)
+ 80 continue
+ write (iout2,9989)
+9989 format (32h original antisymmetric sequence)
+ write (iout2,9993) (x(i),i=1,n)
+ write (iout2,9992)
+c
+c obtain n point dft of antisymmetric sequence
+c
+ call fast(x, n)
+ write (iout2,9988) n
+9988 format (1h , i4, 36h point fft of antisymmetric sequence)
+ write (iout2,9993) (x(i),i=1,np2)
+ write (iout2,9992)
+c
+c use subroutine fftasm to obtain dft from no2 point fft
+c
+ do 90 i=1,no2
+ x(i) = y(i)
+ 90 continue
+ call fftasm(x, n, y)
+ write (iout2,9987)
+9987 format (17h output of fftasm)
+ write (iout2,9993) (x(i),i=1,no2p1)
+ write (iout2,9992)
+c
+c use subroutine iftasm to obtain original sequence from no2 point dft
+c
+ call iftasm(x, n, y)
+ write (iout2,9986)
+9986 format (17h output of iftasm)
+ write (iout2,9993) (x(i),i=1,no2)
+ write (iout2,9992)
+c
+c create sequence with only odd harmonics--begin in frequency domain
+c
+ do 100 i=1,np2,2
+ x(i) = 0.
+ x(i+1) = 0.
+ if (mod(i,4).eq.1) go to 100
+ x(i) = uni(0) - 0.5
+ x(i+1) = uni(0) - 0.5
+ if (n.eq.2) x(i+1) = 0.
+ 100 continue
+ write (iout2,9985) n
+9985 format (1h , i4, 35h point fft of odd harmonic sequence)
+ write (iout2,9993) (x(i),i=1,np2)
+ write (iout2,9992)
+c
+c transform back to time sequence
+c
+ call fsst(x, n)
+ write (iout2,9984)
+9984 format (31h original odd harmonic sequence)
+ write (iout2,9993) (x(i),i=1,n)
+ write (iout2,9992)
+c
+c use subroutine fftohm to obtain dft from no2 point fft
+c
+ call fftohm(x, n)
+ write (iout2,9983)
+9983 format (17h output of fftohm)
+ write (iout2,9993) (x(i),i=1,no2)
+ write (iout2,9992)
+c
+c use subroutine iftohm to obtain original sequence from no2 point dft
+c
+ call iftohm(x, n)
+ write (iout2,9982)
+9982 format (17h output of iftohm)
+ write (iout2,9993) (x(i),i=1,no2)
+ write (iout2,9992)
+c
+c create sequence with only real valued odd harmonics
+c
+ do 110 i=1,np2,2
+ x(i) = 0.
+ x(i+1) = 0.
+ if (mod(i,4).eq.1) go to 110
+ x(i) = uni(0) - 0.5
+ 110 continue
+ write (iout2,9981) n
+9981 format (1h , i4, 45h point fft of odd harmonic, symmetric sequenc,
+ * 1he)
+ write (iout2,9993) (x(i),i=1,np2)
+ write (iout2,9992)
+c
+c transform back to time sequence
+c
+ call fsst(x, n)
+ write (iout2,9980)
+9980 format (42h original odd harmonic, symmetric sequence)
+ write (iout2,9993) (x(i),i=1,n)
+ write (iout2,9992)
+c
+c use subroutine fftsoh to obtain dft from no4 point fft
+c
+ call fftsoh(x, n, y)
+ write (iout2,9979)
+9979 format (17h output of fftsoh)
+ write (iout2,9993) (x(i),i=1,no4)
+ write (iout2,9992)
+c
+c use subroutine iftsoh to obtain original sequence from no4 point dft
+c
+ call iftsoh(x, n, y)
+ write (iout2,9978)
+9978 format (17h output of iftsoh)
+ write (iout2,9993) (x(i),i=1,no4)
+ write (iout2,9992)
+c
+c create sequence with only imaginary valued odd harmonics--begin
+c in frequency domain
+c
+ do 120 i=1,np2,2
+ x(i) = 0.
+ x(i+1) = 0.
+ if (mod(i,4).eq.1) go to 120
+ x(i+1) = uni(0) - 0.5
+ 120 continue
+ write (iout2,9977) n
+9977 format (1h , i4, 41h point fft of odd harmonic, antisymmetric,
+ * 9h sequence)
+ write (iout2,9993) (x(i),i=1,np2)
+ write (iout2,9992)
+c
+c transform back to time sequence
+c
+ call fsst(x, n)
+ write (iout2,9976)
+9976 format (46h original odd harmonic, antisymmetric sequence)
+ write (iout2,9993) (x(i),i=1,n)
+ write (iout2,9992)
+c
+c use subroutine fftaoh to obtain dft from no4 point fft
+c
+ call fftaoh(x, n, y)
+ write (iout2,9975)
+9975 format (17h output of fftaoh)
+ write (iout2,9993) (x(i),i=1,no4)
+ write (iout2,9992)
+c
+c use subroutine iftaoh to obtain original sequence from n/4 point dft
+c
+ call iftaoh(x, n, y)
+ write (iout2,9974)
+9974 format (17h output of iftaoh)
+ write (iout2,9993) (x(i),i=1,no4p1)
+ write (iout2,9992)
+c
+c begin a new page
+c
+ write (iout2,9973)
+9973 format (1h1)
+ go to 10
+ end
diff --git a/math/ieee/chap1/test/test17.f b/math/ieee/chap1/test/test17.f
new file mode 100644
index 00000000..15a34788
--- /dev/null
+++ b/math/ieee/chap1/test/test17.f
@@ -0,0 +1,147 @@
+c
+c-----------------------------------------------------------------------
+c main program: test program to exercise the wfta subroutine
+c the test waveform is a complex exponential a**i whose
+c transform is known analytically to be (1 - a**n)/(1 - a*w**k).
+c
+c authors:
+c james h. mcclellan and hamid nawab
+c department of electrical engineering and computer science
+c massachusetts of technology
+c cambridge, mass. 02139
+c
+c inputs:
+c n-- transform length. it must be formed as the product of
+c relatively prime integers from the set:
+c 2,3,4,5,7,8,9,16
+c invrs is the flag for forward or inverse transform.
+c invrs = 1 yields inverse transform
+c invrs .ne. 1 gives forward transform
+c rad and phi are the magnitude and angle (as a fraction of
+c 2*pi/n) of the complex exponential test signal.
+c suggestion: rad = 0.98, phi = 0.5.
+c-----------------------------------------------------------------------
+c
+ double precision pi2,pin,xn,xj,xt
+ dimension xr(1260),xi(1260)
+ complex cone,ca,can,cnum,cden
+c
+c output will be punched
+c
+ iout=i1mach(3)
+ input=i1mach(1)
+ cone=cmplx(1.0,0.0)
+ pi2=8.0d0*datan(1.0d0)
+50 continue
+ read(input,130)n
+130 format(i5)
+ write(iout,150) n
+150 format(10h length = ,i5)
+ if(n.le.0 .or. n.gt.1260) stop
+c
+c enter a 1 to perform the inverse
+c
+c read(input,130) invrs
+ invrs = 0
+c
+c enter magnitude and angle (in fraction of 2*pi/n)
+c avoid multiples of n for the angle if the radius is
+c close to one. suggestion: rad = 0.98, phi = 0.5.
+c
+c read(input,160) rad,phi
+ rad = 0.98
+ phi = 0.5
+160 format(2f15.10)
+ xn=float(n)
+ pin=phi
+ pin=pin*pi2/xn
+c
+c generate z**j
+c
+ init=0
+ do 200 j=1,n
+ an=rad**(j-1)
+ xj=j-1
+ xj=xj*pin
+ xt=dcos(xj)
+ xr(j)=xt
+ xr(j)=xr(j)*an
+ xt=dsin(xj)
+ xi(j)=xt
+ xi(j)=xi(j)*an
+200 continue
+ can=cmplx(xr(n),xi(n))
+ ca=cmplx(xr(2),xi(2))
+ can=can*ca
+c
+c print first 50 values of input sequence
+c
+ max=50
+ if(n.lt.50)max=n
+ write(iout,300)(j,xr(j),xi(j),j=1,max)
+c
+c call the winograd fourier transform algorithm
+c
+ call wfta(xr,xi,n,invrs,init,ierr)
+c
+c check for error return
+c
+ if(ierr.lt.0) write(iout,250) ierr
+250 format(1x,5herror,i5)
+ if(ierr.lt.0) go to 50
+c
+c print first 50 values of the transformed sequence
+c
+ write(iout,300)(j,xr(j),xi(j),j=1,max)
+300 format(1x,3hj =,i3,6hreal =,e20.12,6himag =,e20.12)
+c
+c calculate absolute and relative deviations
+c
+ devabs=0.0
+ devrel=0.0
+ cnum=cone-can
+ pin=pi2/xn
+ do 350 j=1,n
+ xj=j-1
+ xj=-xj*pin
+ if(invrs.eq.1) xj=-xj
+ tr=dcos(xj)
+ ti=dsin(xj)
+ can=cmplx(tr,ti)
+ cden=cone-ca*can
+ cden=cnum/cden
+c
+c true value of the transform (1. - a**n)/(1. - a*w**k),
+c where a = rad*exp(j*phi*(2*pi/n)), w = exp(-j*2*pi/n).
+c for the inverse transform the complex exponential w
+c is conjugated.
+c
+ tr=real(cden)
+ ti=aimag(cden)
+ if(invrs.ne.1) go to 330
+c
+c scale inverse transform by 1/n
+c
+ tr=tr/float(n)
+ ti=ti/float(n)
+330 tr=xr(j)-tr
+ ti=xi(j)-ti
+ devabs=sqrt(tr*tr+ti*ti)
+ xmag=sqrt(xr(j)*xr(j)+xi(j)*xi(j))
+ devrel=100.0*devabs/xmag
+ if(devabs.le.devmx1)go to 340
+ devmx1=devabs
+ labs=j-1
+340 if(devrel.le.devmx2)go to 350
+ devmx2=devrel
+ lrel=j-1
+350 continue
+c
+c print the absolute and relative deviations together
+c with their locations.
+c
+ write(iout,380) devabs,labs,devrel,lrel
+380 format(1x,21habsolute deviation = ,e20.12,9h at index,i5/
+ 1 1x,21hrelative deviation = ,f11.7,8h percent,1x,9h at index,i5)
+ go to 50
+ end
diff --git a/math/ieee/chap1/test/test18.f b/math/ieee/chap1/test/test18.f
new file mode 100644
index 00000000..cf550e01
--- /dev/null
+++ b/math/ieee/chap1/test/test18.f
@@ -0,0 +1,71 @@
+c
+c-----------------------------------------------------------------------
+c main program: time-efficient radix-4 fast fourier transform
+c author: l. robert morris
+c department of systems engineering and computing science
+c carleton university, ottawa, canada k1s 5b6
+c
+c input: the array "a" contains the data to be transformed
+c-----------------------------------------------------------------------
+c
+c test program for autogen radix-4 fft
+c
+ dimension a(2048),b(2048)
+ common /aa/a
+c
+ ioutd=i1mach(2)
+c
+c compute dft and idft for n = 64, 256, and 1024 complex points
+c
+ do 1 mm=3,5
+ n=4**mm
+ do 2 j=1,n
+ a(2*j-1)=uni(0)
+ a(2*j )=uni(0)
+ b(2*j-1)=a(2*j-1)
+2 b(2*j )=a(2*j)
+c
+c forward dft
+c
+ call radix4(mm,1,-1)
+c
+ if(mm.ne.3) go to 5
+c
+c list dft input, output for n = 64 only
+c
+ write(ioutd,98)
+ write(ioutd,100)
+ do 3 j=1,n
+ write(ioutd,96) b(2*j-1),b(2*j),a(2*j-1),a(2*j)
+3 continue
+c
+c inverse dft
+c
+5 call radix4(mm,0, 1)
+c
+c list dft input, idft output for n = 64 only
+c
+ if(mm.ne.3) go to 7
+c
+ write(ioutd,99)
+ write(ioutd,100)
+ do 6 j=1,n
+ write(ioutd,96) b(2*j-1),b(2*j),a(2*j-1),a(2*j)
+6 continue
+c
+c calculate rms error
+c
+7 err=0.0
+ do 8 j=1,n
+8 err=err+(a(2*j-1)-b(2*j-1))**2+(a(2*j)-b(2*j))**2
+ err=sqrt(err/float(n))
+ write(ioutd,97) mm,err
+1 continue
+c
+96 format(1x,4(f10.6,2x))
+97 format(1x,20h rms error for m =,i2,4h is ,e14.6/)
+98 format(1x,43h dft input dft output/)
+99 format(1x,43h dft input idft output/)
+100 format(1x,44h real imag real imag/)
+ stop
+ end
diff --git a/math/ieee/chap1/time/time12.f b/math/ieee/chap1/time/time12.f
new file mode 100644
index 00000000..774c2cc9
--- /dev/null
+++ b/math/ieee/chap1/time/time12.f
@@ -0,0 +1,53 @@
+c-----------------------------------------------------------------------
+c
+c-----------------------------------------------------------------------
+c
+ parameter (SIZE = 1024, ILOOP = 100)
+ complex a, w
+ real breal(SIZE), bimag(SIZE), qbreal(SIZE), qbimag(SIZE)
+c
+ ioutd = i1mach(2)
+ nn = SIZE
+ tpi = 8.*atan(1.)
+ tpion = tpi/float(nn)
+ w = cmplx(cos(tpion),-sin(tpion))
+c
+c generate a**k as test function
+c result to b(i) for modification by dft and idft subroutines and
+c a copy to qb(i) to compare final result with for error difference.
+c
+ a = (.9,.3)
+ breal(1) = 1.0
+ bimag(1) = 0.0
+ qbreal(1) = 1.0
+ qbimag(1) = 0.0
+ do 10 k=2,nn
+ w = a**(k-1)
+ breal(k) = real(w)
+ bimag(k) = aimag(w)
+ qbreal(k) = breal(k)
+ qbimag(k) = bimag(k)
+ 10 continue
+c
+c now compute dft, idft, dft, idft, ...
+c first dft is computed specially, in case subroutine needs to be started.
+c
+ call fft842(0, SIZE, breal, bimag)
+ do 25 icount = 1, ILOOP
+ call fft842(1, SIZE, breal, bimag)
+ call fft842(0, SIZE, breal, bimag)
+ 25 continue
+ call fft842(1, SIZE, breal, bimag)
+c
+c calculate rms error between b(i) and qb(i).
+c
+ err = 0.
+ do 30 i=1,nn
+ err = err + (breal(i)-qbreal(i))**2
+ * + (bimag(i)-qbimag(i))**2
+ 30 continue
+ err = sqrt(err / float(nn))
+ write (ioutd,9994) ILOOP, err
+ 9994 format(' rms error, after ', i5, ' loops = ', e15.8)
+ stop
+ end
diff --git a/math/ieee/chap1/time/time17.f b/math/ieee/chap1/time/time17.f
new file mode 100644
index 00000000..adcce4c2
--- /dev/null
+++ b/math/ieee/chap1/time/time17.f
@@ -0,0 +1,53 @@
+c-----------------------------------------------------------------------
+c
+c-----------------------------------------------------------------------
+c
+ parameter (SIZE = 1008, ILOOP = 100)
+ complex a, w
+ real breal(SIZE), bimag(SIZE), qbreal(SIZE), qbimag(SIZE)
+c
+ ioutd = i1mach(2)
+ nn = SIZE
+ tpi = 8.*atan(1.)
+ tpion = tpi/float(nn)
+ w = cmplx(cos(tpion),-sin(tpion))
+c
+c generate a**k as test function
+c result to b(i) for modification by dft and idft subroutines and
+c a copy to qb(i) to compare final result with for error difference.
+c
+ a = (.9,.3)
+ breal(1) = 1.0
+ bimag(1) = 0.0
+ qbreal(1) = 1.0
+ qbimag(1) = 0.0
+ do 10 k=2,nn
+ w = a**(k-1)
+ breal(k) = real(w)
+ bimag(k) = aimag(w)
+ qbreal(k) = breal(k)
+ qbimag(k) = bimag(k)
+ 10 continue
+c
+c now compute dft, idft, dft, idft, ...
+c first dft is computed specially, in case subroutine needs to be started.
+c
+ call wfta(breal, bimag, SIZE, 0, 0, ierr)
+ do 25 icount = 1, ILOOP
+ call wfta(breal, bimag, SIZE, 1, 1, ierr)
+ call wfta(breal, bimag, SIZE, 0, 1, ierr)
+ 25 continue
+ call wfta(breal, bimag, SIZE, 1, 1, ierr)
+c
+c calculate rms error between b(i) and qb(i).
+c
+ err = 0.
+ do 30 i=1,nn
+ err = err + (breal(i)-qbreal(i))**2
+ * + (bimag(i)-qbimag(i))**2
+ 30 continue
+ err = sqrt(err / float(nn))
+ write (ioutd,9994) ILOOP, err
+ 9994 format(' rms error, after ', i5, ' loops = ', e15.8)
+ stop
+ end
diff --git a/math/ieee/chap1/time/time18.f b/math/ieee/chap1/time/time18.f
new file mode 100644
index 00000000..87680554
--- /dev/null
+++ b/math/ieee/chap1/time/time18.f
@@ -0,0 +1,48 @@
+c-----------------------------------------------------------------------
+c
+c-----------------------------------------------------------------------
+c
+ parameter (SIZE = 1024, ILOOP = 100)
+ complex w, b(SIZE), qb(SIZE), a
+ common /aa/ b
+c
+ ioutd = i1mach(2)
+ nn = SIZE
+ tpi = 8.*atan(1.)
+ tpion = tpi/float(nn)
+ w = cmplx(cos(tpion),-sin(tpion))
+c
+c generate a**k as test function
+c result to b(i) for modification by dft and idft subroutines and
+c a copy to qb(i) to compare final result with for error difference.
+c
+ a = (.9,.3)
+ b(1) = (1.,0.)
+ qb(1) = b(1)
+ do 10 k=2,nn
+ b(k) = a**(k-1)
+ qb(k) = b(k)
+ 10 continue
+c
+c now compute dft, idft, dft, idft, ...
+c first dft is computed specially, in case subroutine needs to be started.
+c
+ call radix4(5, 1, -1)
+ do 25 icount = 1, ILOOP
+ call radix4(5, 0, 1)
+ call radix4(5, 0, -1)
+ 25 continue
+ call radix4(5, 0, 1)
+c
+c calculate rms error between b(i) and qb(i).
+c
+ err = 0.
+ do 30 i=1,nn
+ de = cabs(qb(i)-b(i))
+ err = err + de**2
+ 30 continue
+ err = sqrt(err / float(nn))
+ write (ioutd,9994) ILOOP, err
+ 9994 format(' rms error, after ', i5, ' loops = ', e15.8)
+ stop
+ end
diff --git a/math/ieee/chap1/weave1.f b/math/ieee/chap1/weave1.f
new file mode 100644
index 00000000..9c83d0ea
--- /dev/null
+++ b/math/ieee/chap1/weave1.f
@@ -0,0 +1,371 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: weave1
+c this subroutine implements the different pre-weave
+c modules of the wfta. the working arrays are sr and si.
+c the routine checks to see which factors are present
+c in the transform length n = na*nb*nc*nd and executes
+c the pre-weave code for these factors.
+c
+c-----------------------------------------------------------------------
+c
+ subroutine weave1(sr,si)
+ common na,nb,nc,nd,nd1,nd2,nd3,nd4
+ dimension q(8),t(16)
+ dimension sr(1),si(1)
+ if(na.eq.1) go to 300
+ if(na.ne.2) go to 800
+c
+c **********************************************************************
+c
+c the following code implements the 2 point pre-weave module
+c
+c **********************************************************************
+c
+ nlup2=2*(nd2-nb)
+ nlup23=2*nd2*(nd3-nc)
+ nbase=1
+ do 240 n4=1,nd
+ do 230 n3=1,nc
+ do 220 n2=1,nb
+ nr1=nbase+1
+ t0=sr(nbase)+sr(nr1)
+ sr(nr1)=sr(nbase)-sr(nr1)
+ sr(nbase)=t0
+ t0=si(nbase)+si(nr1)
+ si(nr1)=si(nbase)-si(nr1)
+ si(nbase)=t0
+220 nbase=nbase+2
+230 nbase=nbase+nlup2
+240 nbase=nbase+nlup23
+800 if(na.ne.8) go to 1600
+c
+c **********************************************************************
+c
+c the following code implements the 8 point pre-weave module
+c
+c **********************************************************************
+c
+ nlup2=8*(nd2-nb)
+ nlup23=8*nd2*(nd3-nc)
+ nbase=1
+ do 840 n4=1,nd
+ do 830 n3=1,nc
+ do 820 n2=1,nb
+ nr1=nbase+1
+ nr2=nr1+1
+ nr3=nr2+1
+ nr4=nr3+1
+ nr5=nr4+1
+ nr6=nr5+1
+ nr7=nr6+1
+ t3=sr(nr3)+sr(nr7)
+ t7=sr(nr3)-sr(nr7)
+ t0=sr(nbase)+sr(nr4)
+ sr(nr4)=sr(nbase)-sr(nr4)
+ t1=sr(nr1)+sr(nr5)
+ t5=sr(nr1)-sr(nr5)
+ t2=sr(nr2)+sr(nr6)
+ sr(nr6)=sr(nr2)-sr(nr6)
+ sr(nbase)=t0+t2
+ sr(nr2)=t0-t2
+ sr(nr1)=t1+t3
+ sr(nr3)=t1-t3
+ sr(nr5)=t5+t7
+ sr(nr7)=t5-t7
+ t3=si(nr3)+si(nr7)
+ t7=si(nr3)-si(nr7)
+ t0=si(nbase)+si(nr4)
+ si(nr4)=si(nbase)-si(nr4)
+ t1=si(nr1)+si(nr5)
+ t5=si(nr1)-si(nr5)
+ t2=si(nr2)+si(nr6)
+ si(nr6)=si(nr2)-si(nr6)
+ si(nbase)=t0+t2
+ si(nr2)=t0-t2
+ si(nr1)=t1+t3
+ si(nr3)=t1-t3
+ si(nr5)=t5+t7
+ si(nr7)=t5-t7
+820 nbase=nbase+8
+830 nbase=nbase+nlup2
+840 nbase=nbase+nlup23
+1600 if(na.ne.16) go to 300
+c
+c **********************************************************************
+c
+c the following code implements the 16 point pre-weave module
+c
+c **********************************************************************
+c
+ nlup2=18*(nd2-nb)
+ nlup23=18*nd2*(nd3-nc)
+ nbase=1
+ do 1640 n4=1,nd
+ do 1630 n3=1,nc
+ do 1620 n2=1,nb
+ nr1=nbase+1
+ nr2=nr1+1
+ nr3=nr2+1
+ nr4=nr3+1
+ nr5=nr4+1
+ nr6=nr5+1
+ nr7=nr6+1
+ nr8=nr7+1
+ nr9=nr8+1
+ nr10=nr9+1
+ nr11=nr10+1
+ nr12=nr11+1
+ nr13=nr12+1
+ nr14=nr13+1
+ nr15=nr14+1
+ nr16=nr15+1
+ nr17=nr16+1
+ jbase=nbase
+ do 1645 j=1,8
+ t(j)=sr(jbase)+sr(jbase+8)
+ t(j+8)=sr(jbase)-sr(jbase+8)
+ jbase=jbase+1
+1645 continue
+ do 1650 j=1,4
+ q(j)=t(j)+t(j+4)
+ q(j+4)=t(j)-t(j+4)
+1650 continue
+ sr(nbase)=q(1)+q(3)
+ sr(nr2)=q(1)-q(3)
+ sr(nr1)=q(2)+q(4)
+ sr(nr3)=q(2)-q(4)
+ sr(nr5)=q(6)+q(8)
+ sr(nr7)=q(6)-q(8)
+ sr(nr4)=q(5)
+ sr(nr6)=q(7)
+ sr(nr8)=t(9)
+ sr(nr9)=t(10)+t(16)
+ sr(nr15)=t(10)-t(16)
+ sr(nr13)=t(14)+t(12)
+ sr(nr11)=t(14)-t(12)
+ sr(nr17)=sr(nr11)+sr(nr15)
+ sr(nr16)=sr(nr9)+sr(nr13)
+ sr(nr10)=t(11)+t(15)
+ sr(nr14)=t(11)-t(15)
+ sr(nr12)=t(13)
+ jbase=nbase
+ do 1745 j=1,8
+ t(j)=si(jbase)+si(jbase+8)
+ t(j+8)=si(jbase)-si(jbase+8)
+ jbase=jbase+1
+1745 continue
+ do 1750 j=1,4
+ q(j)=t(j)+t(j+4)
+ q(j+4)=t(j)-t(j+4)
+1750 continue
+ si(nbase)=q(1)+q(3)
+ si(nr2)=q(1)-q(3)
+ si(nr1)=q(2)+q(4)
+ si(nr3)=q(2)-q(4)
+ si(nr5)=q(6)+q(8)
+ si(nr7)=q(6)-q(8)
+ si(nr4)=q(5)
+ si(nr6)=q(7)
+ si(nr8)=t(9)
+ si(nr9)=t(10)+t(16)
+ si(nr15)=t(10)-t(16)
+ si(nr13)=t(14)+t(12)
+ si(nr11)=t(14)-t(12)
+ si(nr17)=si(nr11)+si(nr15)
+ si(nr16)=si(nr9)+si(nr13)
+ si(nr10)=t(11)+t(15)
+ si(nr14)=t(11)-t(15)
+ si(nr12)=t(13)
+1620 nbase=nbase+18
+1630 nbase=nbase+nlup2
+1640 nbase=nbase+nlup23
+300 if(nb.eq.1) go to 700
+ if(nb.ne.3) go to 900
+c
+c **********************************************************************
+c
+c the following code implements the 3 point pre-weave module
+c
+c **********************************************************************
+c
+ nlup2=2*nd1
+ nlup23=3*nd1*(nd3-nc)
+ nbase=1
+ noff=nd1
+ do 340 n4=1,nd
+ do 330 n3=1,nc
+ do 310 n2=1,nd1
+ nr1=nbase+noff
+ nr2=nr1+noff
+ t1=sr(nr1)+sr(nr2)
+ sr(nbase)=sr(nbase)+t1
+ sr(nr2)=sr(nr1)-sr(nr2)
+ sr(nr1)=t1
+ t1=si(nr1)+si(nr2)
+ si(nbase)=si(nbase)+t1
+ si(nr2)=si(nr1)-si(nr2)
+ si(nr1)=t1
+310 nbase=nbase+1
+330 nbase=nbase+nlup2
+340 nbase=nbase+nlup23
+900 if(nb.ne.9) go to 700
+c
+c **********************************************************************
+c
+c the following code implements the 9 point pre-weave module
+c
+c **********************************************************************
+c
+ nlup2=10*nd1
+ nlup23=11*nd1*(nd3-nc)
+ nbase=1
+ noff=nd1
+ do 940 n4=1,nd
+ do 930 n3=1,nc
+ do 910 n2=1,nd1
+ nr1=nbase+noff
+ nr2=nr1+noff
+ nr3=nr2+noff
+ nr4=nr3+noff
+ nr5=nr4+noff
+ nr6=nr5+noff
+ nr7=nr6+noff
+ nr8=nr7+noff
+ nr9=nr8+noff
+ nr10=nr9+noff
+ t3=sr(nr3)+sr(nr6)
+ t6=sr(nr3)-sr(nr6)
+ sr(nbase)=sr(nbase)+t3
+ t7=sr(nr7)+sr(nr2)
+ t2=sr(nr7)-sr(nr2)
+ sr(nr2)=t6
+ t1=sr(nr1)+sr(nr8)
+ t8=sr(nr1)-sr(nr8)
+ sr(nr1)=t3
+ t4=sr(nr4)+sr(nr5)
+ t5=sr(nr4)-sr(nr5)
+ sr(nr3)=t1+t4+t7
+ sr(nr4)=t1-t7
+ sr(nr5)=t4-t1
+ sr(nr6)=t7-t4
+ sr(nr10)=t2+t5+t8
+ sr(nr7)=t8-t2
+ sr(nr8)=t5-t8
+ sr(nr9)=t2-t5
+ t3=si(nr3)+si(nr6)
+ t6=si(nr3)-si(nr6)
+ si(nbase)=si(nbase)+t3
+ t7=si(nr7)+si(nr2)
+ t2=si(nr7)-si(nr2)
+ si(nr2)=t6
+ t1=si(nr1)+si(nr8)
+ t8=si(nr1)-si(nr8)
+ si(nr1)=t3
+ t4=si(nr4)+si(nr5)
+ t5=si(nr4)-si(nr5)
+ si(nr3)=t1+t4+t7
+ si(nr4)=t1-t7
+ si(nr5)=t4-t1
+ si(nr6)=t7-t4
+ si(nr10)=t2+t5+t8
+ si(nr7)=t8-t2
+ si(nr8)=t5-t8
+ si(nr9)=t2-t5
+910 nbase=nbase+1
+930 nbase=nbase+nlup2
+940 nbase=nbase+nlup23
+700 if(nc.ne.7) go to 500
+c
+c **********************************************************************
+c
+c the following code implements the 7 point pre-weave module
+c
+c **********************************************************************
+c
+ noff=nd1*nd2
+ nbase=1
+ nlup2=8*noff
+ do 740 n4=1,nd
+ do 710 n1=1,noff
+ nr1=nbase+noff
+ nr2=nr1+noff
+ nr3=nr2+noff
+ nr4=nr3+noff
+ nr5=nr4+noff
+ nr6=nr5+noff
+ nr7=nr6+noff
+ nr8=nr7+noff
+ t1=sr(nr1)+sr(nr6)
+ t6=sr(nr1)-sr(nr6)
+ t4=sr(nr4)+sr(nr3)
+ t3=sr(nr4)-sr(nr3)
+ t2=sr(nr2)+sr(nr5)
+ t5=sr(nr2)-sr(nr5)
+ sr(nr5)=t6-t3
+ sr(nr2)=t5+t3+t6
+ sr(nr6)=t5-t6
+ sr(nr8)=t3-t5
+ sr(nr3)=t2-t1
+ sr(nr4)=t1-t4
+ sr(nr7)=t4-t2
+ t1=t1+t4+t2
+ sr(nbase)=sr(nbase)+t1
+ sr(nr1)=t1
+ t1=si(nr1)+si(nr6)
+ t6=si(nr1)-si(nr6)
+ t4=si(nr4)+si(nr3)
+ t3=si(nr4)-si(nr3)
+ t2=si(nr2)+si(nr5)
+ t5=si(nr2)-si(nr5)
+ si(nr5)=t6-t3
+ si(nr2)=t5+t3+t6
+ si(nr6)=t5-t6
+ si(nr8)=t3-t5
+ si(nr3)=t2-t1
+ si(nr4)=t1-t4
+ si(nr7)=t4-t2
+ t1=t1+t4+t2
+ si(nbase)=si(nbase)+t1
+ si(nr1)=t1
+710 nbase=nbase+1
+740 nbase=nbase+nlup2
+500 if(nd.ne.5) return
+c
+c **********************************************************************
+c
+c the following code implements the 5 point pre-weave module
+c
+c **********************************************************************
+c
+ noff=nd1*nd2*nd3
+ nbase=1
+ do 510 n1=1,noff
+ nr1=nbase+noff
+ nr2=nr1+noff
+ nr3=nr2+noff
+ nr4=nr3+noff
+ nr5=nr4+noff
+ t4=sr(nr1)-sr(nr4)
+ t1=sr(nr1)+sr(nr4)
+ t3=sr(nr3)+sr(nr2)
+ t2=sr(nr3)-sr(nr2)
+ sr(nr3)=t1-t3
+ sr(nr1)=t1+t3
+ sr(nbase)=sr(nbase)+sr(nr1)
+ sr(nr5)=t2+t4
+ sr(nr2)=t4
+ sr(nr4)=t2
+ t4=si(nr1)-si(nr4)
+ t1=si(nr1)+si(nr4)
+ t3=si(nr3)+si(nr2)
+ t2=si(nr3)-si(nr2)
+ si(nr3)=t1-t3
+ si(nr1)=t1+t3
+ si(nbase)=si(nbase)+si(nr1)
+ si(nr5)=t2+t4
+ si(nr2)=t4
+ si(nr4)=t2
+510 nbase=nbase+1
+ return
+ end
diff --git a/math/ieee/chap1/weave2.f b/math/ieee/chap1/weave2.f
new file mode 100644
index 00000000..5c04ff91
--- /dev/null
+++ b/math/ieee/chap1/weave2.f
@@ -0,0 +1,412 @@
+c
+c-----------------------------------------------------------------------
+c
+c subroutine: weave2
+c this subroutine implements the post-weave modules
+c of the wfta. the working arrays are sr and si.
+c the routine checks to see which factors are present
+c in the transform length n = na*nb*nc*nd and executes
+c the post-weave code for these factors.
+c
+c-----------------------------------------------------------------------
+c
+ subroutine weave2(sr,si)
+ common na,nb,nc,nd,nd1,nd2,nd3,nd4
+ dimension sr(1),si(1)
+ dimension q(8),t(16)
+ if(nd.ne.5) go to 700
+c
+c **********************************************************************
+c
+c the following code implements the 5 point post-weave module
+c
+c **********************************************************************
+c
+ noff=nd1*nd2*nd3
+ nbase=1
+ do 510 n1=1,noff
+ nr1=nbase+noff
+ nr2=nr1+noff
+ nr3=nr2+noff
+ nr4=nr3+noff
+ nr5=nr4+noff
+ t1=sr(nbase)+sr(nr1)
+ t3=t1-sr(nr3)
+ t1=t1+sr(nr3)
+ t4=si(nr2)+si(nr5)
+ t2=si(nr4)+si(nr5)
+ sr(nr1)=t1-t4
+ sr4=t1+t4
+ sr2=t3+t2
+ sr(nr3)=t3-t2
+ t1=si(nbase)+si(nr1)
+ t3=t1-si(nr3)
+ t1=t1+si(nr3)
+ t4=sr(nr2)+sr(nr5)
+ t2=sr(nr4)+sr(nr5)
+ si(nr1)=t1+t4
+ si(nr4)=t1-t4
+ si(nr2)=t3-t2
+ si(nr3)=t3+t2
+ sr(nr2)=sr2
+ sr(nr4)=sr4
+510 nbase=nbase+1
+700 if(nc.ne.7) go to 300
+c
+c **********************************************************************
+c
+c the following code implements the 7 point post-weave module
+c
+c **********************************************************************
+c
+ noff=nd1*nd2
+ nbase=1
+ nlup2=8*noff
+ do 740 n4=1,nd
+ do 710 n1=1,noff
+ nr1=nbase+noff
+ nr2=nr1+noff
+ nr3=nr2+noff
+ nr4=nr3+noff
+ nr5=nr4+noff
+ nr6=nr5+noff
+ nr7=nr6+noff
+ nr8=nr7+noff
+ t1=sr(nr1)+sr(nbase)
+ t2=t1-sr(nr3)-sr(nr4)
+ t4=t1+sr(nr3)-sr(nr7)
+ t1=t1+sr(nr4)+sr(nr7)
+ t6=si(nr2)+si(nr5)+si(nr8)
+ t5=si(nr2)-si(nr5)-si(nr6)
+ t3=si(nr2)+si(nr6)-si(nr8)
+ sr(nr1)=t1-t6
+ sr6=t1+t6
+ sr2=t2-t5
+ sr5=t2+t5
+ sr(nr4)=t4-t3
+ sr(nr3)=t4+t3
+ t1=si(nr1)+si(nbase)
+ t2=t1-si(nr3)-si(nr4)
+ t4=t1+si(nr3)-si(nr7)
+ t1=t1+si(nr4)+si(nr7)
+ t6=sr(nr2)+sr(nr5)+sr(nr8)
+ t5=sr(nr2)-sr(nr5)-sr(nr6)
+ t3=sr(nr2)+sr(nr6)-sr(nr8)
+ si(nr1)=t1+t6
+ si(nr6)=t1-t6
+ si(nr2)=t2+t5
+ si(nr5)=t2-t5
+ si(nr4)=t4+t3
+ si(nr3)=t4-t3
+ sr(nr2)=sr2
+ sr(nr5)=sr5
+ sr(nr6)=sr6
+710 nbase=nbase+1
+740 nbase=nbase+nlup2
+300 if(nb.eq.1) go to 400
+ if(nb.ne.3) go to 900
+c
+c **********************************************************************
+c
+c the following code implements the 3 point post-weave module
+c
+c **********************************************************************
+c
+ nlup2=2*nd1
+ nlup23=3*nd1*(nd3-nc)
+ nbase=1
+ noff=nd1
+ do 340 n5=1,nd
+ do 330 n4=1,nc
+ do 310 n2=1,nd1
+ nr1=nbase+noff
+ nr2=nr1+noff
+ t1=sr(nbase)+sr(nr1)
+ sr(nr1)=t1-si(nr2)
+ sr2=t1+si(nr2)
+ t1=si(nbase)+si(nr1)
+ si(nr1)=t1+sr(nr2)
+ si(nr2)=t1-sr(nr2)
+ sr(nr2)=sr2
+310 nbase=nbase+1
+330 nbase=nbase+nlup2
+340 nbase=nbase+nlup23
+900 if(nb.ne.9) go to 400
+c
+c **********************************************************************
+c
+c the following code implements the 9 point post-weave module
+c
+c **********************************************************************
+c
+ nlup2=10*nd1
+ nlup23=11*nd1*(nd3-nc)
+ nbase=1
+ noff=nd1
+ do 940 n4=1,nd
+ do 930 n3=1,nc
+ do 910 n2=1,nd1
+ nr1=nbase+noff
+ nr2=nr1+noff
+ nr3=nr2+noff
+ nr4=nr3+noff
+ nr5=nr4+noff
+ nr6=nr5+noff
+ nr7=nr6+noff
+ nr8=nr7+noff
+ nr9=nr8+noff
+ nr10=nr9+noff
+ t3=sr(nbase)-sr(nr3)
+ t7=sr(nbase)+sr(nr1)
+ sr(nbase)=sr(nbase)+sr(nr3)+sr(nr3)
+ t6=t3+si(nr10)
+ sr(nr3)=t3-si(nr10)
+ t4=t7+sr(nr5)-sr(nr6)
+ t1=t7-sr(nr4)-sr(nr5)
+ t7=t7+sr(nr4)+sr(nr6)
+ sr(nr6)=t6
+ t8=si(nr2)-si(nr7)-si(nr8)
+ t5=si(nr2)+si(nr8)-si(nr9)
+ t2=si(nr2)+si(nr7)+si(nr9)
+ sr(nr1)=t7-t2
+ sr8=t7+t2
+ sr(nr4)=t1-t8
+ sr(nr5)=t1+t8
+ sr7=t4-t5
+ sr2=t4+t5
+ t3=si(nbase)-si(nr3)
+ t7=si(nbase)+si(nr1)
+ si(nbase)=si(nbase)+si(nr3)+si(nr3)
+ t6=t3-sr(nr10)
+ si(nr3)=t3+sr(nr10)
+ t4=t7+si(nr5)-si(nr6)
+ t1=t7-si(nr4)-si(nr5)
+ t7=t7+si(nr4)+si(nr6)
+ si(nr6)=t6
+ t8=sr(nr2)-sr(nr7)-sr(nr8)
+ t5=sr(nr2)+sr(nr8)-sr(nr9)
+ t2=sr(nr2)+sr(nr7)+sr(nr9)
+ si(nr1)=t7+t2
+ si(nr8)=t7-t2
+ si(nr4)=t1+t8
+ si(nr5)=t1-t8
+ si(nr7)=t4+t5
+ si(nr2)=t4-t5
+ sr(nr2)=sr2
+ sr(nr7)=sr7
+ sr(nr8)=sr8
+910 nbase=nbase+1
+930 nbase=nbase+nlup2
+940 nbase=nbase+nlup23
+400 if(na.eq.1) return
+ if(na.ne.4) go to 800
+c
+c **********************************************************************
+c
+c the following code implements the 4 point post-weave module
+c
+c **********************************************************************
+c
+ nlup2=4*(nd2-nb)
+ nlup23=4*nd2*(nd3-nc)
+ nbase=1
+ do 440 n4=1,nd
+ do 430 n3=1,nc
+ do 420 n2=1,nb
+ nr1=nbase+1
+ nr2=nr1+1
+ nr3=nr2+1
+ tr0=sr(nbase)+sr(nr2)
+ tr2=sr(nbase)-sr(nr2)
+ tr1=sr(nr1)+sr(nr3)
+ tr3=sr(nr1)-sr(nr3)
+ ti1=si(nr1)+si(nr3)
+ ti3=si(nr1)-si(nr3)
+ sr(nbase)=tr0+tr1
+ sr(nr2)=tr0-tr1
+ sr(nr1)=tr2+ti3
+ sr(nr3)=tr2-ti3
+ ti0=si(nbase)+si(nr2)
+ ti2=si(nbase)-si(nr2)
+ si(nbase)=ti0+ti1
+ si(nr2)=ti0-ti1
+ si(nr1)=ti2-tr3
+ si(nr3)=ti2+tr3
+420 nbase=nbase+4
+430 nbase=nbase+nlup2
+440 nbase=nbase+nlup23
+800 if(na.ne.8) go to 1600
+c
+c **********************************************************************
+c
+c the following code implements the 8 point post-weave module
+c
+c **********************************************************************
+c
+ nlup2=8*(nd2-nb)
+ nlup23=8*nd2*(nd3-nc)
+ nbase=1
+ do 840 n4=1,nd
+ do 830 n3=1,nc
+ do 820 n2=1,nb
+ nr1=nbase+1
+ nr2=nr1+1
+ nr3=nr2+1
+ nr4=nr3+1
+ nr5=nr4+1
+ nr6=nr5+1
+ nr7=nr6+1
+ t1=sr(nbase)-sr(nr1)
+ sr(nbase)=sr(nbase)+sr(nr1)
+ sr6=sr(nr2)+si(nr3)
+ sr(nr2)=sr(nr2)-si(nr3)
+ t4=sr(nr4)-si(nr5)
+ t5=sr(nr4)+si(nr5)
+ t6=sr(nr7)-si(nr6)
+ t7=sr(nr7)+si(nr6)
+ sr(nr4)=t1
+ sr(nr1)=t4+t6
+ sr3=t4-t6
+ sr5=t5-t7
+ sr(nr7)=t5+t7
+ t1=si(nbase)-si(nr1)
+ si(nbase)=si(nbase)+si(nr1)
+ t3=si(nr2)-sr(nr3)
+ si(nr2)=si(nr2)+sr(nr3)
+ t4=si(nr4)+sr(nr5)
+ t5=si(nr4)-sr(nr5)
+ si(nr6)=t3
+ t6=sr(nr6)+si(nr7)
+ t7=sr(nr6)-si(nr7)
+ si(nr4)=t1
+ si(nr1)=t4+t6
+ si(nr3)=t4-t6
+ si(nr5)=t5+t7
+ si(nr7)=t5-t7
+ sr(nr3)=sr3
+ sr(nr5)=sr5
+ sr(nr6)=sr6
+820 nbase=nbase+8
+830 nbase=nbase+nlup2
+840 nbase=nbase+nlup23
+1600 if(na.ne.16) return
+c
+c **********************************************************************
+c
+c the following code implements the 16 point post-weave module
+c
+c **********************************************************************
+c
+ nlup2=18*(nd2-nb)
+ nlup23=18*nd2*(nd3-nc)
+ nbase=1
+ do 1640 n4=1,nd
+ do 1630 n3=1,nc
+ do 1620 n2=1,nb
+ nr1=nbase+1
+ nr2=nr1+1
+ nr3=nr2+1
+ nr4=nr3+1
+ nr5=nr4+1
+ nr6=nr5+1
+ nr7=nr6+1
+ nr8=nr7+1
+ nr9=nr8+1
+ nr10=nr9+1
+ nr11=nr10+1
+ nr12=nr11+1
+ nr13=nr12+1
+ nr14=nr13+1
+ nr15=nr14+1
+ nr16=nr15+1
+ nr17=nr16+1
+ t(2)=sr(nbase)-sr(nr1)
+ sr(nbase)=sr(nr1)+sr(nbase)
+ t(4)=sr(nr2)+si(nr3)
+ t(3)=sr(nr2)-si(nr3)
+ t(6)=sr(nr4)+si(nr5)
+ t(5)=sr(nr4)-si(nr5)
+ t(8)=-si(nr6)-sr(nr7)
+ t(7)=-si(nr6)+sr(nr7)
+ t(9)=sr(nr8)+sr(nr14)
+ t(15)=sr(nr8)-sr(nr14)
+ t(13)=-si(nr10)-si(nr12)
+ t(11)=si(nr10)-si(nr12)
+ t(16)=sr(nr15)-sr(nr17)
+ t(12)=sr(nr11)-sr(nr17)
+ t(10)=-si(nr9)-si(nr16)
+ t(14)=-si(nr16)+si(nr13)
+ sr(nr2)=t(5)+t(7)
+ sr6=t(5)-t(7)
+ sr10=t(6)+t(8)
+ sr(nr14)=t(6)-t(8)
+ q(7)=t(9)+t(10)
+ q(8)=t(9)-t(10)
+ q(1)=t(11)+t(12)
+ q(2)=t(11)-t(12)
+ q(4)=t(14)+t(15)
+ q(5)=t(15)-t(14)
+ q(3)=t(13)+t(16)
+ q(6)=t(13)-t(16)
+ sr(nr1)=q(3)+q(7)
+ sr(nr7)=q(7)-q(3)
+ sr9=q(8)+q(6)
+ sr(nr15)=q(8)-q(6)
+ sr5=q(1)+q(4)
+ sr3=q(4)-q(1)
+ sr13=q(2)+q(5)
+ sr11=q(5)-q(2)
+ sr(nr8)=t(2)
+ sr(nr4)=t(3)
+ sr12=t(4)
+ t(2)=si(nbase)-si(nr1)
+ si(nbase)=si(nr1)+si(nbase)
+ t(4)=si(nr2)-sr(nr3)
+ t(3)=si(nr2)+sr(nr3)
+ t(6)=si(nr4)-sr(nr5)
+ t(5)=si(nr4)+sr(nr5)
+ t(8)=sr(nr6)-si(nr7)
+ t(7)=sr(nr6)+si(nr7)
+ t(9)=si(nr8)+si(nr14)
+ t(15)=si(nr8)-si(nr14)
+ t(13)=sr(nr10)+sr(nr12)
+ t(11)=sr(nr12)-sr(nr10)
+ t(16)=si(nr15)-si(nr17)
+ t(12)=si(nr11)-si(nr17)
+ t(10)=sr(nr9)+sr(nr16)
+ si(nr2)=t(5)+t(7)
+ si(nr6)=t(5)-t(7)
+ si(nr10)=t(6)+t(8)
+ si(nr14)=t(6)-t(8)
+ q(7)=t(9)+t(10)
+ q(8)=t(9)-t(10)
+ q(1)=t(11)+t(12)
+ q(2)=t(11)-t(12)
+ q(4)=t(14)+t(15)
+ q(5)=t(15)-t(14)
+ q(3)=t(13)+t(16)
+ q(6)=t(13)-t(16)
+ si(nr1)=q(3)+q(7)
+ si(nr7)=q(7)-q(3)
+ si(nr9)=q(8)+q(6)
+ si(nr15)=q(8)-q(6)
+ si(nr5)=q(1)+q(4)
+ si(nr3)=q(4)-q(1)
+ si(nr13)=q(2)+q(5)
+ si(nr11)=q(5)-q(2)
+ si(nr8)=t(2)
+ si(nr4)=t(3)
+ si(nr12)=t(4)
+ sr(nr3)=sr3
+ sr(nr5)=sr5
+ sr(nr6)=sr6
+ sr(nr9)=sr9
+ sr(nr10)=sr10
+ sr(nr11)=sr11
+ sr(nr12)=sr12
+ sr(nr13)=sr13
+1620 nbase=nbase+18
+1630 nbase=nbase+nlup2
+1640 nbase=nbase+nlup23
+ return
+ end
diff --git a/math/ieee/chap1/wfta.f b/math/ieee/chap1/wfta.f
new file mode 100644
index 00000000..9e819941
--- /dev/null
+++ b/math/ieee/chap1/wfta.f
@@ -0,0 +1,150 @@
+c
+c-----------------------------------------------------------------------
+c subroutine: wfta
+c winograd fourier transform algorithm
+c-----------------------------------------------------------------------
+c
+ subroutine wfta(xr,xi,n,invrs,init,ierr)
+ dimension xr(1),xi(1)
+c
+c inputs:
+c n-- transform length. must be formed as the product of
+c relatively prime integers from the set:
+c 2,3,4,5,7,8,9,16
+c thus the largest possible value of n is 5040.
+c xr(.)-- array that holds the real part of the data
+c to be transformed.
+c xi(.)-- array that holds the imaginary part of the
+c data to be transformed.
+c invrs-- parameter that flags whether or not the inverse
+c transform is to be calculated. a division by n
+c is included in the inverse.
+c invrs = 1 yields inverse transform
+c invrs .ne. 1 gives forward transform
+c init-- parameter that flags whether or not the program
+c is to be initialized for this value of n. the
+c initialization is performed only once in order to
+c to speed up the computation on succeeding calls
+c to the wfta routine, when n is held fixed.
+c init = 0 results in initialization.
+c ierr-- error code that is negative when the wfta
+c terminates incorrectly.
+c 0 = successful completion
+c -1 = this value of n does not factor properly
+c -2 = an initialization has not been done for
+c this value of n.
+c
+c
+c the following two cards may be changed if the maximum
+c desired transform length is less than 5040
+c
+c *********************************************************************
+ dimension sr(1782),si(1782),coef(1782)
+ integer indx1(1008),indx2(1008)
+c *********************************************************************
+c
+ common na,nb,nc,nd,nd1,nd2,nd3,nd4
+c
+c test for initial run
+c
+ if(init.eq.0) call inishl(n,coef,xr,xi,indx1,indx2,ierr)
+c
+ if(ierr.lt.0) return
+ m=na*nb*nc*nd
+ if(m.eq.n) go to 100
+ ierr=-2
+ return
+c
+c error(-2)-- program not initialized for this value of n
+c
+100 nmult=nd1*nd2*nd3*nd4
+c
+c the following code maps the data arrays xr and xi to
+c the working arrays sr and si via the mapping vector
+c indx1(.). the permutation of the data follows the
+c sino correspondence of the chinese remainder theorem.
+c
+ j=1
+ k=1
+ inc1=nd1-na
+ inc2=nd1*(nd2-nb)
+ inc3=nd1*nd2*(nd3-nc)
+ do 140 n4=1,nd
+ do 130 n3=1,nc
+ do 120 n2=1,nb
+ do 110 n1=1,na
+ ind=indx1(k)
+ sr(j)=xr(ind)
+ si(j)=xi(ind)
+ k=k+1
+110 j=j+1
+120 j=j+inc1
+130 j=j+inc2
+140 j=j+inc3
+c
+c do the pre-weave modules
+c
+ call weave1(sr,si)
+c
+c the following loop performs all the multiplications of the
+c winograd fourier transform algorithm. the multiplication
+c coefficients are stored on the initialization pass in the
+c array coef(.).
+c
+ do 200 j=1,nmult
+ sr(j)=sr(j)*coef(j)
+ si(j)=si(j)*coef(j)
+ 200 continue
+c
+c do the post-weave modules
+c
+ call weave2(sr,si)
+c
+c
+c the following code maps the working arrays sr and si
+c to the data arrays xr and xi via the mapping vector
+c indx2(.). the permutation of the data follows the
+c chinese remainder theorem.
+c
+ j=1
+ k=1
+ inc1=nd1-na
+ inc2=nd1*(nd2-nb)
+ inc3=nd1*nd2*(nd3-nc)
+c
+c check for inverse
+c
+ if(invrs.eq.1) go to 400
+ do 340 n4=1,nd
+ do 330 n3=1,nc
+ do 320 n2=1,nb
+ do 310 n1=1,na
+ kndx=indx2(k)
+ xr(kndx)=sr(j)
+ xi(kndx)=si(j)
+ k=k+1
+310 j=j+1
+320 j=j+inc1
+330 j=j+inc2
+340 j=j+inc3
+ return
+c
+c different permutation for the inverse
+c
+400 fn=float(n)
+ np2=n+2
+ indx2(1)=n+1
+ do 440 n4=1,nd
+ do 430 n3=1,nc
+ do 420 n2=1,nb
+ do 410 n1=1,na
+ kndx=np2-indx2(k)
+ xr(kndx)=sr(j)/fn
+ xi(kndx)=si(j)/fn
+ k=k+1
+410 j=j+1
+420 j=j+inc1
+430 j=j+inc2
+440 j=j+inc3
+ return
+ end
diff --git a/math/ieee/d1mach.f b/math/ieee/d1mach.f
new file mode 100644
index 00000000..699468ab
--- /dev/null
+++ b/math/ieee/d1mach.f
@@ -0,0 +1,256 @@
+c
+c----------------------------------------------------------------------
+c function: d1mach
+c this routine is from the port mathematical subroutine library
+c it is described in the bell laboratories computing science
+c technical report #47 by p.a. fox, a.d. hall and n.l. schryer
+c a modification to the "i out of bounds" error message
+c has been made by c. a. mcgonegal - april, 1978
+c----------------------------------------------------------------------
+c
+ double precision function d1mach(i)
+c
+c double-precision machine constants
+c
+c d1mach( 1) = b**(emin-1), the smallest positive magnitude.
+c
+c d1mach( 2) = b**emax*(1 - b**(-t)), the largest magnitude.
+c
+c d1mach( 3) = b**(-t), the smallest relative spacing.
+c
+c d1mach( 4) = b**(1-t), the largest relative spacing.
+c
+c d1mach( 5) = log10(b)
+c
+c to alter this function for a particular environment,
+c the desired set of data statements should be activated by
+c removing the c from column 1.
+c
+c where possible, octal or hexadecimal constants have been used
+c to specify the constants exactly which has in some cases
+c required the use of equivalent integer arrays.
+c
+ integer small(4)
+ integer large(4)
+ integer right(4)
+ integer diver(4)
+ integer log10(4)
+c
+ double precision dmach(5)
+c
+ equivalence (dmach(1),small(1))
+ equivalence (dmach(2),large(1))
+ equivalence (dmach(3),right(1))
+ equivalence (dmach(4),diver(1))
+ equivalence (dmach(5),log10(1))
+c
+c machine constants for the burroughs 1700 system.
+c
+c data small(1) / zc00800000 /
+c data small(2) / z000000000 /
+c
+c data large(1) / zdffffffff /
+c data large(2) / zfffffffff /
+c
+c data right(1) / zcc5800000 /
+c data right(2) / z000000000 /
+c
+c data diver(1) / zcc6800000 /
+c data diver(2) / z000000000 /
+c
+c data log10(1) / zd00e730e7 /
+c data log10(2) / zc77800dc0 /
+c
+c machine constants for the burroughs 5700 system.
+c
+c data small(1) / o1771000000000000 /
+c data small(2) / o0000000000000000 /
+c
+c data large(1) / o0777777777777777 /
+c data large(2) / o0007777777777777 /
+c
+c data right(1) / o1461000000000000 /
+c data right(2) / o0000000000000000 /
+c
+c data diver(1) / o1451000000000000 /
+c data diver(2) / o0000000000000000 /
+c
+c data log10(1) / o1157163034761674 /
+c data log10(2) / o0006677466732724 /
+c
+c machine constants for the burroughs 6700/7700 systems.
+c
+c data small(1) / o1771000000000000 /
+c data small(2) / o7770000000000000 /
+c
+c data large(1) / o0777777777777777 /
+c data large(2) / o7777777777777777 /
+c
+c data right(1) / o1461000000000000 /
+c data right(2) / o0000000000000000 /
+c
+c data diver(1) / o1451000000000000 /
+c data diver(2) / o0000000000000000 /
+c
+c data log10(1) / o1157163034761674 /
+c data log10(2) / o0006677466732724 /
+c
+c machine constants for the cdc 6000/7000 series.
+c
+c data small(1) / 00604000000000000000b /
+c data small(2) / 00000000000000000000b /
+c
+c data large(1) / 37767777777777777777b /
+c data large(2) / 37167777777777777777b /
+c
+c data right(1) / 15604000000000000000b /
+c data right(2) / 15000000000000000000b /
+c
+c data diver(1) / 15614000000000000000b /
+c data diver(2) / 15010000000000000000b /
+c
+c data log10(1) / 17164642023241175717b /
+c data log10(2) / 16367571421742254654b /
+c
+c machine constants for the cray 1
+c
+c data small(1) / 200004000000000000000b /
+c data small(2) / 000000000000000000000b /
+c
+c data large(1) / 577767777777777777777b /
+c data large(2) / 000007777777777777776b /
+c
+c data right(1) / 376424000000000000000b /
+c data right(2) / 000000000000000000000b /
+c
+c data diver(1) / 376434000000000000000b /
+c data diver(2) / 000000000000000000000b /
+c
+c data log10(1) / 377774642023241175717b /
+c data log10(2) / 000007571421742254654b /
+c
+c machine constants for the data general eclipse s/200
+c
+c note - it may be appropriate to include the following card -
+c static dmach(5)
+c
+c data small/20k,3*0/,large/77777k,3*177777k/
+c data right/31420k,3*0/,diver/32020k,3*0/
+c data log10/40423k,42023k,50237k,74776k/
+c
+c machine constants for the harris slash 6 and slash 7
+c
+c data small(1),small(2) / '20000000, '00000201 /
+c data large(1),large(2) / '37777777, '37777577 /
+c data right(1),right(2) / '20000000, '00000333 /
+c data diver(1),diver(2) / '20000000, '00000334 /
+c data log10(1),log10(2) / '23210115, '10237777 /
+c
+c machine constants for the honeywell 600/6000 series.
+c
+c data small(1),small(2) / o402400000000, o000000000000 /
+c data large(1),large(2) / o376777777777, o777777777777 /
+c data right(1),right(2) / o604400000000, o000000000000 /
+c data diver(1),diver(2) / o606400000000, o000000000000 /
+c data log10(1),log10(2) / o776464202324, o117571775714 /
+c
+c machine constants for the ibm 360/370 series,
+c the xerox sigma 5/7/9 and the sel systems 85/86.
+c
+c data small(1),small(2) / z00100000, z00000000 /
+c data large(1),large(2) / z7fffffff, zffffffff /
+c data right(1),right(2) / z33100000, z00000000 /
+c data diver(1),diver(2) / z34100000, z00000000 /
+c data log10(1),log10(2) / z41134413, z509f79ff /
+c
+c machine constants for the pdp-10 (ka processor).
+c
+c data small(1),small(2) / "033400000000, "000000000000 /
+c data large(1),large(2) / "377777777777, "344777777777 /
+c data right(1),right(2) / "113400000000, "000000000000 /
+c data diver(1),diver(2) / "114400000000, "000000000000 /
+c data log10(1),log10(2) / "177464202324, "144117571776 /
+c
+c machine constants for the pdp-10 (ki processor).
+c
+c data small(1),small(2) / "000400000000, "000000000000 /
+c data large(1),large(2) / "377777777777, "377777777777 /
+c data right(1),right(2) / "103400000000, "000000000000 /
+c data diver(1),diver(2) / "104400000000, "000000000000 /
+c data log10(1),log10(2) / "177464202324, "476747767461 /
+c
+c machine constants for pdp-11 fortran's supporting
+c 32-bit integers (expressed in integer and octal).
+c
+ data small(1),small(2) / 8388608, 0 /
+ data large(1),large(2) / 2147483647, -1 /
+ data right(1),right(2) / 612368384, 0 /
+ data diver(1),diver(2) / 620756992, 0 /
+ data log10(1),log10(2) / 1067065498, -2063872008 /
+c
+c data small(1),small(2) / o00040000000, o00000000000 /
+c data large(1),large(2) / o17777777777, o37777777777 /
+c data right(1),right(2) / o04440000000, o00000000000 /
+c data diver(1),diver(2) / o04500000000, o00000000000 /
+c data log10(1),log10(2) / o07746420232, o20476747770 /
+c
+c machine constants for pdp-11 fortran's supporting
+c 16-bit integers (expressed in integer and octal).
+c
+c data small(1),small(2) / 128, 0 /
+c data small(3),small(4) / 0, 0 /
+c
+c data large(1),large(2) / 32767, -1 /
+c data large(3),large(4) / -1, -1 /
+c
+c data right(1),right(2) / 9344, 0 /
+c data right(3),right(4) / 0, 0 /
+c
+c data diver(1),diver(2) / 9472, 0 /
+c data diver(3),diver(4) / 0, 0 /
+c
+c data log10(1),log10(2) / 16282, 8346 /
+c data log10(3),log10(4) / -31493, -12296 /
+c
+c data small(1),small(2) / o000200, o000000 /
+c data small(3),small(4) / o000000, o000000 /
+c
+c data large(1),large(2) / o077777, o177777 /
+c data large(3),large(4) / o177777, o177777 /
+c
+c data right(1),right(2) / o022200, o000000 /
+c data right(3),right(4) / o000000, o000000 /
+c
+c data diver(1),diver(2) / o022400, o000000 /
+c data diver(3),diver(4) / o000000, o000000 /
+c
+c data log10(1),log10(2) / o037632, o020232 /
+c data log10(3),log10(4) / o102373, o147770 /
+c
+c machine constants for the univac 1100 series.
+c
+c data small(1),small(2) / o000040000000, o000000000000 /
+c data large(1),large(2) / o377777777777, o777777777777 /
+c data right(1),right(2) / o170540000000, o000000000000 /
+c data diver(1),diver(2) / o170640000000, o000000000000 /
+c data log10(1),log10(2) / o177746420232, o411757177572 /
+c
+c machine constants for the vax-11 with
+c fortran iv-plus compiler
+c
+c data small(1),small(2) / z00000080, z00000000 /
+c data large(1),large(2) / zffff7fff, zffffffff /
+c data right(1),right(2) / z00002480, z00000000 /
+c data diver(1),diver(2) / z00002500, z00000000 /
+c data log10(1),log10(2) / z209a3f9a, zcffa84fb /
+c
+ if (i .lt. 1 .or. i .gt. 5) goto 100
+c
+ d1mach = dmach(i)
+ return
+c
+ 100 iwunit = i1mach(4)
+ write(iwunit, 99)
+ 99 format(24hd1mach - i out of bounds)
+ stop
+ end
diff --git a/math/ieee/i1mach.f b/math/ieee/i1mach.f
new file mode 100644
index 00000000..e7b9af2b
--- /dev/null
+++ b/math/ieee/i1mach.f
@@ -0,0 +1,382 @@
+c
+c----------------------------------------------------------------------
+c function: i1mach
+c this routine is from the port mathematical subroutine library
+c it is described in the bell laboratories computing science
+c technical report #47 by p.a. fox, a.d. hall and n.l. schryer
+c---------------------------------------------------------------------
+c
+ integer function i1mach(i)
+c
+c i/o unit numbers.
+c
+c i1mach( 1) = the standard input unit.
+c
+c i1mach( 2) = the standard output unit.
+c
+c i1mach( 3) = the standard punch unit.
+c
+c i1mach( 4) = the standard error message unit.
+c
+c words.
+c
+c i1mach( 5) = the number of bits per integer storage unit.
+c
+c i1mach( 6) = the number of characters per integer storage unit.
+c
+c integers.
+c
+c assume integers are represented in the s-digit, base-a form
+c
+c sign ( x(s-1)*a**(s-1) + ... + x(1)*a + x(0) )
+c
+c where 0 .le. x(i) .lt. a for i=0,...,s-1.
+c
+c i1mach( 7) = a, the base.
+c
+c i1mach( 8) = s, the number of base-a digits.
+c
+c i1mach( 9) = a**s - 1, the largest magnitude.
+c
+c floating-point numbers.
+c
+c assume floating-point numbers are represented in the t-digit,
+c base-b form
+c
+c sign (b**e)*( (x(1)/b) + ... + (x(t)/b**t) )
+c
+c where 0 .le. x(i) .lt. b for i=1,...,t,
+c 0 .lt. x(1), and emin .le. e .le. emax.
+c
+c i1mach(10) = b, the base.
+c
+c single-precision
+c
+c i1mach(11) = t, the number of base-b digits.
+c
+c i1mach(12) = emin, the smallest exponent e.
+c
+c i1mach(13) = emax, the largest exponent e.
+c
+c double-precision
+c
+c i1mach(14) = t, the number of base-b digits.
+c
+c i1mach(15) = emin, the smallest exponent e.
+c
+c i1mach(16) = emax, the largest exponent e.
+c
+c to alter this function for a particular environment,
+c the desired set of data statements should be activated by
+c removing the c from column 1. also, the values of
+c i1mach(1) - i1mach(4) should be checked for consistency
+c with the local operating system.
+c
+ integer imach(16),output
+c
+ equivalence (imach(4),output)
+c
+c machine constants for the burroughs 1700 system.
+c
+c data imach( 1) / 7 /
+c data imach( 2) / 2 /
+c data imach( 3) / 2 /
+c data imach( 4) / 2 /
+c data imach( 5) / 36 /
+c data imach( 6) / 4 /
+c data imach( 7) / 2 /
+c data imach( 8) / 33 /
+c data imach( 9) / z1ffffffff /
+c data imach(10) / 2 /
+c data imach(11) / 24 /
+c data imach(12) / -256 /
+c data imach(13) / 255 /
+c data imach(14) / 60 /
+c data imach(15) / -256 /
+c data imach(16) / 255 /
+c
+c machine constants for the burroughs 5700 system.
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 7 /
+c data imach( 4) / 6 /
+c data imach( 5) / 48 /
+c data imach( 6) / 6 /
+c data imach( 7) / 2 /
+c data imach( 8) / 39 /
+c data imach( 9) / o0007777777777777 /
+c data imach(10) / 8 /
+c data imach(11) / 13 /
+c data imach(12) / -50 /
+c data imach(13) / 76 /
+c data imach(14) / 26 /
+c data imach(15) / -50 /
+c data imach(16) / 76 /
+c
+c machine constants for the burroughs 6700/7700 systems.
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 7 /
+c data imach( 4) / 6 /
+c data imach( 5) / 48 /
+c data imach( 6) / 6 /
+c data imach( 7) / 2 /
+c data imach( 8) / 39 /
+c data imach( 9) / o0007777777777777 /
+c data imach(10) / 8 /
+c data imach(11) / 13 /
+c data imach(12) / -50 /
+c data imach(13) / 76 /
+c data imach(14) / 26 /
+c data imach(15) / -32754 /
+c data imach(16) / 32780 /
+c
+c machine constants for the cdc 6000/7000 series.
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 7 /
+c data imach( 4) / 6 /
+c data imach( 5) / 60 /
+c data imach( 6) / 10 /
+c data imach( 7) / 2 /
+c data imach( 8) / 48 /
+c data imach( 9) / 00007777777777777777b /
+c data imach(10) / 2 /
+c data imach(11) / 48 /
+c data imach(12) / -974 /
+c data imach(13) / 1070 /
+c data imach(14) / 96 /
+c data imach(15) / -927 /
+c data imach(16) / 1070 /
+c
+c machine constants for the cray 1
+c
+c data imach( 1) / 100 /
+c data imach( 2) / 101 /
+c data imach( 3) / 102 /
+c data imach( 4) / 101 /
+c data imach( 5) / 64 /
+c data imach( 6) / 8 /
+c data imach( 7) / 2 /
+c data imach( 8) / 63 /
+c data imach( 9) / 777777777777777777777b /
+c data imach(10) / 2 /
+c data imach(11) / 47 /
+c data imach(12) / -8192 /
+c data imach(13) / 8190 /
+c data imach(14) / 95 /
+c data imach(15) / -8192 /
+c data imach(16) / 8190 /
+c
+c machine constants for the data general eclipse s/200
+c
+c data imach( 1) / 11 /
+c data imach( 2) / 12 /
+c data imach( 3) / 8 /
+c data imach( 4) / 10 /
+c data imach( 5) / 16 /
+c data imach( 6) / 2 /
+c data imach( 7) / 2 /
+c data imach( 8) / 15 /
+c data imach( 9) /32767 /
+c data imach(10) / 16 /
+c data imach(11) / 6 /
+c data imach(12) / -64 /
+c data imach(13) / 63 /
+c data imach(14) / 14 /
+c data imach(15) / -64 /
+c data imach(16) / 63 /
+c
+c machine constants for the harris slash 6 and slash 7
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 0 /
+c data imach( 4) / 6 /
+c data imach( 5) / 24 /
+c data imach( 6) / 3 /
+c data imach( 7) / 2 /
+c data imach( 8) / 23 /
+c data imach( 9) / 8388607 /
+c data imach(10) / 2 /
+c data imach(11) / 23 /
+c data imach(12) / -127 /
+c data imach(13) / 127 /
+c data imach(14) / 38 /
+c data imach(15) / -127 /
+c data imach(16) / 127 /
+c
+c machine constants for the honeywell 600/6000 series.
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 43 /
+c data imach( 4) / 6 /
+c data imach( 5) / 36 /
+c data imach( 6) / 6 /
+c data imach( 7) / 2 /
+c data imach( 8) / 35 /
+c data imach( 9) / o377777777777 /
+c data imach(10) / 2 /
+c data imach(11) / 27 /
+c data imach(12) / -127 /
+c data imach(13) / 127 /
+c data imach(14) / 63 /
+c data imach(15) / -127 /
+c data imach(16) / 127 /
+c
+c machine constants for the ibm 360/370 series,
+c the xerox sigma 5/7/9 and the sel systems 85/86.
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 7 /
+c data imach( 4) / 6 /
+c data imach( 5) / 32 /
+c data imach( 6) / 4 /
+c data imach( 7) / 2 /
+c data imach( 8) / 31 /
+c data imach( 9) / z7fffffff /
+c data imach(10) / 16 /
+c data imach(11) / 6 /
+c data imach(12) / -64 /
+c data imach(13) / 63 /
+c data imach(14) / 14 /
+c data imach(15) / -64 /
+c data imach(16) / 63 /
+c
+c machine constants for the pdp-10 (ka processor).
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 5 /
+c data imach( 4) / 6 /
+c data imach( 5) / 36 /
+c data imach( 6) / 5 /
+c data imach( 7) / 2 /
+c data imach( 8) / 35 /
+c data imach( 9) / "377777777777 /
+c data imach(10) / 2 /
+c data imach(11) / 27 /
+c data imach(12) / -128 /
+c data imach(13) / 127 /
+c data imach(14) / 54 /
+c data imach(15) / -101 /
+c data imach(16) / 127 /
+c
+c machine constants for the pdp-10 (ki processor).
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 5 /
+c data imach( 4) / 6 /
+c data imach( 5) / 36 /
+c data imach( 6) / 5 /
+c data imach( 7) / 2 /
+c data imach( 8) / 35 /
+c data imach( 9) / "377777777777 /
+c data imach(10) / 2 /
+c data imach(11) / 27 /
+c data imach(12) / -128 /
+c data imach(13) / 127 /
+c data imach(14) / 62 /
+c data imach(15) / -128 /
+c data imach(16) / 127 /
+c
+c machine constants for pdp-11 fortran supporting
+c 32-bit integer arithmetic.
+c
+ data imach( 1) / 5 /
+ data imach( 2) / 6 /
+ data imach( 3) / 6 /
+ data imach( 4) / 0 /
+ data imach( 5) / 32 /
+ data imach( 6) / 4 /
+ data imach( 7) / 2 /
+ data imach( 8) / 31 /
+ data imach( 9) / 2147483647 /
+ data imach(10) / 2 /
+ data imach(11) / 24 /
+ data imach(12) / -127 /
+ data imach(13) / 127 /
+ data imach(14) / 56 /
+ data imach(15) / -127 /
+ data imach(16) / 127 /
+c
+c machine constants for pdp-11 fortran supporting
+c 16-bit integer arithmetic.
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 5 /
+c data imach( 4) / 6 /
+c data imach( 5) / 16 /
+c data imach( 6) / 2 /
+c data imach( 7) / 2 /
+c data imach( 8) / 15 /
+c data imach( 9) / 32767 /
+c data imach(10) / 2 /
+c data imach(11) / 24 /
+c data imach(12) / -127 /
+c data imach(13) / 127 /
+c data imach(14) / 56 /
+c data imach(15) / -127 /
+c data imach(16) / 127 /
+c
+c machine constants for the univac 1100 series.
+c
+c note that the punch unit, i1mach(3), has been set to 7
+c which is appropriate for the univac-for system.
+c if you have the univac-ftn system, set it to 1.
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 7 /
+c data imach( 4) / 6 /
+c data imach( 5) / 36 /
+c data imach( 6) / 6 /
+c data imach( 7) / 2 /
+c data imach( 8) / 35 /
+c data imach( 9) / o377777777777 /
+c data imach(10) / 2 /
+c data imach(11) / 27 /
+c data imach(12) / -128 /
+c data imach(13) / 127 /
+c data imach(14) / 60 /
+c data imach(15) /-1024 /
+c data imach(16) / 1023 /
+c
+c machine constants for the vax-11 with
+c fortran iv-plus compiler
+c
+c data imach( 1) / 5 /
+c data imach( 2) / 6 /
+c data imach( 3) / 5 /
+c data imach( 4) / 6 /
+c data imach( 5) / 32 /
+c data imach( 6) / 4 /
+c data imach( 7) / 2 /
+c data imach( 8) / 31 /
+c data imach( 9) / 2147483647 /
+c data imach(10) / 2 /
+c data imach(11) / 24 /
+c data imach(12) / -127 /
+c data imach(13) / 127 /
+c data imach(14) / 56 /
+c data imach(15) / -127 /
+c data imach(16) / 127 /
+c
+ if (i .lt. 1 .or. i .gt. 16) go to 10
+c
+ i1mach=imach(i)
+ return
+c
+ 10 write(output,9000)
+ 9000 format(39h1error 1 in i1mach - i out of bounds)
+c
+ stop
+c
+ end
diff --git a/math/ieee/r1mach.f b/math/ieee/r1mach.f
new file mode 100644
index 00000000..db71aa68
--- /dev/null
+++ b/math/ieee/r1mach.f
@@ -0,0 +1,177 @@
+c
+c----------------------------------------------------------------------
+c function: r1mach
+c this routine is from the port mathematical subroutine library
+c it is described in the bell laboratories computing science
+c technical report #47 by p.a. fox, a.d. hall and n.l. schryer
+c a modification to the "i out of bounds" error message
+c has been made by c. a. mcgonegal - april, 1978
+c----------------------------------------------------------------------
+c
+ real function r1mach(i)
+c
+c single-precision machine constants
+c
+c r1mach(1) = b**(emin-1), the smallest positive magnitude.
+c
+c r1mach(2) = b**emax*(1 - b**(-t)), the largest magnitude.
+c
+c r1mach(3) = b**(-t), the smallest relative spacing.
+c
+c r1mach(4) = b**(1-t), the largest relative spacing.
+c
+c r1mach(5) = log10(b)
+c
+c to alter this function for a particular environment,
+c the desired set of data statements should be activated by
+c removing the c from column 1.
+c
+c where possible, octal or hexadecimal constants have been used
+c to specify the constants exactly which has in some cases
+c required the use of equivalent integer arrays.
+c
+ integer small(2)
+ integer large(2)
+ integer right(2)
+ integer diver(2)
+ integer log10(2)
+c
+ real rmach(5)
+c
+ equivalence (rmach(1),small(1))
+ equivalence (rmach(2),large(1))
+ equivalence (rmach(3),right(1))
+ equivalence (rmach(4),diver(1))
+ equivalence (rmach(5),log10(1))
+c
+c machine constants for the burroughs 1700 system.
+c
+c data rmach(1) / z400800000 /
+c data rmach(2) / z5ffffffff /
+c data rmach(3) / z4e9800000 /
+c data rmach(4) / z4ea800000 /
+c data rmach(5) / z500e730e8 /
+c
+c machine constants for the burroughs 5700/6700/7700 systems.
+c
+c data rmach(1) / o1771000000000000 /
+c data rmach(2) / o0777777777777777 /
+c data rmach(3) / o1311000000000000 /
+c data rmach(4) / o1301000000000000 /
+c data rmach(5) / o1157163034761675 /
+c
+c machine constants for the cdc 6000/7000 series.
+c
+c data rmach(1) / 00014000000000000000b /
+c data rmach(2) / 37767777777777777777b /
+c data rmach(3) / 16404000000000000000b /
+c data rmach(4) / 16414000000000000000b /
+c data rmach(5) / 17164642023241175720b /
+c
+c machine constants for the cray 1
+c
+c data rmach(1) / 200004000000000000000b /
+c data rmach(2) / 577767777777777777776b /
+c data rmach(3) / 377224000000000000000b /
+c data rmach(4) / 377234000000000000000b /
+c data rmach(5) / 377774642023241175720b /
+c
+c machine constants for the data general eclipse s/200
+c
+c note - it may be appropriate to include the following card -
+c static rmach(5)
+c
+c data small/20k,0/,large/77777k,177777k/
+c data right/35420k,0/,diver/36020k,0/
+c data log10/40423k,42023k/
+c
+c machine constants for the harris slash 6 and slash 7
+c
+c data small(1),small(2) / '20000000, '00000201 /
+c data large(1),large(2) / '37777777, '00000177 /
+c data right(1),right(2) / '20000000, '00000352 /
+c data diver(1),diver(2) / '20000000, '00000353 /
+c data log10(1),log10(2) / '23210115, '00000377 /
+c
+c machine constants for the honeywell 600/6000 series.
+c
+c data rmach(1) / o402400000000 /
+c data rmach(2) / o376777777777 /
+c data rmach(3) / o714400000000 /
+c data rmach(4) / o716400000000 /
+c data rmach(5) / o776464202324 /
+c
+c machine constants for the ibm 360/370 series,
+c the xerox sigma 5/7/9 and the sel systems 85/86.
+c
+c data rmach(1) / z00100000 /
+c data rmach(2) / z7fffffff /
+c data rmach(3) / z3b100000 /
+c data rmach(4) / z3c100000 /
+c data rmach(5) / z41134413 /
+c
+c machine constants for the pdp-10 (ka or ki processor).
+c
+c data rmach(1) / "000400000000 /
+c data rmach(2) / "377777777777 /
+c data rmach(3) / "146400000000 /
+c data rmach(4) / "147400000000 /
+c data rmach(5) / "177464202324 /
+c
+c machine constants for pdp-11 fortran's supporting
+c 32-bit integers (expressed in integer and octal).
+c
+ data small(1) / 8388608 /
+ data large(1) / 2147483647 /
+ data right(1) / 880803840 /
+ data diver(1) / 889192448 /
+ data log10(1) / 1067065499 /
+c
+c data rmach(1) / o00040000000 /
+c data rmach(2) / o17777777777 /
+c data rmach(3) / o06440000000 /
+c data rmach(4) / o06500000000 /
+c data rmach(5) / o07746420233 /
+c
+c machine constants for pdp-11 fortran's supporting
+c 16-bit integers (expressed in integer and octal).
+c
+c data small(1),small(2) / 128, 0 /
+c data large(1),large(2) / 32767, -1 /
+c data right(1),right(2) / 13440, 0 /
+c data diver(1),diver(2) / 13568, 0 /
+c data log10(1),log10(2) / 16282, 8347 /
+c
+c data small(1),small(2) / o000200, o000000 /
+c data large(1),large(2) / o077777, o177777 /
+c data right(1),right(2) / o032200, o000000 /
+c data diver(1),diver(2) / o032400, o000000 /
+c data log10(1),log10(2) / o037632, o020233 /
+c
+c machine constants for the univac 1100 series.
+c
+c data rmach(1) / o000400000000 /
+c data rmach(2) / o377777777777 /
+c data rmach(3) / o146400000000 /
+c data rmach(4) / o147400000000 /
+c data rmach(5) / o177464202324 /
+c
+c machine constants for the vax-11 with
+c fortran iv-plus compiler
+c
+c data rmach(1) / z00000080 /
+c data rmach(2) / zffff7fff /
+c data rmach(3) / z00003480 /
+c data rmach(4) / z00003500 /
+c data rmach(5) / z209b3f9a /
+c
+ if (i .lt. 1 .or. i .gt. 5) goto 100
+c
+ r1mach = rmach(i)
+ return
+c
+ 100 iwunit = i1mach(4)
+ write(iwunit, 99)
+ 99 format(24hr1mach - i out of bounds)
+ stop
+ end
diff --git a/math/ieee/uni.c b/math/ieee/uni.c
new file mode 100644
index 00000000..8e76c099
--- /dev/null
+++ b/math/ieee/uni.c
@@ -0,0 +1,8 @@
+/* Copyright(c) 1986 Association of Universities for Research in Astronomy Inc.
+ */
+
+float uni_(dummy)
+float *dummy;
+{
+ return(rand()/ 2147483648.0); /* return a real [0.0, 1.0) */
+}